diff --git a/.gemini/settings.json b/.gemini/settings.json index 715d896d9..ab9a0fc75 100644 --- a/.gemini/settings.json +++ b/.gemini/settings.json @@ -1,4 +1,7 @@ { + "context": { + "fileName": "/.prompts/llm.md" + }, "mcpServers": { "dart": { "command": "dart", @@ -6,6 +9,5 @@ "mcp-server" ] } - }, - "contextFileName": "/.prompts/llm.md" -} + } +} \ No newline at end of file diff --git a/.gemini/settings.json.orig b/.gemini/settings.json.orig new file mode 100644 index 000000000..715d896d9 --- /dev/null +++ b/.gemini/settings.json.orig @@ -0,0 +1,11 @@ +{ + "mcpServers": { + "dart": { + "command": "dart", + "args": [ + "mcp-server" + ] + } + }, + "contextFileName": "/.prompts/llm.md" +} diff --git a/.github/workflows/beta.yml b/.github/workflows/beta.yml index bb03070fb..2d441fed3 100644 --- a/.github/workflows/beta.yml +++ b/.github/workflows/beta.yml @@ -26,8 +26,8 @@ jobs: matrix: os: [ubuntu-latest, macos-latest, windows-latest] steps: - - uses: actions/checkout@8e8c483db84b4bee98b60c0593521ed34d9990e8 - - uses: actions/setup-java@f2beeb24e141e01a676f977032f5a29d81c9e27e + - uses: actions/checkout@de0fac2e4500dabe0009e67214ff5f5447ce83dd + - uses: actions/setup-java@be666c2fcd27ec809703dec50e508c2fdc7f6654 with: distribution: 'zulu' java-version: '17' @@ -42,8 +42,8 @@ jobs: runs-on: ubuntu-latest if: github.repository == 'flutter/samples' steps: - - uses: actions/checkout@8e8c483db84b4bee98b60c0593521ed34d9990e8 - - uses: actions/setup-java@f2beeb24e141e01a676f977032f5a29d81c9e27e + - uses: actions/checkout@de0fac2e4500dabe0009e67214ff5f5447ce83dd + - uses: actions/setup-java@be666c2fcd27ec809703dec50e508c2fdc7f6654 with: distribution: 'zulu' java-version: '17' @@ -58,8 +58,8 @@ jobs: # runs-on: macos-latest # if: github.repository == 'flutter/samples' # steps: - # - uses: actions/checkout@8e8c483db84b4bee98b60c0593521ed34d9990e8 - # - uses: actions/setup-java@f2beeb24e141e01a676f977032f5a29d81c9e27e + # - uses: actions/checkout@de0fac2e4500dabe0009e67214ff5f5447ce83dd + # - uses: actions/setup-java@be666c2fcd27ec809703dec50e508c2fdc7f6654 # with: # distribution: 'zulu' # java-version: '17' diff --git a/.github/workflows/build-android.yml b/.github/workflows/build-android.yml index a9018d7e9..e88b2a3fd 100644 --- a/.github/workflows/build-android.yml +++ b/.github/workflows/build-android.yml @@ -19,8 +19,8 @@ jobs: runs-on: ubuntu-latest if: github.repository == 'flutter/samples' steps: - - uses: actions/checkout@8e8c483db84b4bee98b60c0593521ed34d9990e8 - - uses: actions/setup-java@f2beeb24e141e01a676f977032f5a29d81c9e27e + - uses: actions/checkout@de0fac2e4500dabe0009e67214ff5f5447ce83dd + - uses: actions/setup-java@be666c2fcd27ec809703dec50e508c2fdc7f6654 with: distribution: 'zulu' java-version: '17' diff --git a/.github/workflows/build-ios.yml b/.github/workflows/build-ios.yml index c34b9eda9..91e222a7b 100644 --- a/.github/workflows/build-ios.yml +++ b/.github/workflows/build-ios.yml @@ -22,8 +22,8 @@ jobs: strategy: fail-fast: false steps: - - uses: actions/checkout@8e8c483db84b4bee98b60c0593521ed34d9990e8 - - uses: actions/setup-java@f2beeb24e141e01a676f977032f5a29d81c9e27e + - uses: actions/checkout@de0fac2e4500dabe0009e67214ff5f5447ce83dd + - uses: actions/setup-java@be666c2fcd27ec809703dec50e508c2fdc7f6654 with: distribution: 'zulu' java-version: '17' diff --git a/.github/workflows/gemini-cli.yml b/.github/workflows/gemini-cli.yml index b1d7adfda..ed4e1fdfa 100644 --- a/.github/workflows/gemini-cli.yml +++ b/.github/workflows/gemini-cli.yml @@ -144,7 +144,7 @@ jobs: - name: 'Checkout PR branch' if: |- ${{ steps.get_context.outputs.is_pr == 'true' }} - uses: 'actions/checkout@8e8c483db84b4bee98b60c0593521ed34d9990e8' # ratchet:actions/checkout@v4 + uses: 'actions/checkout@de0fac2e4500dabe0009e67214ff5f5447ce83dd' # ratchet:actions/checkout@v4 with: token: '${{ steps.generate_token.outputs.token || secrets.GITHUB_TOKEN }}' repository: '${{ github.repository }}' @@ -154,7 +154,7 @@ jobs: - name: 'Checkout main branch' if: |- ${{ steps.get_context.outputs.is_pr == 'false' }} - uses: 'actions/checkout@8e8c483db84b4bee98b60c0593521ed34d9990e8' # ratchet:actions/checkout@v4 + uses: 'actions/checkout@de0fac2e4500dabe0009e67214ff5f5447ce83dd' # ratchet:actions/checkout@v4 with: token: '${{ steps.generate_token.outputs.token || secrets.GITHUB_TOKEN }}' repository: '${{ github.repository }}' diff --git a/.github/workflows/gemini-issue-automated-triage.yml b/.github/workflows/gemini-issue-automated-triage.yml index 4cb9c18f2..c76997958 100644 --- a/.github/workflows/gemini-issue-automated-triage.yml +++ b/.github/workflows/gemini-issue-automated-triage.yml @@ -44,7 +44,7 @@ jobs: steps: - name: 'Checkout repository' - uses: 'actions/checkout@8e8c483db84b4bee98b60c0593521ed34d9990e8' # ratchet:actions/checkout@v4 + uses: 'actions/checkout@de0fac2e4500dabe0009e67214ff5f5447ce83dd' # ratchet:actions/checkout@v4 - name: 'Generate GitHub App Token' id: 'generate_token' diff --git a/.github/workflows/gemini-issue-scheduled-triage.yml b/.github/workflows/gemini-issue-scheduled-triage.yml index 4b0112f98..10f002378 100644 --- a/.github/workflows/gemini-issue-scheduled-triage.yml +++ b/.github/workflows/gemini-issue-scheduled-triage.yml @@ -26,7 +26,7 @@ jobs: steps: - name: 'Checkout repository' - uses: 'actions/checkout@8e8c483db84b4bee98b60c0593521ed34d9990e8' # ratchet:actions/checkout@v4 + uses: 'actions/checkout@de0fac2e4500dabe0009e67214ff5f5447ce83dd' # ratchet:actions/checkout@v4 - name: 'Generate GitHub App Token' id: 'generate_token' diff --git a/.github/workflows/gemini-pr-review.yml b/.github/workflows/gemini-pr-review.yml index 0f19cc2ea..0405735b1 100644 --- a/.github/workflows/gemini-pr-review.yml +++ b/.github/workflows/gemini-pr-review.yml @@ -66,7 +66,7 @@ jobs: steps: - name: 'Checkout PR code' - uses: 'actions/checkout@8e8c483db84b4bee98b60c0593521ed34d9990e8' # ratchet:actions/checkout@v4 + uses: 'actions/checkout@de0fac2e4500dabe0009e67214ff5f5447ce83dd' # ratchet:actions/checkout@v4 - name: 'Generate GitHub App Token' id: 'generate_token' diff --git a/.github/workflows/main.yml b/.github/workflows/main.yml index 661df563d..1b84ef177 100644 --- a/.github/workflows/main.yml +++ b/.github/workflows/main.yml @@ -27,8 +27,8 @@ jobs: flutter_version: [stable, beta] os: [ubuntu-latest, macos-latest] steps: - - uses: actions/checkout@8e8c483db84b4bee98b60c0593521ed34d9990e8 - - uses: actions/setup-java@f2beeb24e141e01a676f977032f5a29d81c9e27e + - uses: actions/checkout@de0fac2e4500dabe0009e67214ff5f5447ce83dd + - uses: actions/setup-java@be666c2fcd27ec809703dec50e508c2fdc7f6654 with: distribution: 'zulu' java-version: '17' diff --git a/add_to_app/android_view/content_sizing_android_view/.gitignore b/add_to_app/android_view/content_sizing_android_view/.gitignore new file mode 100644 index 000000000..aa724b770 --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/.gitignore @@ -0,0 +1,15 @@ +*.iml +.gradle +/local.properties +/.idea/caches +/.idea/libraries +/.idea/modules.xml +/.idea/workspace.xml +/.idea/navEditor.xml +/.idea/assetWizardSettings.xml +.DS_Store +/build +/captures +.externalNativeBuild +.cxx +local.properties diff --git a/add_to_app/android_view/content_sizing_android_view/README.md b/add_to_app/android_view/content_sizing_android_view/README.md new file mode 100644 index 000000000..3cf900235 --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/README.md @@ -0,0 +1,4 @@ +# android_view + +An example of an Android app that integrates a Flutter add-to-app module at a +view level. For more information see [../README.md](../README.md). diff --git a/add_to_app/android_view/content_sizing_android_view/app/.gitignore b/add_to_app/android_view/content_sizing_android_view/app/.gitignore new file mode 100644 index 000000000..42afabfd2 --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/app/.gitignore @@ -0,0 +1 @@ +/build \ No newline at end of file diff --git a/add_to_app/android_view/content_sizing_android_view/app/build.gradle b/add_to_app/android_view/content_sizing_android_view/app/build.gradle new file mode 100644 index 000000000..0797ed565 --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/app/build.gradle @@ -0,0 +1,58 @@ +plugins { + id 'com.android.application' + id 'kotlin-android' +} + +android { + compileSdk 36 + + lint { + baseline = file("lint-baseline.xml") + } + + defaultConfig { + applicationId "dev.flutter.example.androidView" + minSdkVersion 24 + targetSdk 36 + versionCode 1 + versionName "1.0" + + testInstrumentationRunner "androidx.test.runner.AndroidJUnitRunner" + } + + buildTypes { + release { + minifyEnabled false + proguardFiles getDefaultProguardFile('proguard-android-optimize.txt'), 'proguard-rules.pro' + } + } + compileOptions { + sourceCompatibility JavaVersion.VERSION_1_8 + targetCompatibility JavaVersion.VERSION_1_8 + } + kotlinOptions { + jvmTarget = '1.8' + } + buildFeatures { + viewBinding true + } + namespace 'dev.flutter.example.androidView' +} + +dependencies { + implementation "org.jetbrains.kotlin:kotlin-stdlib:$kotlin_version" + implementation 'androidx.core:core-ktx:1.13.1' + implementation 'androidx.appcompat:appcompat:1.7.0' + implementation 'com.google.android.material:material:1.12.0' + implementation 'androidx.constraintlayout:constraintlayout:2.1.4' + implementation 'androidx.vectordrawable:vectordrawable:1.2.0' + implementation 'androidx.lifecycle:lifecycle-livedata-ktx:2.8.4' + implementation 'androidx.lifecycle:lifecycle-viewmodel-ktx:2.8.4' + implementation 'androidx.navigation:navigation-fragment-ktx:2.7.7' + implementation 'androidx.navigation:navigation-ui-ktx:2.7.7' + implementation "androidx.recyclerview:recyclerview:1.3.2" + implementation project(path: ':flutter') + testImplementation 'junit:junit:4.+' + androidTestImplementation 'androidx.test.ext:junit:1.2.1' + androidTestImplementation 'androidx.test.espresso:espresso-core:3.6.1' +} diff --git a/add_to_app/android_view/content_sizing_android_view/app/lint-baseline.xml b/add_to_app/android_view/content_sizing_android_view/app/lint-baseline.xml new file mode 100644 index 000000000..18092041f --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/app/lint-baseline.xml @@ -0,0 +1,279 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/add_to_app/android_view/content_sizing_android_view/app/proguard-rules.pro b/add_to_app/android_view/content_sizing_android_view/app/proguard-rules.pro new file mode 100644 index 000000000..481bb4348 --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/app/proguard-rules.pro @@ -0,0 +1,21 @@ +# Add project specific ProGuard rules here. +# You can control the set of applied configuration files using the +# proguardFiles setting in build.gradle. +# +# For more details, see +# http://developer.android.com/guide/developing/tools/proguard.html + +# If your project uses WebView with JS, uncomment the following +# and specify the fully qualified class name to the JavaScript interface +# class: +#-keepclassmembers class fqcn.of.javascript.interface.for.webview { +# public *; +#} + +# Uncomment this to preserve the line number information for +# debugging stack traces. +#-keepattributes SourceFile,LineNumberTable + +# If you keep the line number information, uncomment this to +# hide the original source file name. +#-renamesourcefileattribute SourceFile \ No newline at end of file diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/AndroidManifest.xml b/add_to_app/android_view/content_sizing_android_view/app/src/main/AndroidManifest.xml new file mode 100644 index 000000000..16116cbfa --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/app/src/main/AndroidManifest.xml @@ -0,0 +1,26 @@ + + + + + + + + + + + + + + + diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/java/dev/flutter/example/androidView/FlutterViewEngine.kt b/add_to_app/android_view/content_sizing_android_view/app/src/main/java/dev/flutter/example/androidView/FlutterViewEngine.kt new file mode 100644 index 000000000..e0c96a1b2 --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/app/src/main/java/dev/flutter/example/androidView/FlutterViewEngine.kt @@ -0,0 +1,243 @@ +// Copyright 2019 The Flutter team. All rights reserved. +// Use of this source code is governed by a BSD-style license that can be +// found in the LICENSE file. + +package dev.flutter.example.androidView + +import android.app.Activity +import android.content.Intent +import androidx.activity.ComponentActivity +import androidx.lifecycle.Lifecycle +import androidx.lifecycle.LifecycleObserver +import androidx.lifecycle.OnLifecycleEvent +import io.flutter.embedding.android.ExclusiveAppComponent +import io.flutter.embedding.android.FlutterView +import io.flutter.embedding.engine.FlutterEngine +import io.flutter.plugin.platform.PlatformPlugin + +/** + * This is an application-specific wrapper class that exists to expose the intersection of an + * application's active activity and an application's visible view to a [FlutterEngine] for + * rendering. + * + * Omitted features from the [io.flutter.embedding.android.FlutterActivity] include: + * * **State restoration**. If you're integrating at the view level, you should handle activity + * state restoration yourself. + * * **Engine creations**. At this level of granularity, you must make an engine and attach. + * and all engine features like initial route etc must be configured on the engine yourself. + * * **Splash screens**. You must implement it yourself. Read from + * `addOnFirstFrameRenderedListener` as needed. + * * **Transparency, surface/texture**. These are just [FlutterView] level APIs. Set them on the + * [FlutterView] directly. + * * **Intents**. This doesn't do any translation of intents into actions in the [FlutterEngine]. + * you must do them yourself. + * * **Back buttons**. You must decide whether to send it to Flutter via + * [FlutterEngine.getNavigationChannel.popRoute()], or consume it natively. Though that + * decision may be difficult due to https://github.com/flutter/flutter/issues/67011. + * * **Low memory signals**. You're strongly encouraged to pass the low memory signals (such + * as from the host `Activity`'s `onTrimMemory` callbacks) to the [FlutterEngine] to let + * Flutter and the Dart VM cull its own memory usage. + * + * Your own [FlutterView] integrating application may need a similar wrapper but you must decide on + * what the appropriate intersection between the [FlutterView], the [FlutterEngine] and your + * `Activity` should be for your own application. + */ +class FlutterViewEngine(val engine: FlutterEngine) : LifecycleObserver, ExclusiveAppComponent{ + private var flutterView: FlutterView? = null + private var activity: ComponentActivity? = null + private var platformPlugin: PlatformPlugin? = null + + /** + * This is the intersection of an available activity and of a visible [FlutterView]. This is + * where Flutter would start rendering. + */ + private fun hookActivityAndView() { + // Assert state. + activity!!.let { activity -> + flutterView!!.let { flutterView -> + platformPlugin = PlatformPlugin(activity, engine.platformChannel) + + engine.activityControlSurface.attachToActivity(this, activity.lifecycle) + flutterView.attachToFlutterEngine(engine) + activity.lifecycle.addObserver(this) + } + } + } + + /** + * Lost the intersection of either an available activity or a visible + * [FlutterView]. + */ + private fun unhookActivityAndView() { + // Stop reacting to activity events. + activity!!.lifecycle.removeObserver(this) + + // Plugins are no longer attached to an activity. + engine.activityControlSurface.detachFromActivity() + + // Release Flutter's control of UI such as system chrome. + platformPlugin!!.destroy() + platformPlugin = null + + // Set Flutter's application state to detached. + engine.lifecycleChannel.appIsDetached(); + + // Detach rendering pipeline. + flutterView!!.detachFromFlutterEngine() + } + + /** + * Signal that a host `Activity` is now ready. If there is no [FlutterView] instance currently + * attached to the view hierarchy and visible, Flutter is not yet rendering. + * + * You can also choose at this point whether to notify the plugins that an `Activity` is + * attached or not. You can also choose at this point whether to connect a Flutter + * [PlatformPlugin] at this point which allows your Dart program to trigger things like + * haptic feedback and read the clipboard. This sample arbitrarily chooses no for both. + */ + fun attachToActivity(activity: ComponentActivity) { + this.activity = activity + if (flutterView != null) { + hookActivityAndView() + } + } + + /** + * Signal that a host `Activity` now no longer connected. If there were a [FlutterView] in + * the view hierarchy and visible at this moment, that [FlutterView] will stop rendering. + * + * You can also choose at this point whether to notify the plugins that an `Activity` is + * no longer attached or not. You can also choose at this point whether to disconnect Flutter's + * [PlatformPlugin] at this point which stops your Dart program being able to trigger things + * like haptic feedback and read the clipboard. This sample arbitrarily chooses yes for both. + */ + fun detachActivity() { + if (flutterView != null) { + unhookActivityAndView() + } + activity = null + } + + /** + * Signal that a [FlutterView] instance is created and attached to a visible Android view + * hierarchy. + * + * If an `Activity` was also previously provided, this puts Flutter into the rendering state + * for this [FlutterView]. This also connects this wrapper class to listen to the `Activity`'s + * lifecycle to pause rendering when the activity is put into the background while the + * view is still attached to the view hierarchy. + */ + fun attachFlutterView(flutterView: FlutterView) { + this.flutterView = flutterView + if (activity != null) { + hookActivityAndView() + } + } + + /** + * Signal that the attached [FlutterView] instance destroyed or no longer attached to a visible + * Android view hierarchy. + * + * If an `Activity` was attached, this stops Flutter from rendering. It also makes this wrapper + * class stop listening to the `Activity`'s lifecycle since it's no longer rendering. + */ + fun detachFlutterView() { + unhookActivityAndView() + flutterView = null + } + + /** + * Callback to let Flutter respond to the `Activity`'s resumed lifecycle event while both an + * `Activity` and a [FlutterView] are attached. + */ + @OnLifecycleEvent(Lifecycle.Event.ON_RESUME) + private fun resumeActivity() { + if (activity != null) { + engine.lifecycleChannel.appIsResumed() + } + + platformPlugin?.updateSystemUiOverlays() + } + + /** + * Callback to let Flutter respond to the `Activity`'s paused lifecycle event while both an + * `Activity` and a [FlutterView] are attached. + */ + @OnLifecycleEvent(Lifecycle.Event.ON_PAUSE) + private fun pauseActivity() { + if (activity != null) { + engine.lifecycleChannel.appIsInactive() + } + } + + /** + * Callback to let Flutter respond to the `Activity`'s stopped lifecycle event while both an + * `Activity` and a [FlutterView] are attached. + */ + @OnLifecycleEvent(Lifecycle.Event.ON_STOP) + private fun stopActivity() { + if (activity != null) { + engine.lifecycleChannel.appIsPaused() + } + } + + // These events aren't used but would be needed for Flutter plugins consuming + // these events to function. + + /** + * Pass through the `Activity`'s `onRequestPermissionsResult` signal to plugins that may be + * listening to it while the `Activity` and the [FlutterView] are connected. + */ + fun onRequestPermissionsResult( + requestCode: Int, + permissions: Array, + grantResults: IntArray + ) { + if (activity != null && flutterView != null) { + engine + .activityControlSurface + .onRequestPermissionsResult(requestCode, permissions, grantResults); + } + } + + /** + * Pass through the `Activity`'s `onActivityResult` signal to plugins that may be + * listening to it while the `Activity` and the [FlutterView] are connected. + */ + fun onActivityResult(requestCode: Int, resultCode: Int, data: Intent?) { + if (activity != null && flutterView != null) { + engine.activityControlSurface.onActivityResult(requestCode, resultCode, data); + } + } + + /** + * Pass through the `Activity`'s `onUserLeaveHint` signal to plugins that may be + * listening to it while the `Activity` and the [FlutterView] are connected. + */ + fun onUserLeaveHint() { + if (activity != null && flutterView != null) { + engine.activityControlSurface.onUserLeaveHint(); + } + } + + /** + * Called when another App Component is about to become attached to the [ ] this App Component + * is currently attached to. + * + * + * This App Component's connections to the [io.flutter.embedding.engine.FlutterEngine] + * are still valid at the moment of this call. + */ + override fun detachFromFlutterEngine() { + // Do nothing here + } + + /** + * Retrieve the App Component behind this exclusive App Component. + * + * @return The app component. + */ + override fun getAppComponent(): Activity { + return activity!!; + } +} diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/java/dev/flutter/example/androidView/ListAdapter.kt b/add_to_app/android_view/content_sizing_android_view/app/src/main/java/dev/flutter/example/androidView/ListAdapter.kt new file mode 100644 index 000000000..303329898 --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/app/src/main/java/dev/flutter/example/androidView/ListAdapter.kt @@ -0,0 +1,106 @@ +// Copyright 2019 The Flutter team. All rights reserved. +// Use of this source code is governed by a BSD-style license that can be +// found in the LICENSE file. + +package dev.flutter.example.androidView + +import android.content.Context +import android.util.Log +import android.view.LayoutInflater +import android.view.View +import android.view.ViewGroup +import androidx.recyclerview.widget.RecyclerView +import dev.flutter.example.androidView.databinding.AndroidCardBinding +import io.flutter.embedding.android.FlutterView +import java.util.* +import kotlin.random.Random + +/** + * A demo-specific implementation of a [RecyclerView.Adapter] to setup the demo environment used + * to display view-level Flutter cells inside a list. + * + * The only instructional parts of this class are to show when to call + * [FlutterViewEngine.attachFlutterView] and [FlutterViewEngine.detachActivity] on a + * [FlutterViewEngine] equivalent class that you may want to create in your own application. + */ +class ListAdapter(context: Context, private val flutterViewEngine: FlutterViewEngine) : RecyclerView.Adapter() { + // Save the previous cells determined to be Flutter cells to avoid a confusing visual effect + // that the Flutter cells change position when scrolling back. + var previousFlutterCells = TreeSet(); + + private val wrapContentLayout = ViewGroup.LayoutParams(ViewGroup.LayoutParams.MATCH_PARENT, ViewGroup.LayoutParams.WRAP_CONTENT) + + private val random = Random.Default + private val flutterView = FlutterView(context) + private var flutterCell: Cell? = null + + /** + * A [RecyclerView.ViewHolder] based on the `android_card` layout XML. + */ + inner class Cell(val binding: AndroidCardBinding) : RecyclerView.ViewHolder(binding.root) { + + } + + override fun onCreateViewHolder(viewGroup: ViewGroup, viewType: Int): Cell { + val binding = AndroidCardBinding.inflate(LayoutInflater.from(viewGroup.context), viewGroup, false) + + // Let the default view holder have an "Android card" inflated from the layout XML. When + // needed, hide the Android card and show a Flutter one instead. + return Cell(binding) + } + + override fun onBindViewHolder(cell: Cell, position: Int) { + // While scrolling forward, if no Flutter is presently showing, let the next one have a 1/3 + // chance of being Flutter. + // + // While scrolling backward, let it be deterministic, and only show cells that were + // previously Flutter cells as Flutter cells. + if (previousFlutterCells.contains(position) + || ((previousFlutterCells.isEmpty() || position > previousFlutterCells.last()) + && flutterCell == null + && random.nextInt(3) == 0)) { + // If we're restoring a cell at a previous location, the current cell may not have + // recycled yet since that JVM timing is indeterministic. Yank it from the current one. + // + // This shouldn't produce any visual glitches since in the forward direction, + // Flutter cells were only introduced once the previous Flutter cell recycled. + if (flutterCell != null) { + Log.w("FeedAdapter", "While restoring a previous Flutter cell, a current " + + "yet to be recycled Flutter cell was detached.") + flutterCell!!.binding.root.removeView(flutterView) + flutterViewEngine.detachFlutterView() + flutterCell = null + } + + // Add the Flutter card and hide the Android card for the cells chosen to be Flutter + // cells. + cell.binding.root.addView(flutterView, wrapContentLayout) + cell.binding.androidCard.visibility = View.GONE + + // Keep track of the cell so we know which one to restore back to the "Android cell" + // state when the view gets recycled. + flutterCell = cell + // Keep track that this position has once been a Flutter cell. Let it be a Flutter cell + // again when scrolling back to this position. + previousFlutterCells.add(position) + + // This is what makes the Flutter cell start rendering. + flutterViewEngine.attachFlutterView(flutterView) + } else { + // If it's not selected as a Flutter cell, just show the Android card. + cell.binding.androidCard.visibility = View.VISIBLE + cell.binding.cellNumber.text = position.toString(); + } + } + + override fun getItemCount() = 100 + + override fun onViewRecycled(cell: Cell) { + if (cell == flutterCell) { + cell.binding.root.removeView(flutterView) + flutterViewEngine.detachFlutterView() + flutterCell = null + } + super.onViewRecycled(cell) + } +} diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/java/dev/flutter/example/androidView/MainActivity.kt b/add_to_app/android_view/content_sizing_android_view/app/src/main/java/dev/flutter/example/androidView/MainActivity.kt new file mode 100644 index 000000000..0993288bb --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/app/src/main/java/dev/flutter/example/androidView/MainActivity.kt @@ -0,0 +1,118 @@ +// Copyright 2019 The Flutter team. All rights reserved. +// Use of this source code is governed by a BSD-style license that can be +// found in the LICENSE file. + +package dev.flutter.example.androidView + +import android.content.Intent +import android.os.Bundle +import android.os.Parcelable +import androidx.appcompat.app.AppCompatActivity +import androidx.core.os.BundleCompat +import androidx.recyclerview.widget.LinearLayoutManager +import dev.flutter.example.androidView.databinding.ActivityMainBinding +import io.flutter.FlutterInjector +import io.flutter.embedding.engine.FlutterEngine +import io.flutter.embedding.engine.dart.DartExecutor +import java.util.* +import kotlin.collections.ArrayList + +// There are 3 files in this sample. MainActivity and ListAdapter are just +// fictional setups. FlutterViewEngine is instructional and demonstrates the +// various plumbing needed for a functioning FlutterView integration. +/** + * Main activity for this demo that shows a page with a `RecyclerView`. + * + * There are 3 files in this sample. MainActivity and ListAdapter are just fictional setups. + * FlutterViewEngine is instructional and demonstrates the various plumbing needed for a functioning + * FlutterView integration. + */ +class MainActivity : AppCompatActivity() { + + private lateinit var binding: ActivityMainBinding + private lateinit var flutterViewEngine: FlutterViewEngine + + + override fun onCreate(savedInstanceState: Bundle?) { + super.onCreate(savedInstanceState) + + binding = ActivityMainBinding.inflate(layoutInflater) + setContentView(binding.root) + + // TODO: create a multi-engine version after + // https://github.com/flutter/flutter/issues/72009 is built. + val engine = FlutterEngine(applicationContext) + engine.dartExecutor.executeDartEntrypoint( + DartExecutor.DartEntrypoint( + FlutterInjector.instance().flutterLoader().findAppBundlePath(), + "main")) + + flutterViewEngine = FlutterViewEngine(engine) + // The activity and FlutterView have different lifecycles. + // Attach the activity right away but only start rendering when the + // view is also scrolled into the screen. + flutterViewEngine.attachToActivity(this) + + val layoutManager = LinearLayoutManager(this) + val recyclerView = binding.recyclerView + val adapter = ListAdapter(this, flutterViewEngine) + recyclerView.layoutManager = layoutManager + recyclerView.adapter = adapter + + // If the activity was restarted, keep track of the previous scroll + // position and of the previous cell indices that were randomly selected + // as Flutter cells to preserve immersion. + if (savedInstanceState != null) { + val state = BundleCompat.getParcelable( + savedInstanceState, + "layoutManager", + Parcelable::class.java + ) + layoutManager.onRestoreInstanceState(state) + } + val previousFlutterCellsArray = savedInstanceState?.getIntegerArrayList("adapter") + if (previousFlutterCellsArray != null) { + adapter.previousFlutterCells = TreeSet(previousFlutterCellsArray) + } + } + + override fun onSaveInstanceState(outState: Bundle) { + super.onSaveInstanceState(outState) + + outState.putParcelable("layoutManager", binding.recyclerView.layoutManager?.onSaveInstanceState()) + val previousFlutterCells = (binding.recyclerView.adapter as? ListAdapter)?.previousFlutterCells + if (previousFlutterCells != null) { + outState.putIntegerArrayList( + "adapter", + ArrayList(previousFlutterCells) + ) + } + } + + override fun onDestroy() { + super.onDestroy() + flutterViewEngine.detachActivity() + } + + // These below aren't used here in this demo but would be needed for Flutter plugins that may + // consume these events. + + override fun onRequestPermissionsResult( + requestCode: Int, + permissions: Array, + grantResults: IntArray + ) { + flutterViewEngine.onRequestPermissionsResult(requestCode, permissions, grantResults) + super.onRequestPermissionsResult(requestCode, permissions, grantResults) + } + + override fun onActivityResult(requestCode: Int, resultCode: Int, data: Intent?) { + flutterViewEngine.onActivityResult(requestCode, resultCode, data) + super.onActivityResult(requestCode, resultCode, data) + } + + override fun onUserLeaveHint() { + flutterViewEngine.onUserLeaveHint() + super.onUserLeaveHint() + } +} diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/res/drawable-v24/ic_launcher_foreground.xml b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/drawable-v24/ic_launcher_foreground.xml new file mode 100644 index 000000000..2b068d114 --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/drawable-v24/ic_launcher_foreground.xml @@ -0,0 +1,30 @@ + + + + + + + + + + + \ No newline at end of file diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/res/drawable/ic_dashboard_black_24dp.xml b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/drawable/ic_dashboard_black_24dp.xml new file mode 100644 index 000000000..46fc8deec --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/drawable/ic_dashboard_black_24dp.xml @@ -0,0 +1,9 @@ + + + diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/res/drawable/ic_home_black_24dp.xml b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/drawable/ic_home_black_24dp.xml new file mode 100644 index 000000000..f8bb0b556 --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/drawable/ic_home_black_24dp.xml @@ -0,0 +1,9 @@ + + + diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/res/drawable/ic_launcher_background.xml b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/drawable/ic_launcher_background.xml new file mode 100644 index 000000000..07d5da9cb --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/drawable/ic_launcher_background.xml @@ -0,0 +1,170 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/res/drawable/ic_notifications_black_24dp.xml b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/drawable/ic_notifications_black_24dp.xml new file mode 100644 index 000000000..78b75c39b --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/drawable/ic_notifications_black_24dp.xml @@ -0,0 +1,9 @@ + + + diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/res/layout/activity_main.xml b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/layout/activity_main.xml new file mode 100644 index 000000000..492a955dc --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/layout/activity_main.xml @@ -0,0 +1,13 @@ + + + + + + \ No newline at end of file diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/res/layout/android_card.xml b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/layout/android_card.xml new file mode 100644 index 000000000..3bf306bd1 --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/layout/android_card.xml @@ -0,0 +1,31 @@ + + + + + + + + + + + + diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-anydpi-v26/ic_launcher.xml b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-anydpi-v26/ic_launcher.xml new file mode 100644 index 000000000..eca70cfe5 --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-anydpi-v26/ic_launcher.xml @@ -0,0 +1,5 @@ + + + + + \ No newline at end of file diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-anydpi-v26/ic_launcher_round.xml b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-anydpi-v26/ic_launcher_round.xml new file mode 100644 index 000000000..eca70cfe5 --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-anydpi-v26/ic_launcher_round.xml @@ -0,0 +1,5 @@ + + + + + \ No newline at end of file diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-hdpi/ic_launcher.png b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-hdpi/ic_launcher.png new file mode 100644 index 000000000..a571e6009 Binary files /dev/null and b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-hdpi/ic_launcher.png differ diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-hdpi/ic_launcher_round.png b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-hdpi/ic_launcher_round.png new file mode 100644 index 000000000..61da551c5 Binary files /dev/null and b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-hdpi/ic_launcher_round.png differ diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-mdpi/ic_launcher.png b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-mdpi/ic_launcher.png new file mode 100644 index 000000000..c41dd2853 Binary files /dev/null and b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-mdpi/ic_launcher.png differ diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-mdpi/ic_launcher_round.png b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-mdpi/ic_launcher_round.png new file mode 100644 index 000000000..db5080a75 Binary files /dev/null and b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-mdpi/ic_launcher_round.png differ diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-xhdpi/ic_launcher.png b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-xhdpi/ic_launcher.png new file mode 100644 index 000000000..6dba46dab Binary files /dev/null and b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-xhdpi/ic_launcher.png differ diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-xhdpi/ic_launcher_round.png b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-xhdpi/ic_launcher_round.png new file mode 100644 index 000000000..da31a871c Binary files /dev/null and b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-xhdpi/ic_launcher_round.png differ diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-xxhdpi/ic_launcher.png b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-xxhdpi/ic_launcher.png new file mode 100644 index 000000000..15ac68172 Binary files /dev/null and b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-xxhdpi/ic_launcher.png differ diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-xxhdpi/ic_launcher_round.png b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-xxhdpi/ic_launcher_round.png new file mode 100644 index 000000000..b216f2d31 Binary files /dev/null and b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-xxhdpi/ic_launcher_round.png differ diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-xxxhdpi/ic_launcher.png b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-xxxhdpi/ic_launcher.png new file mode 100644 index 000000000..f25a41974 Binary files /dev/null and b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-xxxhdpi/ic_launcher.png differ diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-xxxhdpi/ic_launcher_round.png b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-xxxhdpi/ic_launcher_round.png new file mode 100644 index 000000000..e96783ccc Binary files /dev/null and b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/mipmap-xxxhdpi/ic_launcher_round.png differ diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/res/values-night/themes.xml b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/values-night/themes.xml new file mode 100644 index 000000000..82b8203a2 --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/values-night/themes.xml @@ -0,0 +1,16 @@ + + + + \ No newline at end of file diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/res/values/colors.xml b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/values/colors.xml new file mode 100644 index 000000000..f8c6127d3 --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/values/colors.xml @@ -0,0 +1,10 @@ + + + #FFBB86FC + #FF6200EE + #FF3700B3 + #FF03DAC5 + #FF018786 + #FF000000 + #FFFFFFFF + \ No newline at end of file diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/res/values/dimens.xml b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/values/dimens.xml new file mode 100644 index 000000000..e00c2dd14 --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/values/dimens.xml @@ -0,0 +1,5 @@ + + + 16dp + 16dp + \ No newline at end of file diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/res/values/strings.xml b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/values/strings.xml new file mode 100644 index 000000000..97b213769 --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/values/strings.xml @@ -0,0 +1,3 @@ + + Flutter View Content Sizing Integration + \ No newline at end of file diff --git a/add_to_app/android_view/content_sizing_android_view/app/src/main/res/values/themes.xml b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/values/themes.xml new file mode 100644 index 000000000..2d692a11c --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/app/src/main/res/values/themes.xml @@ -0,0 +1,16 @@ + + + + \ No newline at end of file diff --git a/add_to_app/android_view/content_sizing_android_view/build.gradle b/add_to_app/android_view/content_sizing_android_view/build.gradle new file mode 100644 index 000000000..f60b7c423 --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/build.gradle @@ -0,0 +1,26 @@ +// Top-level build file where you can add configuration options common to all sub-projects/modules. +buildscript { + ext.kotlin_version = '1.8.22' + repositories { + google() + mavenCentral() + } + dependencies { + classpath 'com.android.tools.build:gradle:8.9.1' + classpath "org.jetbrains.kotlin:kotlin-gradle-plugin:$kotlin_version" + + // NOTE: Do not place your application dependencies here; they belong + // in the individual module build.gradle files + } +} + +allprojects { + repositories { + google() + mavenCentral() + } +} + +tasks.register('clean', Delete) { + delete rootProject.buildDir +} diff --git a/add_to_app/android_view/content_sizing_android_view/gradle.properties b/add_to_app/android_view/content_sizing_android_view/gradle.properties new file mode 100644 index 000000000..c8ce6fbcc --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/gradle.properties @@ -0,0 +1,21 @@ +# Project-wide Gradle settings. +# IDE (e.g. Android Studio) users: +# Gradle settings configured through the IDE *will override* +# any settings specified in this file. +# For more details on how to configure your build environment visit +# http://www.gradle.org/docs/current/userguide/build_environment.html +# Specifies the JVM arguments used for the daemon process. +# The setting is particularly useful for tweaking memory settings. +org.gradle.jvmargs=-Xmx2048m -Dfile.encoding=UTF-8 +# When configured, Gradle will run in incubating parallel mode. +# This option should only be used with decoupled projects. More details, visit +# http://www.gradle.org/docs/current/userguide/multi_project_builds.html#sec:decoupled_projects +# org.gradle.parallel=true +# AndroidX package structure to make it clearer which packages are bundled with the +# Android operating system, and which are packaged with your app"s APK +# https://developer.android.com/topic/libraries/support-library/androidx-rn +android.useAndroidX=true +# Kotlin code style for this project: "official" or "obsolete": +kotlin.code.style=official +android.nonTransitiveRClass=false +android.nonFinalResIds=false \ No newline at end of file diff --git a/add_to_app/android_view/content_sizing_android_view/gradle/wrapper/gradle-wrapper.properties b/add_to_app/android_view/content_sizing_android_view/gradle/wrapper/gradle-wrapper.properties new file mode 100644 index 000000000..d7952dcde --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/gradle/wrapper/gradle-wrapper.properties @@ -0,0 +1,6 @@ +#Fri Jul 26 11:31:21 EDT 2024 +distributionBase=GRADLE_USER_HOME +distributionPath=wrapper/dists +distributionUrl=https\://services.gradle.org/distributions/gradle-8.11.1-bin.zip +zipStoreBase=GRADLE_USER_HOME +zipStorePath=wrapper/dists diff --git a/add_to_app/android_view/content_sizing_android_view/gradlew b/add_to_app/android_view/content_sizing_android_view/gradlew new file mode 100755 index 000000000..cccdd3d51 --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/gradlew @@ -0,0 +1,172 @@ +#!/usr/bin/env sh + +############################################################################## +## +## Gradle start up script for UN*X +## +############################################################################## + +# Attempt to set APP_HOME +# Resolve links: $0 may be a link +PRG="$0" +# Need this for relative symlinks. +while [ -h "$PRG" ] ; do + ls=`ls -ld "$PRG"` + link=`expr "$ls" : '.*-> \(.*\)$'` + if expr "$link" : '/.*' > /dev/null; then + PRG="$link" + else + PRG=`dirname "$PRG"`"/$link" + fi +done +SAVED="`pwd`" +cd "`dirname \"$PRG\"`/" >/dev/null +APP_HOME="`pwd -P`" +cd "$SAVED" >/dev/null + +APP_NAME="Gradle" +APP_BASE_NAME=`basename "$0"` + +# Add default JVM options here. You can also use JAVA_OPTS and GRADLE_OPTS to pass JVM options to this script. +DEFAULT_JVM_OPTS="" + +# Use the maximum available, or set MAX_FD != -1 to use that value. +MAX_FD="maximum" + +warn () { + echo "$*" +} + +die () { + echo + echo "$*" + echo + exit 1 +} + +# OS specific support (must be 'true' or 'false'). +cygwin=false +msys=false +darwin=false +nonstop=false +case "`uname`" in + CYGWIN* ) + cygwin=true + ;; + Darwin* ) + darwin=true + ;; + MINGW* ) + msys=true + ;; + NONSTOP* ) + nonstop=true + ;; +esac + +CLASSPATH=$APP_HOME/gradle/wrapper/gradle-wrapper.jar + +# Determine the Java command to use to start the JVM. +if [ -n "$JAVA_HOME" ] ; then + if [ -x "$JAVA_HOME/jre/sh/java" ] ; then + # IBM's JDK on AIX uses strange locations for the executables + JAVACMD="$JAVA_HOME/jre/sh/java" + else + JAVACMD="$JAVA_HOME/bin/java" + fi + if [ ! -x "$JAVACMD" ] ; then + die "ERROR: JAVA_HOME is set to an invalid directory: $JAVA_HOME + +Please set the JAVA_HOME variable in your environment to match the +location of your Java installation." + fi +else + JAVACMD="java" + which java >/dev/null 2>&1 || die "ERROR: JAVA_HOME is not set and no 'java' command could be found in your PATH. + +Please set the JAVA_HOME variable in your environment to match the +location of your Java installation." +fi + +# Increase the maximum file descriptors if we can. +if [ "$cygwin" = "false" -a "$darwin" = "false" -a "$nonstop" = "false" ] ; then + MAX_FD_LIMIT=`ulimit -H -n` + if [ $? -eq 0 ] ; then + if [ "$MAX_FD" = "maximum" -o "$MAX_FD" = "max" ] ; then + MAX_FD="$MAX_FD_LIMIT" + fi + ulimit -n $MAX_FD + if [ $? -ne 0 ] ; then + warn "Could not set maximum file descriptor limit: $MAX_FD" + fi + else + warn "Could not query maximum file descriptor limit: $MAX_FD_LIMIT" + fi +fi + +# For Darwin, add options to specify how the application appears in the dock +if $darwin; then + GRADLE_OPTS="$GRADLE_OPTS \"-Xdock:name=$APP_NAME\" \"-Xdock:icon=$APP_HOME/media/gradle.icns\"" +fi + +# For Cygwin, switch paths to Windows format before running java +if $cygwin ; then + APP_HOME=`cygpath --path --mixed "$APP_HOME"` + CLASSPATH=`cygpath --path --mixed "$CLASSPATH"` + JAVACMD=`cygpath --unix "$JAVACMD"` + + # We build the pattern for arguments to be converted via cygpath + ROOTDIRSRAW=`find -L / -maxdepth 1 -mindepth 1 -type d 2>/dev/null` + SEP="" + for dir in $ROOTDIRSRAW ; do + ROOTDIRS="$ROOTDIRS$SEP$dir" + SEP="|" + done + OURCYGPATTERN="(^($ROOTDIRS))" + # Add a user-defined pattern to the cygpath arguments + if [ "$GRADLE_CYGPATTERN" != "" ] ; then + OURCYGPATTERN="$OURCYGPATTERN|($GRADLE_CYGPATTERN)" + fi + # Now convert the arguments - kludge to limit ourselves to /bin/sh + i=0 + for arg in "$@" ; do + CHECK=`echo "$arg"|egrep -c "$OURCYGPATTERN" -` + CHECK2=`echo "$arg"|egrep -c "^-"` ### Determine if an option + + if [ $CHECK -ne 0 ] && [ $CHECK2 -eq 0 ] ; then ### Added a condition + eval `echo args$i`=`cygpath --path --ignore --mixed "$arg"` + else + eval `echo args$i`="\"$arg\"" + fi + i=$((i+1)) + done + case $i in + (0) set -- ;; + (1) set -- "$args0" ;; + (2) set -- "$args0" "$args1" ;; + (3) set -- "$args0" "$args1" "$args2" ;; + (4) set -- "$args0" "$args1" "$args2" "$args3" ;; + (5) set -- "$args0" "$args1" "$args2" "$args3" "$args4" ;; + (6) set -- "$args0" "$args1" "$args2" "$args3" "$args4" "$args5" ;; + (7) set -- "$args0" "$args1" "$args2" "$args3" "$args4" "$args5" "$args6" ;; + (8) set -- "$args0" "$args1" "$args2" "$args3" "$args4" "$args5" "$args6" "$args7" ;; + (9) set -- "$args0" "$args1" "$args2" "$args3" "$args4" "$args5" "$args6" "$args7" "$args8" ;; + esac +fi + +# Escape application args +save () { + for i do printf %s\\n "$i" | sed "s/'/'\\\\''/g;1s/^/'/;\$s/\$/' \\\\/" ; done + echo " " +} +APP_ARGS=$(save "$@") + +# Collect all arguments for the java command, following the shell quoting and substitution rules +eval set -- $DEFAULT_JVM_OPTS $JAVA_OPTS $GRADLE_OPTS "\"-Dorg.gradle.appname=$APP_BASE_NAME\"" -classpath "\"$CLASSPATH\"" org.gradle.wrapper.GradleWrapperMain "$APP_ARGS" + +# by default we should be in the correct project dir, but when run from Finder on Mac, the cwd is wrong +if [ "$(uname)" = "Darwin" ] && [ "$HOME" = "$PWD" ]; then + cd "$(dirname "$0")" +fi + +exec "$JAVACMD" "$@" diff --git a/add_to_app/android_view/content_sizing_android_view/gradlew.bat b/add_to_app/android_view/content_sizing_android_view/gradlew.bat new file mode 100644 index 000000000..f9553162f --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/gradlew.bat @@ -0,0 +1,84 @@ +@if "%DEBUG%" == "" @echo off +@rem ########################################################################## +@rem +@rem Gradle startup script for Windows +@rem +@rem ########################################################################## + +@rem Set local scope for the variables with windows NT shell +if "%OS%"=="Windows_NT" setlocal + +set DIRNAME=%~dp0 +if "%DIRNAME%" == "" set DIRNAME=. +set APP_BASE_NAME=%~n0 +set APP_HOME=%DIRNAME% + +@rem Add default JVM options here. You can also use JAVA_OPTS and GRADLE_OPTS to pass JVM options to this script. +set DEFAULT_JVM_OPTS= + +@rem Find java.exe +if defined JAVA_HOME goto findJavaFromJavaHome + +set JAVA_EXE=java.exe +%JAVA_EXE% -version >NUL 2>&1 +if "%ERRORLEVEL%" == "0" goto init + +echo. +echo ERROR: JAVA_HOME is not set and no 'java' command could be found in your PATH. +echo. +echo Please set the JAVA_HOME variable in your environment to match the +echo location of your Java installation. + +goto fail + +:findJavaFromJavaHome +set JAVA_HOME=%JAVA_HOME:"=% +set JAVA_EXE=%JAVA_HOME%/bin/java.exe + +if exist "%JAVA_EXE%" goto init + +echo. +echo ERROR: JAVA_HOME is set to an invalid directory: %JAVA_HOME% +echo. +echo Please set the JAVA_HOME variable in your environment to match the +echo location of your Java installation. + +goto fail + +:init +@rem Get command-line arguments, handling Windows variants + +if not "%OS%" == "Windows_NT" goto win9xME_args + +:win9xME_args +@rem Slurp the command line arguments. +set CMD_LINE_ARGS= +set _SKIP=2 + +:win9xME_args_slurp +if "x%~1" == "x" goto execute + +set CMD_LINE_ARGS=%* + +:execute +@rem Setup the command line + +set CLASSPATH=%APP_HOME%\gradle\wrapper\gradle-wrapper.jar + +@rem Execute Gradle +"%JAVA_EXE%" %DEFAULT_JVM_OPTS% %JAVA_OPTS% %GRADLE_OPTS% "-Dorg.gradle.appname=%APP_BASE_NAME%" -classpath "%CLASSPATH%" org.gradle.wrapper.GradleWrapperMain %CMD_LINE_ARGS% + +:end +@rem End local scope for the variables with windows NT shell +if "%ERRORLEVEL%"=="0" goto mainEnd + +:fail +rem Set variable GRADLE_EXIT_CONSOLE if you need the _script_ return code instead of +rem the _cmd.exe /c_ return code! +if not "" == "%GRADLE_EXIT_CONSOLE%" exit 1 +exit /b 1 + +:mainEnd +if "%OS%"=="Windows_NT" endlocal + +:omega diff --git a/add_to_app/android_view/content_sizing_android_view/settings.gradle b/add_to_app/android_view/content_sizing_android_view/settings.gradle new file mode 100644 index 000000000..62f8e6580 --- /dev/null +++ b/add_to_app/android_view/content_sizing_android_view/settings.gradle @@ -0,0 +1,7 @@ +rootProject.name = "Flutter View Integration" +include ':app' +setBinding(new Binding([gradle: this])) +evaluate(new File( + settingsDir.parentFile, + 'flutter_module_using_plugin_content_sizing_android_view/.android/include_flutter.groovy' +)) diff --git a/add_to_app/android_view/flutter_module_using_plugin_content_sizing_android_view/.gitignore b/add_to_app/android_view/flutter_module_using_plugin_content_sizing_android_view/.gitignore new file mode 100644 index 000000000..86f469179 --- /dev/null +++ b/add_to_app/android_view/flutter_module_using_plugin_content_sizing_android_view/.gitignore @@ -0,0 +1,42 @@ +.DS_Store +.dart_tool/ + +.packages +.pub/ + +.idea/ +.vagrant/ +.sconsign.dblite +.svn/ + +*.swp +profile + +DerivedData/ + +.generated/ + +*.pbxuser +*.mode1v3 +*.mode2v3 +*.perspectivev3 + +!default.pbxuser +!default.mode1v3 +!default.mode2v3 +!default.perspectivev3 + +xcuserdata + +*.moved-aside + +*.pyc +*sync/ +Icon? +.tags* + +build/ +.android/ +.ios/ +.flutter-plugins +.flutter-plugins-dependencies diff --git a/add_to_app/android_view/flutter_module_using_plugin_content_sizing_android_view/.metadata b/add_to_app/android_view/flutter_module_using_plugin_content_sizing_android_view/.metadata new file mode 100644 index 000000000..194fb3cc0 --- /dev/null +++ b/add_to_app/android_view/flutter_module_using_plugin_content_sizing_android_view/.metadata @@ -0,0 +1,10 @@ +# This file tracks properties of this Flutter project. +# Used by Flutter tool to assess capabilities and perform upgrades etc. +# +# This file should be version controlled and should not be manually edited. + +version: + revision: 532a8fed41a4f6595965f02f3edf9666ba5ebf44 + channel: master + +project_type: module diff --git a/add_to_app/android_view/flutter_module_using_plugin_content_sizing_android_view/README.md b/add_to_app/android_view/flutter_module_using_plugin_content_sizing_android_view/README.md new file mode 100644 index 000000000..01c484f82 --- /dev/null +++ b/add_to_app/android_view/flutter_module_using_plugin_content_sizing_android_view/README.md @@ -0,0 +1,14 @@ +# flutter_module_using_plugin + +An example Flutter module that uses a native plugin, intended for use in the +Flutter add-to-app samples. For more information on how to use it, see the +[README.md](../README.md) parent directory. + +## Getting Started + +For more information about Flutter, check out +[flutter.dev](https://flutter.dev). + +For instructions on how to integrate Flutter modules into your existing +applications, see Flutter's +[add-to-app documentation](https://flutter.dev/docs/development/add-to-app). diff --git a/add_to_app/android_view/flutter_module_using_plugin_content_sizing_android_view/analysis_options.yaml b/add_to_app/android_view/flutter_module_using_plugin_content_sizing_android_view/analysis_options.yaml new file mode 100644 index 000000000..13d6fe105 --- /dev/null +++ b/add_to_app/android_view/flutter_module_using_plugin_content_sizing_android_view/analysis_options.yaml @@ -0,0 +1 @@ +include: package:analysis_defaults/flutter.yaml diff --git a/add_to_app/android_view/flutter_module_using_plugin_content_sizing_android_view/lib/main.dart b/add_to_app/android_view/flutter_module_using_plugin_content_sizing_android_view/lib/main.dart new file mode 100644 index 000000000..0cd24a06b --- /dev/null +++ b/add_to_app/android_view/flutter_module_using_plugin_content_sizing_android_view/lib/main.dart @@ -0,0 +1,56 @@ +// Copyright 2014 The Flutter Authors. All rights reserved. +// Use of this source code is governed by a BSD-style license that can be +// found in the LICENSE file. + +import 'package:flutter/material.dart'; + +void main() { + runApp(const ResizeApp()); +} + +class ResizeApp extends StatefulWidget { + const ResizeApp({super.key}); + + @override + State createState() => _ResizeAppState(); +} + +class _ResizeAppState extends State { + int _listSize = 1; + void _addToList() { + setState(() { + _listSize++; + }); + } + + @override + Widget build(BuildContext context) { + return Center( + heightFactor: 1, + child: Directionality( + textDirection: TextDirection.ltr, + child: Column( + mainAxisSize: MainAxisSize.min, + children: [ + for (int i = 0; i < _listSize; i++) + Container( + color: HSVColor.fromAHSV(1, (10.0 * i), 1, 1).toColor(), + height: 50, + width: 200, + child: Center( + child: Text( + 'Flutter Widget $i', + style: const TextStyle(fontSize: 16, color: Colors.black), + ), + ), + ), + TextButton( + onPressed: _addToList, + child: Text('Listception!'), + ), + ], + ), + ), + ); + } +} diff --git a/add_to_app/android_view/flutter_module_using_plugin_content_sizing_android_view/pubspec.yaml b/add_to_app/android_view/flutter_module_using_plugin_content_sizing_android_view/pubspec.yaml new file mode 100644 index 000000000..4074a0aa1 --- /dev/null +++ b/add_to_app/android_view/flutter_module_using_plugin_content_sizing_android_view/pubspec.yaml @@ -0,0 +1,34 @@ +name: flutter_module_using_plugin_content_sizing_android_view +description: An example Flutter module that uses a plugin. +version: 1.0.0+1 +resolution: workspace + +environment: + sdk: ^3.8.1-0 + +dependencies: + flutter: + sdk: flutter + provider: ^6.1.5 + url_launcher: ^6.3.2 + sensors_plus: ^6.1.1 + +dev_dependencies: + analysis_defaults: + path: ../../../analysis_defaults + flutter_test: + sdk: flutter + +flutter: + uses-material-design: true + + # This section identifies your Flutter project as a module meant for + # embedding in a native host app. These identifiers should _not_ ordinarily + # be changed after generation - they are used to ensure that the tooling can + # maintain consistency when adding or modifying assets and plugins. + # They also do not have any bearing on your native host application's + # identifiers, which may be completely independent or the same as these. + module: + androidX: true + androidPackage: dev.flutter.example.flutter_module_using_plugin + iosBundleIdentifier: dev.flutter.example.flutterModuleUsingPlugin diff --git a/add_to_app/android_view/flutter_module_using_plugin_content_sizing_android_view/test/widget_test.dart b/add_to_app/android_view/flutter_module_using_plugin_content_sizing_android_view/test/widget_test.dart new file mode 100644 index 000000000..4c7cccede --- /dev/null +++ b/add_to_app/android_view/flutter_module_using_plugin_content_sizing_android_view/test/widget_test.dart @@ -0,0 +1,15 @@ +// This is a basic Flutter widget test. +// +// To perform an interaction with a widget in your test, use the WidgetTester +// utility that Flutter provides. For example, you can send tap and scroll +// gestures. You can also use WidgetTester to find child widgets in the widget +// tree, read text, and verify that the values of widget properties are correct. + +import 'package:flutter/material.dart'; +import 'package:flutter_test/flutter_test.dart'; + +class MockCounterModel extends ChangeNotifier {} + +void main() { + testWidgets('MiniView smoke test', (tester) async {}); +} diff --git a/add_to_app/books/README.md b/add_to_app/books/README.md index 2671d94f4..1484b5aee 100644 --- a/add_to_app/books/README.md +++ b/add_to_app/books/README.md @@ -38,7 +38,7 @@ page. * If the `schema.dart` is modified, the generated classes can be updated with ```bash - flutter pub run pigeon --input pigeon/schema.dart \ + dart run pigeon --input pigeon/schema.dart \ --dart_out lib/api.dart \ --objc_header_out ../ios_books/IosBooks/api.h \ --objc_source_out ../ios_books/IosBooks/api.m \ diff --git a/add_to_app/books/flutter_module_books/README.md b/add_to_app/books/flutter_module_books/README.md index f4a98d43a..7cc246ced 100644 --- a/add_to_app/books/flutter_module_books/README.md +++ b/add_to_app/books/flutter_module_books/README.md @@ -16,7 +16,7 @@ in `pigeon/schema.dart` is updated, the generated classes can also be re- generated using: ```shell -flutter pub run pigeon --input pigeon/schema.dart \ +dart run pigeon --input pigeon/schema.dart \ --dart_out lib/api.dart \ --objc_header_out ../ios_books/IosBooks/api.h \ --objc_source_out ../ios_books/IosBooks/api.m \ diff --git a/add_to_app/books/flutter_module_books/run_pigeon.sh b/add_to_app/books/flutter_module_books/run_pigeon.sh index 0c3b546a1..a8b584ade 100755 --- a/add_to_app/books/flutter_module_books/run_pigeon.sh +++ b/add_to_app/books/flutter_module_books/run_pigeon.sh @@ -1,5 +1,5 @@ #!/bin/sh -flutter pub run pigeon --input pigeon/schema.dart \ +dart run pigeon --input pigeon/schema.dart \ --dart_out lib/api.dart \ --objc_header_out ../ios_books/IosBooks/api.h \ --objc_source_out ../ios_books/IosBooks/api.m \ diff --git a/add_to_app/fullscreen/flutter_module_fullscreen/test/widget_test.dart b/add_to_app/fullscreen/flutter_module_fullscreen/test/widget_test.dart index af8421e5b..8bd801b4e 100644 --- a/add_to_app/fullscreen/flutter_module_fullscreen/test/widget_test.dart +++ b/add_to_app/fullscreen/flutter_module_fullscreen/test/widget_test.dart @@ -21,27 +21,30 @@ class MockCounterModel extends ChangeNotifier implements CounterModel { } void main() { - testWidgets('MiniView smoke test', (tester) async { - // Build our app and trigger a frame. - await tester.pumpWidget( - MaterialApp( - home: ChangeNotifierProvider.value( - value: MockCounterModel(), - child: const Contents(), + testWidgets( + 'MiniView smoke test', + (tester) async { + // Build our app and trigger a frame. + await tester.pumpWidget( + MaterialApp( + home: ChangeNotifierProvider.value( + value: MockCounterModel(), + child: const Contents(), + ), ), - ), - ); + ); - // Verify that our counter starts at 0. - expect(find.text('Taps: 0'), findsOneWidget); - expect(find.text('Taps: 1'), findsNothing); + // Verify that our counter starts at 0. + expect(find.text('Taps: 0'), findsOneWidget); + expect(find.text('Taps: 1'), findsNothing); - // Tap the '+' icon and trigger a frame. - await tester.tap(find.text('Tap me!')); - await tester.pump(); + // Tap the '+' icon and trigger a frame. + await tester.tap(find.text('Tap me!')); + await tester.pump(); - // Verify that our counter has incremented. - expect(find.text('Taps: 0'), findsNothing); - expect(find.text('Taps: 1'), findsOneWidget); - }); + // Verify that our counter has incremented. + expect(find.text('Taps: 0'), findsNothing); + expect(find.text('Taps: 1'), findsOneWidget); + }, + ); } diff --git a/asset_transformation/grayscale_transformer/pubspec.yaml b/asset_transformation/grayscale_transformer/pubspec.yaml index 27153b02e..ed59b389e 100644 --- a/asset_transformation/grayscale_transformer/pubspec.yaml +++ b/asset_transformation/grayscale_transformer/pubspec.yaml @@ -1,6 +1,7 @@ name: grayscale_transformer description: A sample command-line application. version: 1.0.0 +resolution: workspace environment: sdk: ^3.9.0-0 @@ -10,5 +11,5 @@ dependencies: image: ^4.1.7 dev_dependencies: - lints: ^5.0.0 + lints: ^6.0.0 test: ^1.24.0 diff --git a/compass_app/app/lib/domain/models/booking/booking_summary.dart b/compass_app/app/lib/domain/models/booking/booking_summary.dart index 4836e5ec5..633747fb8 100644 --- a/compass_app/app/lib/domain/models/booking/booking_summary.dart +++ b/compass_app/app/lib/domain/models/booking/booking_summary.dart @@ -9,7 +9,7 @@ part 'booking_summary.g.dart'; /// BookingSummary contains the necessary data to display a booking /// in the user home screen, but lacks the rest of the booking data -/// like activitities or destination. +/// like activities or destination. /// /// Use the [BookingRepository] to obtain a full [Booking] /// using the [BookingSummary.id]. diff --git a/cupertino_gallery/.gitignore b/cupertino_gallery/.gitignore new file mode 100644 index 000000000..3820a95c6 --- /dev/null +++ b/cupertino_gallery/.gitignore @@ -0,0 +1,45 @@ +# Miscellaneous +*.class +*.log +*.pyc +*.swp +.DS_Store +.atom/ +.build/ +.buildlog/ +.history +.svn/ +.swiftpm/ +migrate_working_dir/ + +# IntelliJ related +*.iml +*.ipr +*.iws +.idea/ + +# The .vscode folder contains launch configuration and tasks you configure in +# VS Code which you may wish to be included in version control, so this line +# is commented out by default. +#.vscode/ + +# Flutter/Dart/Pub related +**/doc/api/ +**/ios/Flutter/.last_build_id +.dart_tool/ +.flutter-plugins-dependencies +.pub-cache/ +.pub/ +/build/ +/coverage/ + +# Symbolication related +app.*.symbols + +# Obfuscation related +app.*.map.json + +# Android Studio will place build artifacts here +/android/app/debug +/android/app/profile +/android/app/release diff --git a/cupertino_gallery/.metadata b/cupertino_gallery/.metadata new file mode 100644 index 000000000..9064db051 --- /dev/null +++ b/cupertino_gallery/.metadata @@ -0,0 +1,45 @@ +# This file tracks properties of this Flutter project. +# Used by Flutter tool to assess capabilities and perform upgrades etc. +# +# This file should be version controlled and should not be manually edited. + +version: + revision: "c0f2a1dd60414de7bef59318dc2554a6bb75d4ad" + channel: "beta" + +project_type: app + +# Tracks metadata for the flutter migrate command +migration: + platforms: + - platform: root + create_revision: c0f2a1dd60414de7bef59318dc2554a6bb75d4ad + base_revision: c0f2a1dd60414de7bef59318dc2554a6bb75d4ad + - platform: android + create_revision: c0f2a1dd60414de7bef59318dc2554a6bb75d4ad + base_revision: c0f2a1dd60414de7bef59318dc2554a6bb75d4ad + - platform: ios + create_revision: c0f2a1dd60414de7bef59318dc2554a6bb75d4ad + base_revision: c0f2a1dd60414de7bef59318dc2554a6bb75d4ad + - platform: linux + create_revision: c0f2a1dd60414de7bef59318dc2554a6bb75d4ad + base_revision: c0f2a1dd60414de7bef59318dc2554a6bb75d4ad + - platform: macos + create_revision: c0f2a1dd60414de7bef59318dc2554a6bb75d4ad + base_revision: c0f2a1dd60414de7bef59318dc2554a6bb75d4ad + - platform: web + create_revision: c0f2a1dd60414de7bef59318dc2554a6bb75d4ad + base_revision: c0f2a1dd60414de7bef59318dc2554a6bb75d4ad + - platform: windows + create_revision: c0f2a1dd60414de7bef59318dc2554a6bb75d4ad + base_revision: c0f2a1dd60414de7bef59318dc2554a6bb75d4ad + + # User provided section + + # List of Local paths (relative to this file) that should be + # ignored by the migrate tool. + # + # Files that are not part of the templates will be ignored by default. + unmanaged_files: + - 'lib/main.dart' + - 'ios/Runner.xcodeproj/project.pbxproj' diff --git a/cupertino_gallery/README.md b/cupertino_gallery/README.md new file mode 100644 index 000000000..064ec5b31 --- /dev/null +++ b/cupertino_gallery/README.md @@ -0,0 +1,16 @@ +# cupertino_gallery + +A new Flutter project. + +## Getting Started + +This project is a starting point for a Flutter application. + +A few resources to get you started if this is your first Flutter project: + +- [Lab: Write your first Flutter app](https://docs.flutter.dev/get-started/codelab) +- [Cookbook: Useful Flutter samples](https://docs.flutter.dev/cookbook) + +For help getting started with Flutter development, view the +[online documentation](https://docs.flutter.dev/), which offers tutorials, +samples, guidance on mobile development, and a full API reference. diff --git a/cupertino_gallery/analysis_options.yaml b/cupertino_gallery/analysis_options.yaml new file mode 100644 index 000000000..0d2902135 --- /dev/null +++ b/cupertino_gallery/analysis_options.yaml @@ -0,0 +1,28 @@ +# This file configures the analyzer, which statically analyzes Dart code to +# check for errors, warnings, and lints. +# +# The issues identified by the analyzer are surfaced in the UI of Dart-enabled +# IDEs (https://dart.dev/tools#ides-and-editors). The analyzer can also be +# invoked from the command line by running `flutter analyze`. + +# The following line activates a set of recommended lints for Flutter apps, +# packages, and plugins designed to encourage good coding practices. +include: package:flutter_lints/flutter.yaml + +linter: + # The lint rules applied to this project can be customized in the + # section below to disable rules from the `package:flutter_lints/flutter.yaml` + # included above or to enable additional rules. A list of all available lints + # and their documentation is published at https://dart.dev/lints. + # + # Instead of disabling a lint rule for the entire project in the + # section below, it can also be suppressed for a single line of code + # or a specific dart file by using the `// ignore: name_of_lint` and + # `// ignore_for_file: name_of_lint` syntax on the line or in the file + # producing the lint. + rules: + # avoid_print: false # Uncomment to disable the `avoid_print` rule + # prefer_single_quotes: true # Uncomment to enable the `prefer_single_quotes` rule + +# Additional information about this file can be found at +# https://dart.dev/guides/language/analysis-options diff --git a/cupertino_gallery/android/.gitignore b/cupertino_gallery/android/.gitignore new file mode 100644 index 000000000..be3943c96 --- /dev/null +++ b/cupertino_gallery/android/.gitignore @@ -0,0 +1,14 @@ +gradle-wrapper.jar +/.gradle +/captures/ +/gradlew +/gradlew.bat +/local.properties +GeneratedPluginRegistrant.java +.cxx/ + +# Remember to never publicly share your keystore. +# See https://flutter.dev/to/reference-keystore +key.properties +**/*.keystore +**/*.jks diff --git a/cupertino_gallery/android/app/build.gradle.kts b/cupertino_gallery/android/app/build.gradle.kts new file mode 100644 index 000000000..169bea05d --- /dev/null +++ b/cupertino_gallery/android/app/build.gradle.kts @@ -0,0 +1,44 @@ +plugins { + id("com.android.application") + id("kotlin-android") + // The Flutter Gradle Plugin must be applied after the Android and Kotlin Gradle plugins. + id("dev.flutter.flutter-gradle-plugin") +} + +android { + namespace = "com.example.cupertino_gallery" + compileSdk = flutter.compileSdkVersion + ndkVersion = flutter.ndkVersion + + compileOptions { + sourceCompatibility = JavaVersion.VERSION_11 + targetCompatibility = JavaVersion.VERSION_11 + } + + kotlinOptions { + jvmTarget = JavaVersion.VERSION_11.toString() + } + + defaultConfig { + // TODO: Specify your own unique Application ID (https://developer.android.com/studio/build/application-id.html). + applicationId = "com.example.cupertino_gallery" + // You can update the following values to match your application needs. + // For more information, see: https://flutter.dev/to/review-gradle-config. + minSdk = flutter.minSdkVersion + targetSdk = flutter.targetSdkVersion + versionCode = flutter.versionCode + versionName = flutter.versionName + } + + buildTypes { + release { + // TODO: Add your own signing config for the release build. + // Signing with the debug keys for now, so `flutter run --release` works. + signingConfig = signingConfigs.getByName("debug") + } + } +} + +flutter { + source = "../.." +} diff --git a/cupertino_gallery/android/app/src/debug/AndroidManifest.xml b/cupertino_gallery/android/app/src/debug/AndroidManifest.xml new file mode 100644 index 000000000..399f6981d --- /dev/null +++ b/cupertino_gallery/android/app/src/debug/AndroidManifest.xml @@ -0,0 +1,7 @@ + + + + diff --git a/cupertino_gallery/android/app/src/main/AndroidManifest.xml b/cupertino_gallery/android/app/src/main/AndroidManifest.xml new file mode 100644 index 000000000..287f17c08 --- /dev/null +++ b/cupertino_gallery/android/app/src/main/AndroidManifest.xml @@ -0,0 +1,45 @@ + + + + + + + + + + + + + + + + + + + + + diff --git a/cupertino_gallery/android/app/src/main/kotlin/com/example/cupertino_gallery/MainActivity.kt b/cupertino_gallery/android/app/src/main/kotlin/com/example/cupertino_gallery/MainActivity.kt new file mode 100644 index 000000000..9ef50d216 --- /dev/null +++ b/cupertino_gallery/android/app/src/main/kotlin/com/example/cupertino_gallery/MainActivity.kt @@ -0,0 +1,5 @@ +package com.example.cupertino_gallery + +import io.flutter.embedding.android.FlutterActivity + +class MainActivity : FlutterActivity() diff --git a/cupertino_gallery/android/app/src/main/res/drawable-v21/launch_background.xml b/cupertino_gallery/android/app/src/main/res/drawable-v21/launch_background.xml new file mode 100644 index 000000000..f74085f3f --- /dev/null +++ b/cupertino_gallery/android/app/src/main/res/drawable-v21/launch_background.xml @@ -0,0 +1,12 @@ + + + + + + + + diff --git a/cupertino_gallery/android/app/src/main/res/drawable/launch_background.xml b/cupertino_gallery/android/app/src/main/res/drawable/launch_background.xml new file mode 100644 index 000000000..304732f88 --- /dev/null +++ b/cupertino_gallery/android/app/src/main/res/drawable/launch_background.xml @@ -0,0 +1,12 @@ + + + + + + + + diff --git a/cupertino_gallery/android/app/src/main/res/mipmap-hdpi/ic_launcher.png b/cupertino_gallery/android/app/src/main/res/mipmap-hdpi/ic_launcher.png new file mode 100644 index 000000000..db77bb4b7 Binary files /dev/null and b/cupertino_gallery/android/app/src/main/res/mipmap-hdpi/ic_launcher.png differ diff --git a/cupertino_gallery/android/app/src/main/res/mipmap-mdpi/ic_launcher.png b/cupertino_gallery/android/app/src/main/res/mipmap-mdpi/ic_launcher.png new file mode 100644 index 000000000..17987b79b Binary files /dev/null and b/cupertino_gallery/android/app/src/main/res/mipmap-mdpi/ic_launcher.png differ diff --git a/cupertino_gallery/android/app/src/main/res/mipmap-xhdpi/ic_launcher.png b/cupertino_gallery/android/app/src/main/res/mipmap-xhdpi/ic_launcher.png new file mode 100644 index 000000000..09d439148 Binary files /dev/null and b/cupertino_gallery/android/app/src/main/res/mipmap-xhdpi/ic_launcher.png differ diff --git a/cupertino_gallery/android/app/src/main/res/mipmap-xxhdpi/ic_launcher.png b/cupertino_gallery/android/app/src/main/res/mipmap-xxhdpi/ic_launcher.png new file mode 100644 index 000000000..d5f1c8d34 Binary files /dev/null and b/cupertino_gallery/android/app/src/main/res/mipmap-xxhdpi/ic_launcher.png differ diff --git a/cupertino_gallery/android/app/src/main/res/mipmap-xxxhdpi/ic_launcher.png b/cupertino_gallery/android/app/src/main/res/mipmap-xxxhdpi/ic_launcher.png new file mode 100644 index 000000000..4d6372eeb Binary files /dev/null and b/cupertino_gallery/android/app/src/main/res/mipmap-xxxhdpi/ic_launcher.png differ diff --git a/cupertino_gallery/android/app/src/main/res/values-night/styles.xml b/cupertino_gallery/android/app/src/main/res/values-night/styles.xml new file mode 100644 index 000000000..06952be74 --- /dev/null +++ b/cupertino_gallery/android/app/src/main/res/values-night/styles.xml @@ -0,0 +1,18 @@ + + + + + + + diff --git a/cupertino_gallery/android/app/src/main/res/values/styles.xml b/cupertino_gallery/android/app/src/main/res/values/styles.xml new file mode 100644 index 000000000..cb1ef8805 --- /dev/null +++ b/cupertino_gallery/android/app/src/main/res/values/styles.xml @@ -0,0 +1,18 @@ + + + + + + + diff --git a/cupertino_gallery/android/app/src/profile/AndroidManifest.xml b/cupertino_gallery/android/app/src/profile/AndroidManifest.xml new file mode 100644 index 000000000..399f6981d --- /dev/null +++ b/cupertino_gallery/android/app/src/profile/AndroidManifest.xml @@ -0,0 +1,7 @@ + + + + diff --git a/cupertino_gallery/android/build.gradle.kts b/cupertino_gallery/android/build.gradle.kts new file mode 100644 index 000000000..dbee657bb --- /dev/null +++ b/cupertino_gallery/android/build.gradle.kts @@ -0,0 +1,24 @@ +allprojects { + repositories { + google() + mavenCentral() + } +} + +val newBuildDir: Directory = + rootProject.layout.buildDirectory + .dir("../../build") + .get() +rootProject.layout.buildDirectory.value(newBuildDir) + +subprojects { + val newSubprojectBuildDir: Directory = newBuildDir.dir(project.name) + project.layout.buildDirectory.value(newSubprojectBuildDir) +} +subprojects { + project.evaluationDependsOn(":app") +} + +tasks.register("clean") { + delete(rootProject.layout.buildDirectory) +} diff --git a/cupertino_gallery/android/gradle.properties b/cupertino_gallery/android/gradle.properties new file mode 100644 index 000000000..f018a6181 --- /dev/null +++ b/cupertino_gallery/android/gradle.properties @@ -0,0 +1,3 @@ +org.gradle.jvmargs=-Xmx8G -XX:MaxMetaspaceSize=4G -XX:ReservedCodeCacheSize=512m -XX:+HeapDumpOnOutOfMemoryError +android.useAndroidX=true +android.enableJetifier=true diff --git a/cupertino_gallery/android/gradle/wrapper/gradle-wrapper.properties b/cupertino_gallery/android/gradle/wrapper/gradle-wrapper.properties new file mode 100644 index 000000000..ac3b47926 --- /dev/null +++ b/cupertino_gallery/android/gradle/wrapper/gradle-wrapper.properties @@ -0,0 +1,5 @@ +distributionBase=GRADLE_USER_HOME +distributionPath=wrapper/dists +zipStoreBase=GRADLE_USER_HOME +zipStorePath=wrapper/dists +distributionUrl=https\://services.gradle.org/distributions/gradle-8.12-all.zip diff --git a/cupertino_gallery/android/settings.gradle.kts b/cupertino_gallery/android/settings.gradle.kts new file mode 100644 index 000000000..fb605bc84 --- /dev/null +++ b/cupertino_gallery/android/settings.gradle.kts @@ -0,0 +1,26 @@ +pluginManagement { + val flutterSdkPath = + run { + val properties = java.util.Properties() + file("local.properties").inputStream().use { properties.load(it) } + val flutterSdkPath = properties.getProperty("flutter.sdk") + require(flutterSdkPath != null) { "flutter.sdk not set in local.properties" } + flutterSdkPath + } + + includeBuild("$flutterSdkPath/packages/flutter_tools/gradle") + + repositories { + google() + mavenCentral() + gradlePluginPortal() + } +} + +plugins { + id("dev.flutter.flutter-plugin-loader") version "1.0.0" + id("com.android.application") version "8.9.1" apply false + id("org.jetbrains.kotlin.android") version "2.1.0" apply false +} + +include(":app") diff --git a/cupertino_gallery/ios/.gitignore b/cupertino_gallery/ios/.gitignore new file mode 100644 index 000000000..7a7f9873a --- /dev/null +++ b/cupertino_gallery/ios/.gitignore @@ -0,0 +1,34 @@ +**/dgph +*.mode1v3 +*.mode2v3 +*.moved-aside +*.pbxuser +*.perspectivev3 +**/*sync/ +.sconsign.dblite +.tags* +**/.vagrant/ +**/DerivedData/ +Icon? +**/Pods/ +**/.symlinks/ +profile +xcuserdata +**/.generated/ +Flutter/App.framework +Flutter/Flutter.framework +Flutter/Flutter.podspec +Flutter/Generated.xcconfig +Flutter/ephemeral/ +Flutter/app.flx +Flutter/app.zip +Flutter/flutter_assets/ +Flutter/flutter_export_environment.sh +ServiceDefinitions.json +Runner/GeneratedPluginRegistrant.* + +# Exceptions to above rules. +!default.mode1v3 +!default.mode2v3 +!default.pbxuser +!default.perspectivev3 diff --git a/cupertino_gallery/ios/Flutter/AppFrameworkInfo.plist b/cupertino_gallery/ios/Flutter/AppFrameworkInfo.plist new file mode 100644 index 000000000..1dc6cf765 --- /dev/null +++ b/cupertino_gallery/ios/Flutter/AppFrameworkInfo.plist @@ -0,0 +1,26 @@ + + + + + CFBundleDevelopmentRegion + en + CFBundleExecutable + App + CFBundleIdentifier + io.flutter.flutter.app + CFBundleInfoDictionaryVersion + 6.0 + CFBundleName + App + CFBundlePackageType + FMWK + CFBundleShortVersionString + 1.0 + CFBundleSignature + ???? + CFBundleVersion + 1.0 + MinimumOSVersion + 13.0 + + diff --git a/cupertino_gallery/ios/Flutter/Debug.xcconfig b/cupertino_gallery/ios/Flutter/Debug.xcconfig new file mode 100644 index 000000000..592ceee85 --- /dev/null +++ b/cupertino_gallery/ios/Flutter/Debug.xcconfig @@ -0,0 +1 @@ +#include "Generated.xcconfig" diff --git a/cupertino_gallery/ios/Flutter/Release.xcconfig b/cupertino_gallery/ios/Flutter/Release.xcconfig new file mode 100644 index 000000000..592ceee85 --- /dev/null +++ b/cupertino_gallery/ios/Flutter/Release.xcconfig @@ -0,0 +1 @@ +#include "Generated.xcconfig" diff --git a/cupertino_gallery/ios/Runner.xcodeproj/project.pbxproj b/cupertino_gallery/ios/Runner.xcodeproj/project.pbxproj new file mode 100644 index 000000000..45736c73b --- /dev/null +++ b/cupertino_gallery/ios/Runner.xcodeproj/project.pbxproj @@ -0,0 +1,619 @@ +// !$*UTF8*$! +{ + archiveVersion = 1; + classes = { + }; + objectVersion = 54; + objects = { + +/* Begin PBXBuildFile section */ + 1498D2341E8E89220040F4C2 /* GeneratedPluginRegistrant.m in Sources */ = {isa = PBXBuildFile; fileRef = 1498D2331E8E89220040F4C2 /* GeneratedPluginRegistrant.m */; }; + 331C808B294A63AB00263BE5 /* RunnerTests.swift in Sources */ = {isa = PBXBuildFile; fileRef = 331C807B294A618700263BE5 /* RunnerTests.swift */; }; + 3B3967161E833CAA004F5970 /* AppFrameworkInfo.plist in Resources */ = {isa = PBXBuildFile; fileRef = 3B3967151E833CAA004F5970 /* AppFrameworkInfo.plist */; }; + 74858FAF1ED2DC5600515810 /* AppDelegate.swift in Sources */ = {isa = PBXBuildFile; fileRef = 74858FAE1ED2DC5600515810 /* AppDelegate.swift */; }; + 97C146FC1CF9000F007C117D /* Main.storyboard in Resources */ = {isa = PBXBuildFile; fileRef = 97C146FA1CF9000F007C117D /* Main.storyboard */; }; + 97C146FE1CF9000F007C117D /* Assets.xcassets in Resources */ = {isa = PBXBuildFile; fileRef = 97C146FD1CF9000F007C117D /* Assets.xcassets */; }; + 97C147011CF9000F007C117D /* LaunchScreen.storyboard in Resources */ = {isa = PBXBuildFile; fileRef = 97C146FF1CF9000F007C117D /* LaunchScreen.storyboard */; }; +/* End PBXBuildFile section */ + +/* Begin PBXContainerItemProxy section */ + 331C8085294A63A400263BE5 /* PBXContainerItemProxy */ = { + isa = PBXContainerItemProxy; + containerPortal = 97C146E61CF9000F007C117D /* Project object */; + proxyType = 1; + remoteGlobalIDString = 97C146ED1CF9000F007C117D; + remoteInfo = Runner; + }; +/* End PBXContainerItemProxy section */ + +/* Begin PBXCopyFilesBuildPhase section */ + 9705A1C41CF9048500538489 /* Embed Frameworks */ = { + isa = PBXCopyFilesBuildPhase; + buildActionMask = 2147483647; + dstPath = ""; + dstSubfolderSpec = 10; + files = ( + ); + name = "Embed Frameworks"; + runOnlyForDeploymentPostprocessing = 0; + }; +/* End PBXCopyFilesBuildPhase section */ + +/* Begin PBXFileReference section */ + 1498D2321E8E86230040F4C2 /* GeneratedPluginRegistrant.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; path = GeneratedPluginRegistrant.h; sourceTree = ""; }; + 1498D2331E8E89220040F4C2 /* GeneratedPluginRegistrant.m */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.objc; path = GeneratedPluginRegistrant.m; sourceTree = ""; }; + 331C807B294A618700263BE5 /* RunnerTests.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = RunnerTests.swift; sourceTree = ""; }; + 331C8081294A63A400263BE5 /* RunnerTests.xctest */ = {isa = PBXFileReference; explicitFileType = wrapper.cfbundle; includeInIndex = 0; path = RunnerTests.xctest; sourceTree = BUILT_PRODUCTS_DIR; }; + 3B3967151E833CAA004F5970 /* AppFrameworkInfo.plist */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = text.plist.xml; name = AppFrameworkInfo.plist; path = Flutter/AppFrameworkInfo.plist; sourceTree = ""; }; + 74858FAD1ED2DC5600515810 /* Runner-Bridging-Header.h */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.c.h; path = "Runner-Bridging-Header.h"; sourceTree = ""; }; + 74858FAE1ED2DC5600515810 /* AppDelegate.swift */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.swift; path = AppDelegate.swift; sourceTree = ""; }; + 7AFA3C8E1D35360C0083082E /* Release.xcconfig */ = {isa = PBXFileReference; lastKnownFileType = text.xcconfig; name = Release.xcconfig; path = Flutter/Release.xcconfig; sourceTree = ""; }; + 9740EEB21CF90195004384FC /* Debug.xcconfig */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = text.xcconfig; name = Debug.xcconfig; path = Flutter/Debug.xcconfig; sourceTree = ""; }; + 9740EEB31CF90195004384FC /* Generated.xcconfig */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = text.xcconfig; name = Generated.xcconfig; path = Flutter/Generated.xcconfig; sourceTree = ""; }; + 97C146EE1CF9000F007C117D /* Runner.app */ = {isa = PBXFileReference; explicitFileType = wrapper.application; includeInIndex = 0; path = Runner.app; sourceTree = BUILT_PRODUCTS_DIR; }; + 97C146FB1CF9000F007C117D /* Base */ = {isa = PBXFileReference; lastKnownFileType = file.storyboard; name = Base; path = Base.lproj/Main.storyboard; sourceTree = ""; }; + 97C146FD1CF9000F007C117D /* Assets.xcassets */ = {isa = PBXFileReference; lastKnownFileType = folder.assetcatalog; path = Assets.xcassets; sourceTree = ""; }; + 97C147001CF9000F007C117D /* Base */ = {isa = PBXFileReference; lastKnownFileType = file.storyboard; name = Base; path = Base.lproj/LaunchScreen.storyboard; sourceTree = ""; }; + 97C147021CF9000F007C117D /* Info.plist */ = {isa = PBXFileReference; lastKnownFileType = text.plist.xml; path = Info.plist; sourceTree = ""; }; +/* End PBXFileReference section */ + +/* Begin PBXFrameworksBuildPhase section */ + 97C146EB1CF9000F007C117D /* Frameworks */ = { + isa = PBXFrameworksBuildPhase; + buildActionMask = 2147483647; + files = ( + ); + runOnlyForDeploymentPostprocessing = 0; + }; +/* End PBXFrameworksBuildPhase section */ + +/* Begin PBXGroup section */ + 331C8082294A63A400263BE5 /* RunnerTests */ = { + isa = PBXGroup; + children = ( + 331C807B294A618700263BE5 /* RunnerTests.swift */, + ); + path = RunnerTests; + sourceTree = ""; + }; + 9740EEB11CF90186004384FC /* Flutter */ = { + isa = PBXGroup; + children = ( + 3B3967151E833CAA004F5970 /* AppFrameworkInfo.plist */, + 9740EEB21CF90195004384FC /* Debug.xcconfig */, + 7AFA3C8E1D35360C0083082E /* Release.xcconfig */, + 9740EEB31CF90195004384FC /* Generated.xcconfig */, + ); + name = Flutter; + sourceTree = ""; + }; + 97C146E51CF9000F007C117D = { + isa = PBXGroup; + children = ( + 9740EEB11CF90186004384FC /* Flutter */, + 97C146F01CF9000F007C117D /* Runner */, + 97C146EF1CF9000F007C117D /* Products */, + 331C8082294A63A400263BE5 /* RunnerTests */, + ); + sourceTree = ""; + }; + 97C146EF1CF9000F007C117D /* Products */ = { + isa = PBXGroup; + children = ( + 97C146EE1CF9000F007C117D /* Runner.app */, + 331C8081294A63A400263BE5 /* RunnerTests.xctest */, + ); + name = Products; + sourceTree = ""; + }; + 97C146F01CF9000F007C117D /* Runner */ = { + isa = PBXGroup; + children = ( + 97C146FA1CF9000F007C117D /* Main.storyboard */, + 97C146FD1CF9000F007C117D /* Assets.xcassets */, + 97C146FF1CF9000F007C117D /* LaunchScreen.storyboard */, + 97C147021CF9000F007C117D /* Info.plist */, + 1498D2321E8E86230040F4C2 /* GeneratedPluginRegistrant.h */, + 1498D2331E8E89220040F4C2 /* GeneratedPluginRegistrant.m */, + 74858FAE1ED2DC5600515810 /* AppDelegate.swift */, + 74858FAD1ED2DC5600515810 /* Runner-Bridging-Header.h */, + ); + path = Runner; + sourceTree = ""; + }; +/* End PBXGroup section */ + +/* Begin PBXNativeTarget section */ + 331C8080294A63A400263BE5 /* RunnerTests */ = { + isa = PBXNativeTarget; + buildConfigurationList = 331C8087294A63A400263BE5 /* Build configuration list for PBXNativeTarget "RunnerTests" */; + buildPhases = ( + 331C807D294A63A400263BE5 /* Sources */, + 331C807F294A63A400263BE5 /* Resources */, + ); + buildRules = ( + ); + dependencies = ( + 331C8086294A63A400263BE5 /* PBXTargetDependency */, + ); + name = RunnerTests; + productName = RunnerTests; + productReference = 331C8081294A63A400263BE5 /* RunnerTests.xctest */; + productType = "com.apple.product-type.bundle.unit-test"; + }; + 97C146ED1CF9000F007C117D /* Runner */ = { + isa = PBXNativeTarget; + buildConfigurationList = 97C147051CF9000F007C117D /* Build configuration list for PBXNativeTarget "Runner" */; + buildPhases = ( + 9740EEB61CF901F6004384FC /* Run Script */, + 97C146EA1CF9000F007C117D /* Sources */, + 97C146EB1CF9000F007C117D /* Frameworks */, + 97C146EC1CF9000F007C117D /* Resources */, + 9705A1C41CF9048500538489 /* Embed Frameworks */, + 3B06AD1E1E4923F5004D2608 /* Thin Binary */, + ); + buildRules = ( + ); + dependencies = ( + ); + name = Runner; + productName = Runner; + productReference = 97C146EE1CF9000F007C117D /* Runner.app */; + productType = "com.apple.product-type.application"; + }; +/* End PBXNativeTarget section */ + +/* Begin PBXProject section */ + 97C146E61CF9000F007C117D /* Project object */ = { + isa = PBXProject; + attributes = { + BuildIndependentTargetsInParallel = YES; + LastUpgradeCheck = 1510; + ORGANIZATIONNAME = ""; + TargetAttributes = { + 331C8080294A63A400263BE5 = { + CreatedOnToolsVersion = 14.0; + TestTargetID = 97C146ED1CF9000F007C117D; + }; + 97C146ED1CF9000F007C117D = { + CreatedOnToolsVersion = 7.3.1; + LastSwiftMigration = 1100; + }; + }; + }; + buildConfigurationList = 97C146E91CF9000F007C117D /* Build configuration list for PBXProject "Runner" */; + compatibilityVersion = "Xcode 9.3"; + developmentRegion = en; + hasScannedForEncodings = 0; + knownRegions = ( + en, + Base, + ); + mainGroup = 97C146E51CF9000F007C117D; + productRefGroup = 97C146EF1CF9000F007C117D /* Products */; + projectDirPath = ""; + projectRoot = ""; + targets = ( + 97C146ED1CF9000F007C117D /* Runner */, + 331C8080294A63A400263BE5 /* RunnerTests */, + ); + }; +/* End PBXProject section */ + +/* Begin PBXResourcesBuildPhase section */ + 331C807F294A63A400263BE5 /* Resources */ = { + isa = PBXResourcesBuildPhase; + buildActionMask = 2147483647; + files = ( + ); + runOnlyForDeploymentPostprocessing = 0; + }; + 97C146EC1CF9000F007C117D /* Resources */ = { + isa = PBXResourcesBuildPhase; + buildActionMask = 2147483647; + files = ( + 97C147011CF9000F007C117D /* LaunchScreen.storyboard in Resources */, + 3B3967161E833CAA004F5970 /* AppFrameworkInfo.plist in Resources */, + 97C146FE1CF9000F007C117D /* Assets.xcassets in Resources */, + 97C146FC1CF9000F007C117D /* Main.storyboard in Resources */, + ); + runOnlyForDeploymentPostprocessing = 0; + }; +/* End PBXResourcesBuildPhase section */ + +/* Begin PBXShellScriptBuildPhase section */ + 3B06AD1E1E4923F5004D2608 /* Thin Binary */ = { + isa = PBXShellScriptBuildPhase; + alwaysOutOfDate = 1; + buildActionMask = 2147483647; + files = ( + ); + inputPaths = ( + "${TARGET_BUILD_DIR}/${INFOPLIST_PATH}", + ); + name = "Thin Binary"; + outputPaths = ( + ); + runOnlyForDeploymentPostprocessing = 0; + shellPath = /bin/sh; + shellScript = "/bin/sh \"$FLUTTER_ROOT/packages/flutter_tools/bin/xcode_backend.sh\" embed_and_thin"; + }; + 9740EEB61CF901F6004384FC /* Run Script */ = { + isa = PBXShellScriptBuildPhase; + alwaysOutOfDate = 1; + buildActionMask = 2147483647; + files = ( + ); + inputPaths = ( + ); + name = "Run Script"; + outputPaths = ( + ); + runOnlyForDeploymentPostprocessing = 0; + shellPath = /bin/sh; + shellScript = "/bin/sh \"$FLUTTER_ROOT/packages/flutter_tools/bin/xcode_backend.sh\" build"; + }; +/* End PBXShellScriptBuildPhase section */ + +/* Begin PBXSourcesBuildPhase section */ + 331C807D294A63A400263BE5 /* Sources */ = { + isa = PBXSourcesBuildPhase; + buildActionMask = 2147483647; + files = ( + 331C808B294A63AB00263BE5 /* RunnerTests.swift in Sources */, + ); + runOnlyForDeploymentPostprocessing = 0; + }; + 97C146EA1CF9000F007C117D /* Sources */ = { + isa = PBXSourcesBuildPhase; + buildActionMask = 2147483647; + files = ( + 74858FAF1ED2DC5600515810 /* AppDelegate.swift in Sources */, + 1498D2341E8E89220040F4C2 /* GeneratedPluginRegistrant.m in Sources */, + ); + runOnlyForDeploymentPostprocessing = 0; + }; +/* End PBXSourcesBuildPhase section */ + +/* Begin PBXTargetDependency section */ + 331C8086294A63A400263BE5 /* PBXTargetDependency */ = { + isa = PBXTargetDependency; + target = 97C146ED1CF9000F007C117D /* Runner */; + targetProxy = 331C8085294A63A400263BE5 /* PBXContainerItemProxy */; + }; +/* End PBXTargetDependency section */ + +/* Begin PBXVariantGroup section */ + 97C146FA1CF9000F007C117D /* Main.storyboard */ = { + isa = PBXVariantGroup; + children = ( + 97C146FB1CF9000F007C117D /* Base */, + ); + name = Main.storyboard; + sourceTree = ""; + }; + 97C146FF1CF9000F007C117D /* LaunchScreen.storyboard */ = { + isa = PBXVariantGroup; + children = ( + 97C147001CF9000F007C117D /* Base */, + ); + name = LaunchScreen.storyboard; + sourceTree = ""; + }; +/* End PBXVariantGroup section */ + +/* Begin XCBuildConfiguration section */ + 249021D3217E4FDB00AE95B9 /* Profile */ = { + isa = XCBuildConfiguration; + buildSettings = { + ALWAYS_SEARCH_USER_PATHS = NO; + ASSETCATALOG_COMPILER_GENERATE_SWIFT_ASSET_SYMBOL_EXTENSIONS = YES; + CLANG_ANALYZER_NONNULL = YES; + CLANG_CXX_LANGUAGE_STANDARD = "gnu++0x"; + CLANG_CXX_LIBRARY = "libc++"; + CLANG_ENABLE_MODULES = YES; + CLANG_ENABLE_OBJC_ARC = YES; + CLANG_WARN_BLOCK_CAPTURE_AUTORELEASING = YES; + CLANG_WARN_BOOL_CONVERSION = YES; + CLANG_WARN_COMMA = YES; + CLANG_WARN_CONSTANT_CONVERSION = YES; + CLANG_WARN_DEPRECATED_OBJC_IMPLEMENTATIONS = YES; + CLANG_WARN_DIRECT_OBJC_ISA_USAGE = YES_ERROR; + CLANG_WARN_EMPTY_BODY = YES; + CLANG_WARN_ENUM_CONVERSION = YES; + CLANG_WARN_INFINITE_RECURSION = YES; + CLANG_WARN_INT_CONVERSION = YES; + CLANG_WARN_NON_LITERAL_NULL_CONVERSION = YES; + CLANG_WARN_OBJC_IMPLICIT_RETAIN_SELF = YES; + CLANG_WARN_OBJC_LITERAL_CONVERSION = YES; + CLANG_WARN_OBJC_ROOT_CLASS = YES_ERROR; + CLANG_WARN_RANGE_LOOP_ANALYSIS = YES; + CLANG_WARN_STRICT_PROTOTYPES = YES; + CLANG_WARN_SUSPICIOUS_MOVE = YES; + CLANG_WARN_UNREACHABLE_CODE = YES; + CLANG_WARN__DUPLICATE_METHOD_MATCH = YES; + "CODE_SIGN_IDENTITY[sdk=iphoneos*]" = "iPhone Developer"; + COPY_PHASE_STRIP = NO; + DEBUG_INFORMATION_FORMAT = "dwarf-with-dsym"; + ENABLE_NS_ASSERTIONS = NO; + ENABLE_STRICT_OBJC_MSGSEND = YES; + ENABLE_USER_SCRIPT_SANDBOXING = NO; + GCC_C_LANGUAGE_STANDARD = gnu99; + GCC_NO_COMMON_BLOCKS = YES; + GCC_WARN_64_TO_32_BIT_CONVERSION = YES; + GCC_WARN_ABOUT_RETURN_TYPE = YES_ERROR; + GCC_WARN_UNDECLARED_SELECTOR = YES; + GCC_WARN_UNINITIALIZED_AUTOS = YES_AGGRESSIVE; + GCC_WARN_UNUSED_FUNCTION = YES; + GCC_WARN_UNUSED_VARIABLE = YES; + IPHONEOS_DEPLOYMENT_TARGET = 13.0; + MTL_ENABLE_DEBUG_INFO = NO; + SDKROOT = iphoneos; + SUPPORTED_PLATFORMS = iphoneos; + TARGETED_DEVICE_FAMILY = "1,2"; + VALIDATE_PRODUCT = YES; + }; + name = Profile; + }; + 249021D4217E4FDB00AE95B9 /* Profile */ = { + isa = XCBuildConfiguration; + baseConfigurationReference = 7AFA3C8E1D35360C0083082E /* Release.xcconfig */; + buildSettings = { + ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon; + CLANG_ENABLE_MODULES = YES; + CURRENT_PROJECT_VERSION = "$(FLUTTER_BUILD_NUMBER)"; + DEVELOPMENT_TEAM = 2UUT9AMTS2; + ENABLE_BITCODE = NO; + INFOPLIST_FILE = Runner/Info.plist; + LD_RUNPATH_SEARCH_PATHS = ( + "$(inherited)", + "@executable_path/Frameworks", + ); + PRODUCT_BUNDLE_IDENTIFIER = com.example.cupertinoGallery; + PRODUCT_NAME = "$(TARGET_NAME)"; + SWIFT_OBJC_BRIDGING_HEADER = "Runner/Runner-Bridging-Header.h"; + SWIFT_VERSION = 5.0; + VERSIONING_SYSTEM = "apple-generic"; + }; + name = Profile; + }; + 331C8088294A63A400263BE5 /* Debug */ = { + isa = XCBuildConfiguration; + buildSettings = { + BUNDLE_LOADER = "$(TEST_HOST)"; + CODE_SIGN_STYLE = Automatic; + CURRENT_PROJECT_VERSION = 1; + GENERATE_INFOPLIST_FILE = YES; + MARKETING_VERSION = 1.0; + PRODUCT_BUNDLE_IDENTIFIER = com.example.cupertinoGallery.RunnerTests; + PRODUCT_NAME = "$(TARGET_NAME)"; + SWIFT_ACTIVE_COMPILATION_CONDITIONS = DEBUG; + SWIFT_OPTIMIZATION_LEVEL = "-Onone"; + SWIFT_VERSION = 5.0; + TEST_HOST = "$(BUILT_PRODUCTS_DIR)/Runner.app/$(BUNDLE_EXECUTABLE_FOLDER_PATH)/Runner"; + }; + name = Debug; + }; + 331C8089294A63A400263BE5 /* Release */ = { + isa = XCBuildConfiguration; + buildSettings = { + BUNDLE_LOADER = "$(TEST_HOST)"; + CODE_SIGN_STYLE = Automatic; + CURRENT_PROJECT_VERSION = 1; + GENERATE_INFOPLIST_FILE = YES; + MARKETING_VERSION = 1.0; + PRODUCT_BUNDLE_IDENTIFIER = com.example.cupertinoGallery.RunnerTests; + PRODUCT_NAME = "$(TARGET_NAME)"; + SWIFT_VERSION = 5.0; + TEST_HOST = "$(BUILT_PRODUCTS_DIR)/Runner.app/$(BUNDLE_EXECUTABLE_FOLDER_PATH)/Runner"; + }; + name = Release; + }; + 331C808A294A63A400263BE5 /* Profile */ = { + isa = XCBuildConfiguration; + buildSettings = { + BUNDLE_LOADER = "$(TEST_HOST)"; + CODE_SIGN_STYLE = Automatic; + CURRENT_PROJECT_VERSION = 1; + GENERATE_INFOPLIST_FILE = YES; + MARKETING_VERSION = 1.0; + PRODUCT_BUNDLE_IDENTIFIER = com.example.cupertinoGallery.RunnerTests; + PRODUCT_NAME = "$(TARGET_NAME)"; + SWIFT_VERSION = 5.0; + TEST_HOST = "$(BUILT_PRODUCTS_DIR)/Runner.app/$(BUNDLE_EXECUTABLE_FOLDER_PATH)/Runner"; + }; + name = Profile; + }; + 97C147031CF9000F007C117D /* Debug */ = { + isa = XCBuildConfiguration; + buildSettings = { + ALWAYS_SEARCH_USER_PATHS = NO; + ASSETCATALOG_COMPILER_GENERATE_SWIFT_ASSET_SYMBOL_EXTENSIONS = YES; + CLANG_ANALYZER_NONNULL = YES; + CLANG_CXX_LANGUAGE_STANDARD = "gnu++0x"; + CLANG_CXX_LIBRARY = "libc++"; + CLANG_ENABLE_MODULES = YES; + CLANG_ENABLE_OBJC_ARC = YES; + CLANG_WARN_BLOCK_CAPTURE_AUTORELEASING = YES; + CLANG_WARN_BOOL_CONVERSION = YES; + CLANG_WARN_COMMA = YES; + CLANG_WARN_CONSTANT_CONVERSION = YES; + CLANG_WARN_DEPRECATED_OBJC_IMPLEMENTATIONS = YES; + CLANG_WARN_DIRECT_OBJC_ISA_USAGE = YES_ERROR; + CLANG_WARN_EMPTY_BODY = YES; + CLANG_WARN_ENUM_CONVERSION = YES; + CLANG_WARN_INFINITE_RECURSION = YES; + CLANG_WARN_INT_CONVERSION = YES; + CLANG_WARN_NON_LITERAL_NULL_CONVERSION = YES; + CLANG_WARN_OBJC_IMPLICIT_RETAIN_SELF = YES; + CLANG_WARN_OBJC_LITERAL_CONVERSION = YES; + CLANG_WARN_OBJC_ROOT_CLASS = YES_ERROR; + CLANG_WARN_RANGE_LOOP_ANALYSIS = YES; + CLANG_WARN_STRICT_PROTOTYPES = YES; + CLANG_WARN_SUSPICIOUS_MOVE = YES; + CLANG_WARN_UNREACHABLE_CODE = YES; + CLANG_WARN__DUPLICATE_METHOD_MATCH = YES; + "CODE_SIGN_IDENTITY[sdk=iphoneos*]" = "iPhone Developer"; + COPY_PHASE_STRIP = NO; + DEBUG_INFORMATION_FORMAT = dwarf; + ENABLE_STRICT_OBJC_MSGSEND = YES; + ENABLE_TESTABILITY = YES; + ENABLE_USER_SCRIPT_SANDBOXING = NO; + GCC_C_LANGUAGE_STANDARD = gnu99; + GCC_DYNAMIC_NO_PIC = NO; + GCC_NO_COMMON_BLOCKS = YES; + GCC_OPTIMIZATION_LEVEL = 0; + GCC_PREPROCESSOR_DEFINITIONS = ( + "DEBUG=1", + "$(inherited)", + ); + GCC_WARN_64_TO_32_BIT_CONVERSION = YES; + GCC_WARN_ABOUT_RETURN_TYPE = YES_ERROR; + GCC_WARN_UNDECLARED_SELECTOR = YES; + GCC_WARN_UNINITIALIZED_AUTOS = YES_AGGRESSIVE; + GCC_WARN_UNUSED_FUNCTION = YES; + GCC_WARN_UNUSED_VARIABLE = YES; + IPHONEOS_DEPLOYMENT_TARGET = 13.0; + MTL_ENABLE_DEBUG_INFO = YES; + ONLY_ACTIVE_ARCH = YES; + SDKROOT = iphoneos; + TARGETED_DEVICE_FAMILY = "1,2"; + }; + name = Debug; + }; + 97C147041CF9000F007C117D /* Release */ = { + isa = XCBuildConfiguration; + buildSettings = { + ALWAYS_SEARCH_USER_PATHS = NO; + ASSETCATALOG_COMPILER_GENERATE_SWIFT_ASSET_SYMBOL_EXTENSIONS = YES; + CLANG_ANALYZER_NONNULL = YES; + CLANG_CXX_LANGUAGE_STANDARD = "gnu++0x"; + CLANG_CXX_LIBRARY = "libc++"; + CLANG_ENABLE_MODULES = YES; + CLANG_ENABLE_OBJC_ARC = YES; + CLANG_WARN_BLOCK_CAPTURE_AUTORELEASING = YES; + CLANG_WARN_BOOL_CONVERSION = YES; + CLANG_WARN_COMMA = YES; + CLANG_WARN_CONSTANT_CONVERSION = YES; + CLANG_WARN_DEPRECATED_OBJC_IMPLEMENTATIONS = YES; + CLANG_WARN_DIRECT_OBJC_ISA_USAGE = YES_ERROR; + CLANG_WARN_EMPTY_BODY = YES; + CLANG_WARN_ENUM_CONVERSION = YES; + CLANG_WARN_INFINITE_RECURSION = YES; + CLANG_WARN_INT_CONVERSION = YES; + CLANG_WARN_NON_LITERAL_NULL_CONVERSION = YES; + CLANG_WARN_OBJC_IMPLICIT_RETAIN_SELF = YES; + CLANG_WARN_OBJC_LITERAL_CONVERSION = YES; + CLANG_WARN_OBJC_ROOT_CLASS = YES_ERROR; + CLANG_WARN_RANGE_LOOP_ANALYSIS = YES; + CLANG_WARN_STRICT_PROTOTYPES = YES; + CLANG_WARN_SUSPICIOUS_MOVE = YES; + CLANG_WARN_UNREACHABLE_CODE = YES; + CLANG_WARN__DUPLICATE_METHOD_MATCH = YES; + "CODE_SIGN_IDENTITY[sdk=iphoneos*]" = "iPhone Developer"; + COPY_PHASE_STRIP = NO; + DEBUG_INFORMATION_FORMAT = "dwarf-with-dsym"; + ENABLE_NS_ASSERTIONS = NO; + ENABLE_STRICT_OBJC_MSGSEND = YES; + ENABLE_USER_SCRIPT_SANDBOXING = NO; + GCC_C_LANGUAGE_STANDARD = gnu99; + GCC_NO_COMMON_BLOCKS = YES; + GCC_WARN_64_TO_32_BIT_CONVERSION = YES; + GCC_WARN_ABOUT_RETURN_TYPE = YES_ERROR; + GCC_WARN_UNDECLARED_SELECTOR = YES; + GCC_WARN_UNINITIALIZED_AUTOS = YES_AGGRESSIVE; + GCC_WARN_UNUSED_FUNCTION = YES; + GCC_WARN_UNUSED_VARIABLE = YES; + IPHONEOS_DEPLOYMENT_TARGET = 13.0; + MTL_ENABLE_DEBUG_INFO = NO; + SDKROOT = iphoneos; + SUPPORTED_PLATFORMS = iphoneos; + SWIFT_COMPILATION_MODE = wholemodule; + SWIFT_OPTIMIZATION_LEVEL = "-O"; + TARGETED_DEVICE_FAMILY = "1,2"; + VALIDATE_PRODUCT = YES; + }; + name = Release; + }; + 97C147061CF9000F007C117D /* Debug */ = { + isa = XCBuildConfiguration; + baseConfigurationReference = 9740EEB21CF90195004384FC /* Debug.xcconfig */; + buildSettings = { + ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon; + CLANG_ENABLE_MODULES = YES; + CURRENT_PROJECT_VERSION = "$(FLUTTER_BUILD_NUMBER)"; + DEVELOPMENT_TEAM = 2UUT9AMTS2; + ENABLE_BITCODE = NO; + INFOPLIST_FILE = Runner/Info.plist; + LD_RUNPATH_SEARCH_PATHS = ( + "$(inherited)", + "@executable_path/Frameworks", + ); + PRODUCT_BUNDLE_IDENTIFIER = com.example.cupertinoGallery; + PRODUCT_NAME = "$(TARGET_NAME)"; + SWIFT_OBJC_BRIDGING_HEADER = "Runner/Runner-Bridging-Header.h"; + SWIFT_OPTIMIZATION_LEVEL = "-Onone"; + SWIFT_VERSION = 5.0; + VERSIONING_SYSTEM = "apple-generic"; + }; + name = Debug; + }; + 97C147071CF9000F007C117D /* Release */ = { + isa = XCBuildConfiguration; + baseConfigurationReference = 7AFA3C8E1D35360C0083082E /* Release.xcconfig */; + buildSettings = { + ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon; + CLANG_ENABLE_MODULES = YES; + CURRENT_PROJECT_VERSION = "$(FLUTTER_BUILD_NUMBER)"; + DEVELOPMENT_TEAM = 2UUT9AMTS2; + ENABLE_BITCODE = NO; + INFOPLIST_FILE = Runner/Info.plist; + LD_RUNPATH_SEARCH_PATHS = ( + "$(inherited)", + "@executable_path/Frameworks", + ); + PRODUCT_BUNDLE_IDENTIFIER = com.example.cupertinoGallery; + PRODUCT_NAME = "$(TARGET_NAME)"; + SWIFT_OBJC_BRIDGING_HEADER = "Runner/Runner-Bridging-Header.h"; + SWIFT_VERSION = 5.0; + VERSIONING_SYSTEM = "apple-generic"; + }; + name = Release; + }; +/* End XCBuildConfiguration section */ + +/* Begin XCConfigurationList section */ + 331C8087294A63A400263BE5 /* Build configuration list for PBXNativeTarget "RunnerTests" */ = { + isa = XCConfigurationList; + buildConfigurations = ( + 331C8088294A63A400263BE5 /* Debug */, + 331C8089294A63A400263BE5 /* Release */, + 331C808A294A63A400263BE5 /* Profile */, + ); + defaultConfigurationIsVisible = 0; + defaultConfigurationName = Release; + }; + 97C146E91CF9000F007C117D /* Build configuration list for PBXProject "Runner" */ = { + isa = XCConfigurationList; + buildConfigurations = ( + 97C147031CF9000F007C117D /* Debug */, + 97C147041CF9000F007C117D /* Release */, + 249021D3217E4FDB00AE95B9 /* Profile */, + ); + defaultConfigurationIsVisible = 0; + defaultConfigurationName = Release; + }; + 97C147051CF9000F007C117D /* Build configuration list for PBXNativeTarget "Runner" */ = { + isa = XCConfigurationList; + buildConfigurations = ( + 97C147061CF9000F007C117D /* Debug */, + 97C147071CF9000F007C117D /* Release */, + 249021D4217E4FDB00AE95B9 /* Profile */, + ); + defaultConfigurationIsVisible = 0; + defaultConfigurationName = Release; + }; +/* End XCConfigurationList section */ + }; + rootObject = 97C146E61CF9000F007C117D /* Project object */; +} diff --git a/cupertino_gallery/ios/Runner.xcodeproj/project.xcworkspace/contents.xcworkspacedata b/cupertino_gallery/ios/Runner.xcodeproj/project.xcworkspace/contents.xcworkspacedata new file mode 100644 index 000000000..919434a62 --- /dev/null +++ b/cupertino_gallery/ios/Runner.xcodeproj/project.xcworkspace/contents.xcworkspacedata @@ -0,0 +1,7 @@ + + + + + diff --git a/cupertino_gallery/ios/Runner.xcodeproj/project.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist b/cupertino_gallery/ios/Runner.xcodeproj/project.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist new file mode 100644 index 000000000..18d981003 --- /dev/null +++ b/cupertino_gallery/ios/Runner.xcodeproj/project.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist @@ -0,0 +1,8 @@ + + + + + IDEDidComputeMac32BitWarning + + + diff --git a/cupertino_gallery/ios/Runner.xcodeproj/project.xcworkspace/xcshareddata/WorkspaceSettings.xcsettings b/cupertino_gallery/ios/Runner.xcodeproj/project.xcworkspace/xcshareddata/WorkspaceSettings.xcsettings new file mode 100644 index 000000000..f9b0d7c5e --- /dev/null +++ b/cupertino_gallery/ios/Runner.xcodeproj/project.xcworkspace/xcshareddata/WorkspaceSettings.xcsettings @@ -0,0 +1,8 @@ + + + + + PreviewsEnabled + + + diff --git a/cupertino_gallery/ios/Runner.xcodeproj/xcshareddata/xcschemes/Runner.xcscheme b/cupertino_gallery/ios/Runner.xcodeproj/xcshareddata/xcschemes/Runner.xcscheme new file mode 100644 index 000000000..e3773d42e --- /dev/null +++ b/cupertino_gallery/ios/Runner.xcodeproj/xcshareddata/xcschemes/Runner.xcscheme @@ -0,0 +1,101 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/cupertino_gallery/ios/Runner.xcworkspace/contents.xcworkspacedata b/cupertino_gallery/ios/Runner.xcworkspace/contents.xcworkspacedata new file mode 100644 index 000000000..1d526a16e --- /dev/null +++ b/cupertino_gallery/ios/Runner.xcworkspace/contents.xcworkspacedata @@ -0,0 +1,7 @@ + + + + + diff --git a/cupertino_gallery/ios/Runner.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist b/cupertino_gallery/ios/Runner.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist new file mode 100644 index 000000000..18d981003 --- /dev/null +++ b/cupertino_gallery/ios/Runner.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist @@ -0,0 +1,8 @@ + + + + + IDEDidComputeMac32BitWarning + + + diff --git a/cupertino_gallery/ios/Runner.xcworkspace/xcshareddata/WorkspaceSettings.xcsettings b/cupertino_gallery/ios/Runner.xcworkspace/xcshareddata/WorkspaceSettings.xcsettings new file mode 100644 index 000000000..f9b0d7c5e --- /dev/null +++ b/cupertino_gallery/ios/Runner.xcworkspace/xcshareddata/WorkspaceSettings.xcsettings @@ -0,0 +1,8 @@ + + + + + PreviewsEnabled + + + diff --git a/cupertino_gallery/ios/Runner/AppDelegate.swift b/cupertino_gallery/ios/Runner/AppDelegate.swift new file mode 100644 index 000000000..626664468 --- /dev/null +++ b/cupertino_gallery/ios/Runner/AppDelegate.swift @@ -0,0 +1,13 @@ +import Flutter +import UIKit + +@main +@objc class AppDelegate: FlutterAppDelegate { + override func application( + _ application: UIApplication, + didFinishLaunchingWithOptions launchOptions: [UIApplication.LaunchOptionsKey: Any]? + ) -> Bool { + GeneratedPluginRegistrant.register(with: self) + return super.application(application, didFinishLaunchingWithOptions: launchOptions) + } +} diff --git a/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Contents.json b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Contents.json new file mode 100644 index 000000000..d36b1fab2 --- /dev/null +++ b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Contents.json @@ -0,0 +1,122 @@ +{ + "images" : [ + { + "size" : "20x20", + "idiom" : "iphone", + "filename" : "Icon-App-20x20@2x.png", + "scale" : "2x" + }, + { + "size" : "20x20", + "idiom" : "iphone", + "filename" : "Icon-App-20x20@3x.png", + "scale" : "3x" + }, + { + "size" : "29x29", + "idiom" : "iphone", + "filename" : "Icon-App-29x29@1x.png", + "scale" : "1x" + }, + { + "size" : "29x29", + "idiom" : "iphone", + "filename" : "Icon-App-29x29@2x.png", + "scale" : "2x" + }, + { + "size" : "29x29", + "idiom" : "iphone", + "filename" : "Icon-App-29x29@3x.png", + "scale" : "3x" + }, + { + "size" : "40x40", + "idiom" : "iphone", + "filename" : "Icon-App-40x40@2x.png", + "scale" : "2x" + }, + { + "size" : "40x40", + "idiom" : "iphone", + "filename" : "Icon-App-40x40@3x.png", + "scale" : "3x" + }, + { + "size" : "60x60", + "idiom" : "iphone", + "filename" : "Icon-App-60x60@2x.png", + "scale" : "2x" + }, + { + "size" : "60x60", + "idiom" : "iphone", + "filename" : "Icon-App-60x60@3x.png", + "scale" : "3x" + }, + { + "size" : "20x20", + "idiom" : "ipad", + "filename" : "Icon-App-20x20@1x.png", + "scale" : "1x" + }, + { + "size" : "20x20", + "idiom" : "ipad", + "filename" : "Icon-App-20x20@2x.png", + "scale" : "2x" + }, + { + "size" : "29x29", + "idiom" : "ipad", + "filename" : "Icon-App-29x29@1x.png", + "scale" : "1x" + }, + { + "size" : "29x29", + "idiom" : "ipad", + "filename" : "Icon-App-29x29@2x.png", + "scale" : "2x" + }, + { + "size" : "40x40", + "idiom" : "ipad", + "filename" : "Icon-App-40x40@1x.png", + "scale" : "1x" + }, + { + "size" : "40x40", + "idiom" : "ipad", + "filename" : "Icon-App-40x40@2x.png", + "scale" : "2x" + }, + { + "size" : "76x76", + "idiom" : "ipad", + "filename" : "Icon-App-76x76@1x.png", + "scale" : "1x" + }, + { + "size" : "76x76", + "idiom" : "ipad", + "filename" : "Icon-App-76x76@2x.png", + "scale" : "2x" + }, + { + "size" : "83.5x83.5", + "idiom" : "ipad", + "filename" : "Icon-App-83.5x83.5@2x.png", + "scale" : "2x" + }, + { + "size" : "1024x1024", + "idiom" : "ios-marketing", + "filename" : "Icon-App-1024x1024@1x.png", + "scale" : "1x" + } + ], + "info" : { + "version" : 1, + "author" : "xcode" + } +} diff --git a/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-1024x1024@1x.png b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-1024x1024@1x.png new file mode 100644 index 000000000..dc9ada472 Binary files /dev/null and b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-1024x1024@1x.png differ diff --git a/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-20x20@1x.png b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-20x20@1x.png new file mode 100644 index 000000000..7353c41ec Binary files /dev/null and b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-20x20@1x.png differ diff --git a/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-20x20@2x.png b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-20x20@2x.png new file mode 100644 index 000000000..797d452e4 Binary files /dev/null and b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-20x20@2x.png differ diff --git a/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-20x20@3x.png b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-20x20@3x.png new file mode 100644 index 000000000..6ed2d933e Binary files /dev/null and b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-20x20@3x.png differ diff --git a/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-29x29@1x.png b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-29x29@1x.png new file mode 100644 index 000000000..4cd7b0099 Binary files /dev/null and b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-29x29@1x.png differ diff --git a/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-29x29@2x.png b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-29x29@2x.png new file mode 100644 index 000000000..fe730945a Binary files /dev/null and b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-29x29@2x.png differ diff --git a/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-29x29@3x.png b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-29x29@3x.png new file mode 100644 index 000000000..321773cd8 Binary files /dev/null and b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-29x29@3x.png differ diff --git a/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-40x40@1x.png b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-40x40@1x.png new file mode 100644 index 000000000..797d452e4 Binary files /dev/null and b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-40x40@1x.png differ diff --git a/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-40x40@2x.png b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-40x40@2x.png new file mode 100644 index 000000000..502f463a9 Binary files /dev/null and b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-40x40@2x.png differ diff --git a/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-40x40@3x.png b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-40x40@3x.png new file mode 100644 index 000000000..0ec303439 Binary files /dev/null and b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-40x40@3x.png differ diff --git a/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-60x60@2x.png b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-60x60@2x.png new file mode 100644 index 000000000..0ec303439 Binary files /dev/null and b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-60x60@2x.png differ diff --git a/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-60x60@3x.png b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-60x60@3x.png new file mode 100644 index 000000000..e9f5fea27 Binary files /dev/null and b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-60x60@3x.png differ diff --git a/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-76x76@1x.png b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-76x76@1x.png new file mode 100644 index 000000000..84ac32ae7 Binary files /dev/null and b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-76x76@1x.png differ diff --git a/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-76x76@2x.png b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-76x76@2x.png new file mode 100644 index 000000000..8953cba09 Binary files /dev/null and b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-76x76@2x.png differ diff --git a/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-83.5x83.5@2x.png b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-83.5x83.5@2x.png new file mode 100644 index 000000000..0467bf12a Binary files /dev/null and b/cupertino_gallery/ios/Runner/Assets.xcassets/AppIcon.appiconset/Icon-App-83.5x83.5@2x.png differ diff --git a/cupertino_gallery/ios/Runner/Assets.xcassets/LaunchImage.imageset/Contents.json b/cupertino_gallery/ios/Runner/Assets.xcassets/LaunchImage.imageset/Contents.json new file mode 100644 index 000000000..0bedcf2fd --- /dev/null +++ b/cupertino_gallery/ios/Runner/Assets.xcassets/LaunchImage.imageset/Contents.json @@ -0,0 +1,23 @@ +{ + "images" : [ + { + "idiom" : "universal", + "filename" : "LaunchImage.png", + "scale" : "1x" + }, + { + "idiom" : "universal", + "filename" : "LaunchImage@2x.png", + "scale" : "2x" + }, + { + "idiom" : "universal", + "filename" : "LaunchImage@3x.png", + "scale" : "3x" + } + ], + "info" : { + "version" : 1, + "author" : "xcode" + } +} diff --git a/cupertino_gallery/ios/Runner/Assets.xcassets/LaunchImage.imageset/LaunchImage.png b/cupertino_gallery/ios/Runner/Assets.xcassets/LaunchImage.imageset/LaunchImage.png new file mode 100644 index 000000000..9da19eaca Binary files /dev/null and b/cupertino_gallery/ios/Runner/Assets.xcassets/LaunchImage.imageset/LaunchImage.png differ diff --git a/cupertino_gallery/ios/Runner/Assets.xcassets/LaunchImage.imageset/LaunchImage@2x.png b/cupertino_gallery/ios/Runner/Assets.xcassets/LaunchImage.imageset/LaunchImage@2x.png new file mode 100644 index 000000000..9da19eaca Binary files /dev/null and b/cupertino_gallery/ios/Runner/Assets.xcassets/LaunchImage.imageset/LaunchImage@2x.png differ diff --git a/cupertino_gallery/ios/Runner/Assets.xcassets/LaunchImage.imageset/LaunchImage@3x.png b/cupertino_gallery/ios/Runner/Assets.xcassets/LaunchImage.imageset/LaunchImage@3x.png new file mode 100644 index 000000000..9da19eaca Binary files /dev/null and b/cupertino_gallery/ios/Runner/Assets.xcassets/LaunchImage.imageset/LaunchImage@3x.png differ diff --git a/cupertino_gallery/ios/Runner/Assets.xcassets/LaunchImage.imageset/README.md b/cupertino_gallery/ios/Runner/Assets.xcassets/LaunchImage.imageset/README.md new file mode 100644 index 000000000..89c2725b7 --- /dev/null +++ b/cupertino_gallery/ios/Runner/Assets.xcassets/LaunchImage.imageset/README.md @@ -0,0 +1,5 @@ +# Launch Screen Assets + +You can customize the launch screen with your own desired assets by replacing the image files in this directory. + +You can also do it by opening your Flutter project's Xcode project with `open ios/Runner.xcworkspace`, selecting `Runner/Assets.xcassets` in the Project Navigator and dropping in the desired images. \ No newline at end of file diff --git a/cupertino_gallery/ios/Runner/Base.lproj/LaunchScreen.storyboard b/cupertino_gallery/ios/Runner/Base.lproj/LaunchScreen.storyboard new file mode 100644 index 000000000..f2e259c7c --- /dev/null +++ b/cupertino_gallery/ios/Runner/Base.lproj/LaunchScreen.storyboard @@ -0,0 +1,37 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/cupertino_gallery/ios/Runner/Base.lproj/Main.storyboard b/cupertino_gallery/ios/Runner/Base.lproj/Main.storyboard new file mode 100644 index 000000000..f3c28516f --- /dev/null +++ b/cupertino_gallery/ios/Runner/Base.lproj/Main.storyboard @@ -0,0 +1,26 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/cupertino_gallery/ios/Runner/Info.plist b/cupertino_gallery/ios/Runner/Info.plist new file mode 100644 index 000000000..a8ead9290 --- /dev/null +++ b/cupertino_gallery/ios/Runner/Info.plist @@ -0,0 +1,49 @@ + + + + + CFBundleDevelopmentRegion + $(DEVELOPMENT_LANGUAGE) + CFBundleDisplayName + Cupertino Gallery + CFBundleExecutable + $(EXECUTABLE_NAME) + CFBundleIdentifier + $(PRODUCT_BUNDLE_IDENTIFIER) + CFBundleInfoDictionaryVersion + 6.0 + CFBundleName + cupertino_gallery + CFBundlePackageType + APPL + CFBundleShortVersionString + $(FLUTTER_BUILD_NAME) + CFBundleSignature + ???? + CFBundleVersion + $(FLUTTER_BUILD_NUMBER) + LSRequiresIPhoneOS + + UILaunchStoryboardName + LaunchScreen + UIMainStoryboardFile + Main + UISupportedInterfaceOrientations + + UIInterfaceOrientationPortrait + UIInterfaceOrientationLandscapeLeft + UIInterfaceOrientationLandscapeRight + + UISupportedInterfaceOrientations~ipad + + UIInterfaceOrientationPortrait + UIInterfaceOrientationPortraitUpsideDown + UIInterfaceOrientationLandscapeLeft + UIInterfaceOrientationLandscapeRight + + CADisableMinimumFrameDurationOnPhone + + UIApplicationSupportsIndirectInputEvents + + + diff --git a/cupertino_gallery/ios/Runner/Runner-Bridging-Header.h b/cupertino_gallery/ios/Runner/Runner-Bridging-Header.h new file mode 100644 index 000000000..308a2a560 --- /dev/null +++ b/cupertino_gallery/ios/Runner/Runner-Bridging-Header.h @@ -0,0 +1 @@ +#import "GeneratedPluginRegistrant.h" diff --git a/cupertino_gallery/ios/RunnerTests/RunnerTests.swift b/cupertino_gallery/ios/RunnerTests/RunnerTests.swift new file mode 100644 index 000000000..86a7c3b1b --- /dev/null +++ b/cupertino_gallery/ios/RunnerTests/RunnerTests.swift @@ -0,0 +1,12 @@ +import Flutter +import UIKit +import XCTest + +class RunnerTests: XCTestCase { + + func testExample() { + // If you add code to the Runner application, consider adding tests here. + // See https://developer.apple.com/documentation/xctest for more information about using XCTest. + } + +} diff --git a/cupertino_gallery/lib/gallery_home.dart b/cupertino_gallery/lib/gallery_home.dart new file mode 100644 index 000000000..b5a407567 --- /dev/null +++ b/cupertino_gallery/lib/gallery_home.dart @@ -0,0 +1,52 @@ +import 'package:flutter/cupertino.dart'; +import 'settings_page.dart'; +import 'widgets_page.dart'; + +class GalleryHome extends StatelessWidget { + const GalleryHome({ + super.key, + required this.onThemeChange, + required this.isDarkMode, + required this.onTextSizeChange, + required this.textSize, + }); + + final ValueChanged onThemeChange; + final bool isDarkMode; + final ValueChanged onTextSizeChange; + final double textSize; + + @override + Widget build(BuildContext context) { + return CupertinoTabScaffold( + tabBar: CupertinoTabBar( + items: const [ + BottomNavigationBarItem( + icon: Icon(CupertinoIcons.list_bullet), + label: 'Widgets', + ), + BottomNavigationBarItem( + icon: Icon(CupertinoIcons.settings), + label: 'Settings', + ), + ], + ), + tabBuilder: (BuildContext context, int index) { + return CupertinoTabView( + builder: (BuildContext context) { + return switch (index) { + 0 => const WidgetsPage(), + 1 => SettingsPage( + onThemeChange: onThemeChange, + isDarkMode: isDarkMode, + onTextSizeChange: onTextSizeChange, + textSize: textSize, + ), + _ => const Center(child: Text('Widgets')), + }; + }, + ); + }, + ); + } +} diff --git a/cupertino_gallery/lib/main.dart b/cupertino_gallery/lib/main.dart new file mode 100644 index 000000000..934796db8 --- /dev/null +++ b/cupertino_gallery/lib/main.dart @@ -0,0 +1,72 @@ +// Copyright 2022 The Flutter team. All rights reserved. +// Use of this source code is governed by a BSD-style license that can be +// found in the LICENSE file. + +import 'package:flutter/cupertino.dart'; +import 'package:flutter/material.dart'; + +import 'gallery_home.dart'; + +void main() { + runApp(const CupertinoGalleryApp()); +} + +class CupertinoGalleryApp extends StatefulWidget { + const CupertinoGalleryApp({super.key}); + + @override + State createState() => _CupertinoGalleryAppState(); +} + +class _CupertinoGalleryAppState extends State { + ThemeMode _themeMode = ThemeMode.system; + double _textSize = 1.0; + + void _handleThemeChange(bool isDarkMode) { + setState(() { + _themeMode = isDarkMode ? ThemeMode.dark : ThemeMode.light; + }); + } + + void _handleTextSizeChange(double newTextSize) { + setState(() { + _textSize = newTextSize; + }); + } + + @override + Widget build(BuildContext context) { + final baseTheme = CupertinoThemeData( + brightness: + _themeMode == ThemeMode.dark ? Brightness.dark : Brightness.light, + ); + final textTheme = baseTheme.textTheme.copyWith( + textStyle: + baseTheme.textTheme.textStyle.copyWith(fontSize: 14 * _textSize), + actionTextStyle: baseTheme.textTheme.actionTextStyle + .copyWith(fontSize: 14 * _textSize), + tabLabelTextStyle: baseTheme.textTheme.tabLabelTextStyle + .copyWith(fontSize: 10 * _textSize), + navTitleTextStyle: baseTheme.textTheme.navTitleTextStyle + .copyWith(fontSize: 17 * _textSize), + navLargeTitleTextStyle: baseTheme.textTheme.navLargeTitleTextStyle + .copyWith(fontSize: 34 * _textSize), + navActionTextStyle: baseTheme.textTheme.navActionTextStyle + .copyWith(fontSize: 17 * _textSize), + pickerTextStyle: baseTheme.textTheme.pickerTextStyle + .copyWith(fontSize: 21 * _textSize), + dateTimePickerTextStyle: baseTheme.textTheme.dateTimePickerTextStyle + .copyWith(fontSize: 21 * _textSize), + ); + return CupertinoApp( + title: 'Cupertino Gallery', + theme: baseTheme.copyWith(textTheme: textTheme), + home: GalleryHome( + onThemeChange: _handleThemeChange, + isDarkMode: _themeMode == ThemeMode.dark, + onTextSizeChange: _handleTextSizeChange, + textSize: _textSize, + ), + ); + } +} diff --git a/cupertino_gallery/lib/settings_page.dart b/cupertino_gallery/lib/settings_page.dart new file mode 100644 index 000000000..59a4b3c73 --- /dev/null +++ b/cupertino_gallery/lib/settings_page.dart @@ -0,0 +1,143 @@ +import 'package:flutter/cupertino.dart'; + +class SettingsPage extends StatefulWidget { + const SettingsPage({ + super.key, + required this.onThemeChange, + required this.isDarkMode, + required this.onTextSizeChange, + required this.textSize, + }); + + final ValueChanged onThemeChange; + final bool isDarkMode; + final ValueChanged onTextSizeChange; + final double textSize; + + @override + State createState() => _SettingsPageState(); +} + +class _SettingsPageState extends State { + late bool isDarkMode; + late double _textSize; + + @override + void initState() { + super.initState(); + isDarkMode = widget.isDarkMode; + _textSize = widget.textSize; + } + + @override + void didUpdateWidget(SettingsPage oldWidget) { + super.didUpdateWidget(oldWidget); + if (widget.isDarkMode != oldWidget.isDarkMode) { + isDarkMode = widget.isDarkMode; + } + if (widget.textSize != oldWidget.textSize) { + _textSize = widget.textSize; + } + } + + @override + Widget build(BuildContext context) { + return CupertinoPageScaffold( + navigationBar: const CupertinoNavigationBar(middle: Text('Settings')), + child: Column( + crossAxisAlignment: CrossAxisAlignment.start, + children: [ + CupertinoListSection( + header: const Text('Appearance'), + children: [ + CupertinoListTile( + title: const Text('Dark Mode'), + trailing: CupertinoSwitch( + value: isDarkMode, + onChanged: (bool isActive) { + setState(() { + isDarkMode = isActive; + widget.onThemeChange(isActive); + }); + }, + ), + ), + CupertinoListTile( + title: const Text('Text Size'), + trailing: Text('${(_textSize * 100).toStringAsFixed(0)}%'), + ), + CupertinoSlider( + value: _textSize, + min: 0.5, + max: 1.5, + onChanged: (double value) { + setState(() { + _textSize = value; + }); + widget.onTextSizeChange(value); + }, + ), + ], + ), + CupertinoListSection( + header: const Text('General'), + children: [ + CupertinoListTile( + title: const Text('About'), + trailing: const Icon(CupertinoIcons.forward), + onTap: () {}, + ), + CupertinoListTile( + title: const Text('Privacy'), + trailing: const Icon(CupertinoIcons.forward), + onTap: () {}, + ), + CupertinoListTile( + title: const Text('Help'), + trailing: const Icon(CupertinoIcons.forward), + onTap: () {}, + ), + CupertinoListTile( + title: const Text('Reset Settings'), + trailing: const Icon(CupertinoIcons.forward), + onTap: () { + showCupertinoDialog( + context: context, + builder: (BuildContext context) => CupertinoAlertDialog( + title: const Text('Reset Settings'), + content: const Text( + 'Are you sure you want to reset all settings?', + ), + actions: [ + CupertinoDialogAction( + child: const Text('Cancel'), + onPressed: () { + Navigator.pop(context); + }, + ), + CupertinoDialogAction( + isDestructiveAction: true, + child: const Text('Reset'), + onPressed: () { + setState(() { + isDarkMode = false; + _textSize = 1.0; + widget.onThemeChange(false); + widget.onTextSizeChange(1.0); + }); + Navigator.pop(context); + }, + ), + ], + ), + ); + }, + ), + ], + ), + ], + ), + ); + } +} + diff --git a/cupertino_gallery/lib/widget_detail_page.dart b/cupertino_gallery/lib/widget_detail_page.dart new file mode 100644 index 000000000..bd289c4f5 --- /dev/null +++ b/cupertino_gallery/lib/widget_detail_page.dart @@ -0,0 +1,84 @@ +import 'package:flutter/cupertino.dart'; + +import 'widgets/action_sheet_page.dart'; +import 'widgets/activity_indicator_page.dart'; +import 'widgets/alert_dialog_page.dart'; +import 'widgets/button_page.dart'; +import 'widgets/checkbox_page.dart'; +import 'widgets/context_menu_page.dart'; +import 'widgets/date_picker_page.dart'; +import 'widgets/list_tile_page.dart'; +import 'widgets/picker_page.dart'; +import 'widgets/popup_surface_page.dart'; +import 'widgets/radio_page.dart'; +import 'widgets/scrollbar_page.dart'; +import 'widgets/search_text_field_page.dart'; +import 'widgets/segmented_control_page.dart'; +import 'widgets/sheet_page.dart'; +import 'widgets/slider_page.dart'; +import 'widgets/sliding_segmented_control_page.dart'; +import 'widgets/switch_page.dart'; +import 'widgets/text_field_page.dart'; +import 'widgets/text_theme_page.dart'; +import 'widgets/time_picker_page.dart'; + +class WidgetDetailPage extends StatelessWidget { + const WidgetDetailPage({super.key, required this.title}); + + final String title; + + @override + Widget build(BuildContext context) { + switch (title) { + case 'Action Sheet': + return const ActionSheetPage(); + case 'Activity Indicator': + return const ActivityIndicatorPage(); + case 'Alert Dialog': + return const AlertDialogPage(); + case 'Button': + return const ButtonPage(); + case 'Checkbox': + return const CheckboxPage(); + case 'Context Menu': + return const ContextMenuPage(); + case 'Date Picker': + return const DatePickerPage(); + case 'List Tile': + return const ListTilePage(); + case 'Picker': + return const PickerPage(); + case 'Popup Surface': + return const PopupSurfacePage(); + case 'Radio': + return const RadioPage(); + case 'Scrollbar': + return const ScrollbarPage(); + case 'Search Text Field': + return const SearchTextFieldPage(); + case 'Segmented Control': + return const SegmentedControlPage(); + case 'Sheet': + return const SheetPage(); + case 'Slider': + return const SliderPage(); + case 'Sliding Segmented Control': + return const SlidingSegmentedControlPage(); + case 'Switch': + return const SwitchPage(); + case 'Text Field': + return const TextFieldPage(); + case 'Text Theme': + return const TextThemePage(); + case 'Time Picker': + return const TimePickerPage(); + default: + return const CupertinoPageScaffold( + navigationBar: CupertinoNavigationBar( + middle: Text('Widget Not Found'), + ), + child: Center(child: Text('Widget Not Found')), + ); + } + } +} diff --git a/cupertino_gallery/lib/widgets/action_sheet_page.dart b/cupertino_gallery/lib/widgets/action_sheet_page.dart new file mode 100644 index 000000000..5949323cb --- /dev/null +++ b/cupertino_gallery/lib/widgets/action_sheet_page.dart @@ -0,0 +1,49 @@ +import 'package:flutter/cupertino.dart'; + +class ActionSheetPage extends StatelessWidget { + const ActionSheetPage({super.key}); + + @override + Widget build(BuildContext context) { + return CupertinoPageScaffold( + navigationBar: const CupertinoNavigationBar( + middle: Text('Action Sheet'), + ), + child: Center( + child: CupertinoButton( + child: const Text('Show Action Sheet'), + onPressed: () { + showCupertinoModalPopup( + context: context, + builder: (BuildContext context) => CupertinoActionSheet( + title: const Text('Title'), + message: const Text('Message'), + actions: [ + CupertinoActionSheetAction( + child: const Text('Action One'), + onPressed: () { + Navigator.pop(context); + }, + ), + CupertinoActionSheetAction( + child: const Text('Action Two'), + onPressed: () { + Navigator.pop(context); + }, + ) + ], + cancelButton: CupertinoActionSheetAction( + isDefaultAction: true, + onPressed: () { + Navigator.pop(context); + }, + child: const Text('Cancel'), + ), + ), + ); + }, + ), + ), + ); + } +} diff --git a/cupertino_gallery/lib/widgets/activity_indicator_page.dart b/cupertino_gallery/lib/widgets/activity_indicator_page.dart new file mode 100644 index 000000000..550da6f62 --- /dev/null +++ b/cupertino_gallery/lib/widgets/activity_indicator_page.dart @@ -0,0 +1,17 @@ +import 'package:flutter/cupertino.dart'; + +class ActivityIndicatorPage extends StatelessWidget { + const ActivityIndicatorPage({super.key}); + + @override + Widget build(BuildContext context) { + return const CupertinoPageScaffold( + navigationBar: CupertinoNavigationBar( + middle: Text('Activity Indicator'), + ), + child: Center( + child: CupertinoActivityIndicator(), + ), + ); + } +} diff --git a/cupertino_gallery/lib/widgets/alert_dialog_page.dart b/cupertino_gallery/lib/widgets/alert_dialog_page.dart new file mode 100644 index 000000000..416ba5160 --- /dev/null +++ b/cupertino_gallery/lib/widgets/alert_dialog_page.dart @@ -0,0 +1,41 @@ +import 'package:flutter/cupertino.dart'; + +class AlertDialogPage extends StatelessWidget { + const AlertDialogPage({super.key}); + + @override + Widget build(BuildContext context) { + return CupertinoPageScaffold( + navigationBar: const CupertinoNavigationBar(middle: Text('Alert Dialog')), + child: Center( + child: CupertinoButton( + child: const Text('Show Alert Dialog'), + onPressed: () { + showCupertinoDialog( + context: context, + builder: (BuildContext context) => CupertinoAlertDialog( + title: const Text('Alert'), + content: const Text('This is a sample alert dialog.'), + actions: [ + CupertinoDialogAction( + child: const Text('OK'), + onPressed: () { + Navigator.pop(context); + }, + ), + CupertinoDialogAction( + isDefaultAction: true, + child: const Text('NO'), + onPressed: () { + Navigator.pop(context); + }, + ), + ], + ), + ); + }, + ), + ), + ); + } +} diff --git a/cupertino_gallery/lib/widgets/button_page.dart b/cupertino_gallery/lib/widgets/button_page.dart new file mode 100644 index 000000000..d59916841 --- /dev/null +++ b/cupertino_gallery/lib/widgets/button_page.dart @@ -0,0 +1,42 @@ +import 'package:flutter/cupertino.dart'; + +class ButtonPage extends StatelessWidget { + const ButtonPage({super.key}); + + @override + Widget build(BuildContext context) { + return CupertinoPageScaffold( + navigationBar: const CupertinoNavigationBar(middle: Text('Button')), + child: Center( + child: Column( + mainAxisAlignment: MainAxisAlignment.center, + children: [ + Text( + 'CupertinoButton widget', + style: CupertinoTheme.of(context).textTheme.textStyle, + ), + const SizedBox(height: 16), + CupertinoButton(child: const Text('Enabled'), onPressed: () {}), + const SizedBox(height: 16), + const CupertinoButton(onPressed: null, child: Text('Disabled')), + const SizedBox(height: 32), + Text( + 'CupertinoButton.filled widget', + style: CupertinoTheme.of(context).textTheme.textStyle, + ), + const SizedBox(height: 16), + CupertinoButton.filled( + child: const Text('Enabled'), + onPressed: () {}, + ), + const SizedBox(height: 16), + const CupertinoButton.filled( + onPressed: null, + child: Text('Disabled'), + ), + ], + ), + ), + ); + } +} diff --git a/cupertino_gallery/lib/widgets/checkbox_page.dart b/cupertino_gallery/lib/widgets/checkbox_page.dart new file mode 100644 index 000000000..357cb0746 --- /dev/null +++ b/cupertino_gallery/lib/widgets/checkbox_page.dart @@ -0,0 +1,31 @@ +import 'package:flutter/cupertino.dart'; + +class CheckboxPage extends StatefulWidget { + const CheckboxPage({super.key}); + + @override + State createState() => _CheckboxPageState(); +} + +class _CheckboxPageState extends State { + bool _value = false; + + @override + Widget build(BuildContext context) { + return CupertinoPageScaffold( + navigationBar: const CupertinoNavigationBar( + middle: Text('Checkbox'), + ), + child: Center( + child: CupertinoCheckbox( + value: _value, + onChanged: (bool? value) { + setState(() { + _value = value!; + }); + }, + ), + ), + ); + } +} diff --git a/cupertino_gallery/lib/widgets/context_menu_page.dart b/cupertino_gallery/lib/widgets/context_menu_page.dart new file mode 100644 index 000000000..6e4432426 --- /dev/null +++ b/cupertino_gallery/lib/widgets/context_menu_page.dart @@ -0,0 +1,42 @@ +import 'package:flutter/cupertino.dart'; + +class ContextMenuPage extends StatelessWidget { + const ContextMenuPage({super.key}); + + @override + Widget build(BuildContext context) { + return CupertinoPageScaffold( + navigationBar: const CupertinoNavigationBar(middle: Text('Context Menu')), + child: Center( + child: Column( + mainAxisAlignment: MainAxisAlignment.center, + children: [ + Text('Long press to activate context menu:'), + SizedBox(height: 16), + SizedBox( + width: 100, + height: 100, + child: CupertinoContextMenu( + actions: [ + CupertinoContextMenuAction( + child: const Text('Action one'), + onPressed: () { + Navigator.pop(context); + }, + ), + CupertinoContextMenuAction( + child: const Text('Action two'), + onPressed: () { + Navigator.pop(context); + }, + ), + ], + child: Container(color: CupertinoColors.activeBlue), + ), + ), + ], + ), + ), + ); + } +} diff --git a/cupertino_gallery/lib/widgets/date_picker_page.dart b/cupertino_gallery/lib/widgets/date_picker_page.dart new file mode 100644 index 000000000..26395a315 --- /dev/null +++ b/cupertino_gallery/lib/widgets/date_picker_page.dart @@ -0,0 +1,22 @@ +import 'package:flutter/cupertino.dart'; + +class DatePickerPage extends StatelessWidget { + const DatePickerPage({super.key}); + + @override + Widget build(BuildContext context) { + return CupertinoPageScaffold( + navigationBar: const CupertinoNavigationBar( + middle: Text('Date Picker'), + ), + child: Center( + child: SizedBox( + height: 200, + child: CupertinoDatePicker( + onDateTimeChanged: (DateTime newDate) {}, + ), + ), + ), + ); + } +} diff --git a/cupertino_gallery/lib/widgets/list_tile_page.dart b/cupertino_gallery/lib/widgets/list_tile_page.dart new file mode 100644 index 000000000..4821c14fd --- /dev/null +++ b/cupertino_gallery/lib/widgets/list_tile_page.dart @@ -0,0 +1,62 @@ +import 'package:flutter/cupertino.dart'; + +class ListTilePage extends StatelessWidget { + const ListTilePage({super.key}); + + @override + Widget build(BuildContext context) { + return CupertinoPageScaffold( + navigationBar: const CupertinoNavigationBar(middle: Text('List Tile')), + child: Center( + child: ListView( + children: [ + CupertinoListSection.insetGrouped( + children: [ + CupertinoListTile( + title: Text('Title'), + subtitle: Text('Subtitle'), + leading: Icon(CupertinoIcons.info), + trailing: Icon(CupertinoIcons.forward), + ), + CupertinoListTile( + title: Text('Title'), + subtitle: Text('Subtitle'), + leading: Icon(CupertinoIcons.person), + trailing: Icon(CupertinoIcons.forward), + ), + CupertinoListTile( + title: Text('Title'), + subtitle: Text('Subtitle'), + leading: Icon(CupertinoIcons.wifi), + trailing: Icon(CupertinoIcons.forward), + ), + ], + ), + CupertinoListSection( + children: [ + CupertinoListTile( + title: Text('Title'), + subtitle: Text('Subtitle'), + leading: Icon(CupertinoIcons.search), + trailing: Icon(CupertinoIcons.forward), + ), + CupertinoListTile( + title: Text('Title'), + subtitle: Text('Subtitle'), + leading: Icon(CupertinoIcons.heart_fill), + trailing: Icon(CupertinoIcons.forward), + ), + CupertinoListTile( + title: Text('Title'), + subtitle: Text('Subtitle'), + leading: Icon(CupertinoIcons.ant), + trailing: Icon(CupertinoIcons.forward), + ), + ], + ), + ], + ), + ), + ); + } +} diff --git a/cupertino_gallery/lib/widgets/picker_page.dart b/cupertino_gallery/lib/widgets/picker_page.dart new file mode 100644 index 000000000..21726435b --- /dev/null +++ b/cupertino_gallery/lib/widgets/picker_page.dart @@ -0,0 +1,28 @@ +import 'package:flutter/cupertino.dart'; + +class PickerPage extends StatelessWidget { + const PickerPage({super.key}); + + @override + Widget build(BuildContext context) { + return CupertinoPageScaffold( + navigationBar: const CupertinoNavigationBar( + middle: Text('Picker'), + ), + child: Center( + child: SizedBox( + height: 200, + child: CupertinoPicker( + itemExtent: 32, + onSelectedItemChanged: (int index) {}, + children: const [ + Text('One'), + Text('Two'), + Text('Three'), + ], + ), + ), + ), + ); + } +} diff --git a/cupertino_gallery/lib/widgets/popup_surface_page.dart b/cupertino_gallery/lib/widgets/popup_surface_page.dart new file mode 100644 index 000000000..c817ab474 --- /dev/null +++ b/cupertino_gallery/lib/widgets/popup_surface_page.dart @@ -0,0 +1,36 @@ +import 'package:flutter/cupertino.dart'; + +class PopupSurfacePage extends StatelessWidget { + const PopupSurfacePage({super.key}); + + @override + Widget build(BuildContext context) { + return CupertinoPageScaffold( + navigationBar: const CupertinoNavigationBar( + middle: Text('Popup Surface'), + ), + child: Center( + child: CupertinoButton( + child: const Text('Show Popup Surface'), + onPressed: () { + showCupertinoModalPopup( + context: context, + builder: (BuildContext context) { + return CupertinoPopupSurface( + child: Container( + color: CupertinoColors.white, + width: 200, + height: 200, + child: const Center( + child: Text('This is a popup surface.'), + ), + ), + ); + }, + ); + }, + ), + ), + ); + } +} diff --git a/cupertino_gallery/lib/widgets/radio_page.dart b/cupertino_gallery/lib/widgets/radio_page.dart new file mode 100644 index 000000000..f5e768472 --- /dev/null +++ b/cupertino_gallery/lib/widgets/radio_page.dart @@ -0,0 +1,46 @@ +import 'package:flutter/cupertino.dart'; + +class RadioPage extends StatefulWidget { + const RadioPage({super.key}); + + @override + State createState() => _RadioPageState(); +} + +class _RadioPageState extends State { + int _selectedValue = 0; + + @override + Widget build(BuildContext context) { + return CupertinoPageScaffold( + navigationBar: const CupertinoNavigationBar(middle: Text('Radio')), + child: Center( + child: RadioGroup( + groupValue: _selectedValue, + onChanged: (int? value) { + setState(() { + _selectedValue = value!; + }); + }, + child: Column( + mainAxisAlignment: MainAxisAlignment.center, + children: [ + CupertinoListTile( + title: const Text('Option 1'), + leading: CupertinoRadio(value: 0), + ), + CupertinoListTile( + title: const Text('Option 2'), + leading: CupertinoRadio(value: 1), + ), + CupertinoListTile( + title: const Text('Option 3'), + leading: CupertinoRadio(value: 2), + ), + ], + ), + ), + ), + ); + } +} diff --git a/cupertino_gallery/lib/widgets/scrollbar_page.dart b/cupertino_gallery/lib/widgets/scrollbar_page.dart new file mode 100644 index 000000000..fdecb34cb --- /dev/null +++ b/cupertino_gallery/lib/widgets/scrollbar_page.dart @@ -0,0 +1,26 @@ +import 'package:flutter/cupertino.dart'; + +class ScrollbarPage extends StatelessWidget { + const ScrollbarPage({super.key}); + + @override + Widget build(BuildContext context) { + final ScrollController controller = ScrollController(); + return CupertinoPageScaffold( + navigationBar: CupertinoNavigationBar(middle: Text('Scrollbar')), + child: CupertinoScrollbar( + controller: controller, + child: ListView.separated( + controller: controller, + itemCount: 100, + itemBuilder: (BuildContext context, int index) { + return CupertinoListTile(title: Text('Item $index')); + }, + separatorBuilder: (BuildContext context, int index) { + return Container(height: 1, color: CupertinoColors.opaqueSeparator); + }, + ), + ), + ); + } +} diff --git a/cupertino_gallery/lib/widgets/search_text_field_page.dart b/cupertino_gallery/lib/widgets/search_text_field_page.dart new file mode 100644 index 000000000..00aefc65c --- /dev/null +++ b/cupertino_gallery/lib/widgets/search_text_field_page.dart @@ -0,0 +1,20 @@ +import 'package:flutter/cupertino.dart'; + +class SearchTextFieldPage extends StatelessWidget { + const SearchTextFieldPage({super.key}); + + @override + Widget build(BuildContext context) { + return const CupertinoPageScaffold( + navigationBar: CupertinoNavigationBar( + middle: Text('Search Text Field'), + ), + child: Center( + child: Padding( + padding: EdgeInsets.all(16.0), + child: CupertinoSearchTextField(), + ), + ), + ); + } +} diff --git a/cupertino_gallery/lib/widgets/segmented_control_page.dart b/cupertino_gallery/lib/widgets/segmented_control_page.dart new file mode 100644 index 000000000..614ca44b2 --- /dev/null +++ b/cupertino_gallery/lib/widgets/segmented_control_page.dart @@ -0,0 +1,36 @@ +import 'package:flutter/cupertino.dart'; + +class SegmentedControlPage extends StatefulWidget { + const SegmentedControlPage({super.key}); + + @override + State createState() => _SegmentedControlPageState(); +} + +class _SegmentedControlPageState extends State { + int _selectedIndex = 0; + + @override + Widget build(BuildContext context) { + return CupertinoPageScaffold( + navigationBar: const CupertinoNavigationBar( + middle: Text('Segmented Control'), + ), + child: Center( + child: CupertinoSegmentedControl( + children: { + 0: Text('One'), + 1: Text('Two'), + 2: Text('Three'), + }, + onValueChanged: (int val) { + setState(() { + _selectedIndex = val; + }); + }, + groupValue: _selectedIndex, + ), + ), + ); + } +} diff --git a/cupertino_gallery/lib/widgets/sheet_page.dart b/cupertino_gallery/lib/widgets/sheet_page.dart new file mode 100644 index 000000000..1020135d6 --- /dev/null +++ b/cupertino_gallery/lib/widgets/sheet_page.dart @@ -0,0 +1,39 @@ +import 'package:flutter/cupertino.dart'; + +class SheetPage extends StatelessWidget { + const SheetPage({super.key}); + + @override + Widget build(BuildContext context) { + return CupertinoPageScaffold( + navigationBar: const CupertinoNavigationBar(middle: Text('Sheet')), + child: Center( + child: CupertinoButton.filled( + child: const Text('Show Sheet'), + onPressed: () { + Navigator.of(context).push( + CupertinoSheetRoute( + builder: (BuildContext context) { + return CupertinoPageScaffold( + navigationBar: CupertinoNavigationBar( + middle: const Text('Sheet'), + trailing: GestureDetector( + child: const Icon(CupertinoIcons.xmark), + onTap: () { + Navigator.of(context).pop(); + }, + ), + ), + child: const Center( + child: Text('This is a sheet'), + ), + ); + }, + ), + ); + }, + ), + ), + ); + } +} diff --git a/cupertino_gallery/lib/widgets/slider_page.dart b/cupertino_gallery/lib/widgets/slider_page.dart new file mode 100644 index 000000000..61d812a43 --- /dev/null +++ b/cupertino_gallery/lib/widgets/slider_page.dart @@ -0,0 +1,31 @@ +import 'package:flutter/cupertino.dart'; + +class SliderPage extends StatefulWidget { + const SliderPage({super.key}); + + @override + State createState() => _SliderPageState(); +} + +class _SliderPageState extends State { + double _value = 0.5; + + @override + Widget build(BuildContext context) { + return CupertinoPageScaffold( + navigationBar: const CupertinoNavigationBar( + middle: Text('Slider'), + ), + child: Center( + child: CupertinoSlider( + value: _value, + onChanged: (double value) { + setState(() { + _value = value; + }); + }, + ), + ), + ); + } +} diff --git a/cupertino_gallery/lib/widgets/sliding_segmented_control_page.dart b/cupertino_gallery/lib/widgets/sliding_segmented_control_page.dart new file mode 100644 index 000000000..528c1512c --- /dev/null +++ b/cupertino_gallery/lib/widgets/sliding_segmented_control_page.dart @@ -0,0 +1,38 @@ +import 'package:flutter/cupertino.dart'; + +class SlidingSegmentedControlPage extends StatefulWidget { + const SlidingSegmentedControlPage({super.key}); + + @override + State createState() => + _SlidingSegmentedControlPageState(); +} + +class _SlidingSegmentedControlPageState + extends State { + int? _groupValue = 0; + + @override + Widget build(BuildContext context) { + return CupertinoPageScaffold( + navigationBar: const CupertinoNavigationBar( + middle: Text('Sliding Segmented Control'), + ), + child: Center( + child: CupertinoSlidingSegmentedControl( + children: const { + 0: Text('One'), + 1: Text('Two'), + 2: Text('Three'), + }, + onValueChanged: (int? value) { + setState(() { + _groupValue = value; + }); + }, + groupValue: _groupValue, + ), + ), + ); + } +} diff --git a/cupertino_gallery/lib/widgets/switch_page.dart b/cupertino_gallery/lib/widgets/switch_page.dart new file mode 100644 index 000000000..627ce29b1 --- /dev/null +++ b/cupertino_gallery/lib/widgets/switch_page.dart @@ -0,0 +1,31 @@ +import 'package:flutter/cupertino.dart'; + +class SwitchPage extends StatefulWidget { + const SwitchPage({super.key}); + + @override + State createState() => _SwitchPageState(); +} + +class _SwitchPageState extends State { + bool _value = true; + + @override + Widget build(BuildContext context) { + return CupertinoPageScaffold( + navigationBar: const CupertinoNavigationBar( + middle: Text('Switch'), + ), + child: Center( + child: CupertinoSwitch( + value: _value, + onChanged: (bool value) { + setState(() { + _value = value; + }); + }, + ), + ), + ); + } +} diff --git a/cupertino_gallery/lib/widgets/text_field_page.dart b/cupertino_gallery/lib/widgets/text_field_page.dart new file mode 100644 index 000000000..e8a8f27b1 --- /dev/null +++ b/cupertino_gallery/lib/widgets/text_field_page.dart @@ -0,0 +1,22 @@ +import 'package:flutter/cupertino.dart'; + +class TextFieldPage extends StatelessWidget { + const TextFieldPage({super.key}); + + @override + Widget build(BuildContext context) { + return const CupertinoPageScaffold( + navigationBar: CupertinoNavigationBar( + middle: Text('Text Field'), + ), + child: Center( + child: Padding( + padding: EdgeInsets.all(16.0), + child: CupertinoTextField( + placeholder: 'Enter text', + ), + ), + ), + ); + } +} diff --git a/cupertino_gallery/lib/widgets/text_theme_page.dart b/cupertino_gallery/lib/widgets/text_theme_page.dart new file mode 100644 index 000000000..9e360b86c --- /dev/null +++ b/cupertino_gallery/lib/widgets/text_theme_page.dart @@ -0,0 +1,58 @@ +import 'package:flutter/cupertino.dart'; + +class TextThemePage extends StatelessWidget { + const TextThemePage({super.key}); + + @override + Widget build(BuildContext context) { + return CupertinoPageScaffold( + navigationBar: const CupertinoNavigationBar( + middle: Text('Text Theme'), + ), + child: Center( + child: Column( + mainAxisAlignment: MainAxisAlignment.center, + children: [ + Text( + 'This is the default text style', + style: CupertinoTheme.of(context).textTheme.textStyle, + ), + const SizedBox(height: 16), + Text( + 'This is the action text style', + style: CupertinoTheme.of(context).textTheme.actionTextStyle, + ), + const SizedBox(height: 16), + Text( + 'This is the tab label text style', + style: CupertinoTheme.of(context).textTheme.tabLabelTextStyle, + ), + const SizedBox(height: 16), + Text( + 'This is the nav title text style', + style: CupertinoTheme.of(context).textTheme.navTitleTextStyle, + ), + const SizedBox(height: 16), + Text( + 'This is the nav large title text style', + style: CupertinoTheme.of(context) + .textTheme + .navLargeTitleTextStyle, + ), + const SizedBox(height: 16), + Text( + 'This is the picker text style', + style: CupertinoTheme.of(context).textTheme.pickerTextStyle, + ), + const SizedBox(height: 16), + Text( + 'This is the date time picker text style', + style: + CupertinoTheme.of(context).textTheme.dateTimePickerTextStyle, + ), + ], + ), + ), + ); + } +} diff --git a/cupertino_gallery/lib/widgets/time_picker_page.dart b/cupertino_gallery/lib/widgets/time_picker_page.dart new file mode 100644 index 000000000..64a9d28dc --- /dev/null +++ b/cupertino_gallery/lib/widgets/time_picker_page.dart @@ -0,0 +1,22 @@ +import 'package:flutter/cupertino.dart'; + +class TimePickerPage extends StatelessWidget { + const TimePickerPage({super.key}); + + @override + Widget build(BuildContext context) { + return CupertinoPageScaffold( + navigationBar: const CupertinoNavigationBar( + middle: Text('Time Picker'), + ), + child: Center( + child: SizedBox( + height: 200, + child: CupertinoTimerPicker( + onTimerDurationChanged: (Duration newDuration) {}, + ), + ), + ), + ); + } +} diff --git a/cupertino_gallery/lib/widgets_page.dart b/cupertino_gallery/lib/widgets_page.dart new file mode 100644 index 000000000..3c338299b --- /dev/null +++ b/cupertino_gallery/lib/widgets_page.dart @@ -0,0 +1,75 @@ +import 'package:flutter/cupertino.dart'; +import 'widget_detail_page.dart'; + +class WidgetsPage extends StatelessWidget { + const WidgetsPage({super.key}); + + @override + Widget build(BuildContext context) { + return CupertinoPageScaffold( + child: CustomScrollView( + slivers: [ + CupertinoSliverNavigationBar(largeTitle: Text('Cupertino Gallery')), + SliverFillRemaining( + child: ListView( + children: [ + CustomCupertinoListTile(title: 'Action Sheet'), + CustomCupertinoListTile(title: 'Activity Indicator'), + CustomCupertinoListTile(title: 'Alert Dialog'), + CustomCupertinoListTile(title: 'Button'), + CustomCupertinoListTile(title: 'Checkbox'), + CustomCupertinoListTile(title: 'Context Menu'), + CustomCupertinoListTile(title: 'Date Picker'), + CustomCupertinoListTile(title: 'List Tile'), + CustomCupertinoListTile(title: 'Picker'), + CustomCupertinoListTile(title: 'Popup Surface'), + CustomCupertinoListTile(title: 'Radio'), + CustomCupertinoListTile(title: 'Scrollbar'), + CustomCupertinoListTile(title: 'Search Text Field'), + CustomCupertinoListTile(title: 'Segmented Control'), + CustomCupertinoListTile(title: 'Sheet'), + CustomCupertinoListTile(title: 'Slider'), + CustomCupertinoListTile(title: 'Sliding Segmented Control'), + CustomCupertinoListTile(title: 'Switch'), + CustomCupertinoListTile(title: 'Text Field'), + CustomCupertinoListTile(title: 'Text Theme'), + CustomCupertinoListTile(title: 'Time Picker'), + ], + ), + ), + ], + ), + ); + } +} + +class CustomCupertinoListTile extends StatelessWidget { + const CustomCupertinoListTile({super.key, required this.title}); + + final String title; + + @override + Widget build(BuildContext context) { + return GestureDetector( + onTap: () { + Navigator.of(context).push( + CupertinoPageRoute( + builder: (BuildContext context) { + return WidgetDetailPage(title: title); + }, + ), + ); + }, + child: Container( + padding: const EdgeInsets.symmetric(horizontal: 16.0, vertical: 12.0), + decoration: const BoxDecoration( + border: Border(bottom: BorderSide(color: CupertinoColors.separator)), + ), + child: Row( + mainAxisAlignment: MainAxisAlignment.spaceBetween, + children: [Text(title), const Icon(CupertinoIcons.forward)], + ), + ), + ); + } +} diff --git a/cupertino_gallery/linux/.gitignore b/cupertino_gallery/linux/.gitignore new file mode 100644 index 000000000..d3896c984 --- /dev/null +++ b/cupertino_gallery/linux/.gitignore @@ -0,0 +1 @@ +flutter/ephemeral diff --git a/cupertino_gallery/linux/CMakeLists.txt b/cupertino_gallery/linux/CMakeLists.txt new file mode 100644 index 000000000..cee57a90d --- /dev/null +++ b/cupertino_gallery/linux/CMakeLists.txt @@ -0,0 +1,128 @@ +# Project-level configuration. +cmake_minimum_required(VERSION 3.13) +project(runner LANGUAGES CXX) + +# The name of the executable created for the application. Change this to change +# the on-disk name of your application. +set(BINARY_NAME "cupertino_gallery") +# The unique GTK application identifier for this application. See: +# https://wiki.gnome.org/HowDoI/ChooseApplicationID +set(APPLICATION_ID "com.example.cupertino_gallery") + +# Explicitly opt in to modern CMake behaviors to avoid warnings with recent +# versions of CMake. +cmake_policy(SET CMP0063 NEW) + +# Load bundled libraries from the lib/ directory relative to the binary. +set(CMAKE_INSTALL_RPATH "$ORIGIN/lib") + +# Root filesystem for cross-building. +if(FLUTTER_TARGET_PLATFORM_SYSROOT) + set(CMAKE_SYSROOT ${FLUTTER_TARGET_PLATFORM_SYSROOT}) + set(CMAKE_FIND_ROOT_PATH ${CMAKE_SYSROOT}) + set(CMAKE_FIND_ROOT_PATH_MODE_PROGRAM NEVER) + set(CMAKE_FIND_ROOT_PATH_MODE_PACKAGE ONLY) + set(CMAKE_FIND_ROOT_PATH_MODE_LIBRARY ONLY) + set(CMAKE_FIND_ROOT_PATH_MODE_INCLUDE ONLY) +endif() + +# Define build configuration options. +if(NOT CMAKE_BUILD_TYPE AND NOT CMAKE_CONFIGURATION_TYPES) + set(CMAKE_BUILD_TYPE "Debug" CACHE + STRING "Flutter build mode" FORCE) + set_property(CACHE CMAKE_BUILD_TYPE PROPERTY STRINGS + "Debug" "Profile" "Release") +endif() + +# Compilation settings that should be applied to most targets. +# +# Be cautious about adding new options here, as plugins use this function by +# default. In most cases, you should add new options to specific targets instead +# of modifying this function. +function(APPLY_STANDARD_SETTINGS TARGET) + target_compile_features(${TARGET} PUBLIC cxx_std_14) + target_compile_options(${TARGET} PRIVATE -Wall -Werror) + target_compile_options(${TARGET} PRIVATE "$<$>:-O3>") + target_compile_definitions(${TARGET} PRIVATE "$<$>:NDEBUG>") +endfunction() + +# Flutter library and tool build rules. +set(FLUTTER_MANAGED_DIR "${CMAKE_CURRENT_SOURCE_DIR}/flutter") +add_subdirectory(${FLUTTER_MANAGED_DIR}) + +# System-level dependencies. +find_package(PkgConfig REQUIRED) +pkg_check_modules(GTK REQUIRED IMPORTED_TARGET gtk+-3.0) + +# Application build; see runner/CMakeLists.txt. +add_subdirectory("runner") + +# Run the Flutter tool portions of the build. This must not be removed. +add_dependencies(${BINARY_NAME} flutter_assemble) + +# Only the install-generated bundle's copy of the executable will launch +# correctly, since the resources must in the right relative locations. To avoid +# people trying to run the unbundled copy, put it in a subdirectory instead of +# the default top-level location. +set_target_properties(${BINARY_NAME} + PROPERTIES + RUNTIME_OUTPUT_DIRECTORY "${CMAKE_BINARY_DIR}/intermediates_do_not_run" +) + + +# Generated plugin build rules, which manage building the plugins and adding +# them to the application. +include(flutter/generated_plugins.cmake) + + +# === Installation === +# By default, "installing" just makes a relocatable bundle in the build +# directory. +set(BUILD_BUNDLE_DIR "${PROJECT_BINARY_DIR}/bundle") +if(CMAKE_INSTALL_PREFIX_INITIALIZED_TO_DEFAULT) + set(CMAKE_INSTALL_PREFIX "${BUILD_BUNDLE_DIR}" CACHE PATH "..." FORCE) +endif() + +# Start with a clean build bundle directory every time. +install(CODE " + file(REMOVE_RECURSE \"${BUILD_BUNDLE_DIR}/\") + " COMPONENT Runtime) + +set(INSTALL_BUNDLE_DATA_DIR "${CMAKE_INSTALL_PREFIX}/data") +set(INSTALL_BUNDLE_LIB_DIR "${CMAKE_INSTALL_PREFIX}/lib") + +install(TARGETS ${BINARY_NAME} RUNTIME DESTINATION "${CMAKE_INSTALL_PREFIX}" + COMPONENT Runtime) + +install(FILES "${FLUTTER_ICU_DATA_FILE}" DESTINATION "${INSTALL_BUNDLE_DATA_DIR}" + COMPONENT Runtime) + +install(FILES "${FLUTTER_LIBRARY}" DESTINATION "${INSTALL_BUNDLE_LIB_DIR}" + COMPONENT Runtime) + +foreach(bundled_library ${PLUGIN_BUNDLED_LIBRARIES}) + install(FILES "${bundled_library}" + DESTINATION "${INSTALL_BUNDLE_LIB_DIR}" + COMPONENT Runtime) +endforeach(bundled_library) + +# Copy the native assets provided by the build.dart from all packages. +set(NATIVE_ASSETS_DIR "${PROJECT_BUILD_DIR}native_assets/linux/") +install(DIRECTORY "${NATIVE_ASSETS_DIR}" + DESTINATION "${INSTALL_BUNDLE_LIB_DIR}" + COMPONENT Runtime) + +# Fully re-copy the assets directory on each build to avoid having stale files +# from a previous install. +set(FLUTTER_ASSET_DIR_NAME "flutter_assets") +install(CODE " + file(REMOVE_RECURSE \"${INSTALL_BUNDLE_DATA_DIR}/${FLUTTER_ASSET_DIR_NAME}\") + " COMPONENT Runtime) +install(DIRECTORY "${PROJECT_BUILD_DIR}/${FLUTTER_ASSET_DIR_NAME}" + DESTINATION "${INSTALL_BUNDLE_DATA_DIR}" COMPONENT Runtime) + +# Install the AOT library on non-Debug builds only. +if(NOT CMAKE_BUILD_TYPE MATCHES "Debug") + install(FILES "${AOT_LIBRARY}" DESTINATION "${INSTALL_BUNDLE_LIB_DIR}" + COMPONENT Runtime) +endif() diff --git a/cupertino_gallery/linux/flutter/CMakeLists.txt b/cupertino_gallery/linux/flutter/CMakeLists.txt new file mode 100644 index 000000000..d5bd01648 --- /dev/null +++ b/cupertino_gallery/linux/flutter/CMakeLists.txt @@ -0,0 +1,88 @@ +# This file controls Flutter-level build steps. It should not be edited. +cmake_minimum_required(VERSION 3.10) + +set(EPHEMERAL_DIR "${CMAKE_CURRENT_SOURCE_DIR}/ephemeral") + +# Configuration provided via flutter tool. +include(${EPHEMERAL_DIR}/generated_config.cmake) + +# TODO: Move the rest of this into files in ephemeral. See +# https://github.com/flutter/flutter/issues/57146. + +# Serves the same purpose as list(TRANSFORM ... PREPEND ...), +# which isn't available in 3.10. +function(list_prepend LIST_NAME PREFIX) + set(NEW_LIST "") + foreach(element ${${LIST_NAME}}) + list(APPEND NEW_LIST "${PREFIX}${element}") + endforeach(element) + set(${LIST_NAME} "${NEW_LIST}" PARENT_SCOPE) +endfunction() + +# === Flutter Library === +# System-level dependencies. +find_package(PkgConfig REQUIRED) +pkg_check_modules(GTK REQUIRED IMPORTED_TARGET gtk+-3.0) +pkg_check_modules(GLIB REQUIRED IMPORTED_TARGET glib-2.0) +pkg_check_modules(GIO REQUIRED IMPORTED_TARGET gio-2.0) + +set(FLUTTER_LIBRARY "${EPHEMERAL_DIR}/libflutter_linux_gtk.so") + +# Published to parent scope for install step. +set(FLUTTER_LIBRARY ${FLUTTER_LIBRARY} PARENT_SCOPE) +set(FLUTTER_ICU_DATA_FILE "${EPHEMERAL_DIR}/icudtl.dat" PARENT_SCOPE) +set(PROJECT_BUILD_DIR "${PROJECT_DIR}/build/" PARENT_SCOPE) +set(AOT_LIBRARY "${PROJECT_DIR}/build/lib/libapp.so" PARENT_SCOPE) + +list(APPEND FLUTTER_LIBRARY_HEADERS + "fl_basic_message_channel.h" + "fl_binary_codec.h" + "fl_binary_messenger.h" + "fl_dart_project.h" + "fl_engine.h" + "fl_json_message_codec.h" + "fl_json_method_codec.h" + "fl_message_codec.h" + "fl_method_call.h" + "fl_method_channel.h" + "fl_method_codec.h" + "fl_method_response.h" + "fl_plugin_registrar.h" + "fl_plugin_registry.h" + "fl_standard_message_codec.h" + "fl_standard_method_codec.h" + "fl_string_codec.h" + "fl_value.h" + "fl_view.h" + "flutter_linux.h" +) +list_prepend(FLUTTER_LIBRARY_HEADERS "${EPHEMERAL_DIR}/flutter_linux/") +add_library(flutter INTERFACE) +target_include_directories(flutter INTERFACE + "${EPHEMERAL_DIR}" +) +target_link_libraries(flutter INTERFACE "${FLUTTER_LIBRARY}") +target_link_libraries(flutter INTERFACE + PkgConfig::GTK + PkgConfig::GLIB + PkgConfig::GIO +) +add_dependencies(flutter flutter_assemble) + +# === Flutter tool backend === +# _phony_ is a non-existent file to force this command to run every time, +# since currently there's no way to get a full input/output list from the +# flutter tool. +add_custom_command( + OUTPUT ${FLUTTER_LIBRARY} ${FLUTTER_LIBRARY_HEADERS} + ${CMAKE_CURRENT_BINARY_DIR}/_phony_ + COMMAND ${CMAKE_COMMAND} -E env + ${FLUTTER_TOOL_ENVIRONMENT} + "${FLUTTER_ROOT}/packages/flutter_tools/bin/tool_backend.sh" + ${FLUTTER_TARGET_PLATFORM} ${CMAKE_BUILD_TYPE} + VERBATIM +) +add_custom_target(flutter_assemble DEPENDS + "${FLUTTER_LIBRARY}" + ${FLUTTER_LIBRARY_HEADERS} +) diff --git a/cupertino_gallery/linux/flutter/generated_plugin_registrant.cc b/cupertino_gallery/linux/flutter/generated_plugin_registrant.cc new file mode 100644 index 000000000..e71a16d23 --- /dev/null +++ b/cupertino_gallery/linux/flutter/generated_plugin_registrant.cc @@ -0,0 +1,11 @@ +// +// Generated file. Do not edit. +// + +// clang-format off + +#include "generated_plugin_registrant.h" + + +void fl_register_plugins(FlPluginRegistry* registry) { +} diff --git a/cupertino_gallery/linux/flutter/generated_plugin_registrant.h b/cupertino_gallery/linux/flutter/generated_plugin_registrant.h new file mode 100644 index 000000000..e0f0a47bc --- /dev/null +++ b/cupertino_gallery/linux/flutter/generated_plugin_registrant.h @@ -0,0 +1,15 @@ +// +// Generated file. Do not edit. +// + +// clang-format off + +#ifndef GENERATED_PLUGIN_REGISTRANT_ +#define GENERATED_PLUGIN_REGISTRANT_ + +#include + +// Registers Flutter plugins. +void fl_register_plugins(FlPluginRegistry* registry); + +#endif // GENERATED_PLUGIN_REGISTRANT_ diff --git a/cupertino_gallery/linux/flutter/generated_plugins.cmake b/cupertino_gallery/linux/flutter/generated_plugins.cmake new file mode 100644 index 000000000..2e1de87a7 --- /dev/null +++ b/cupertino_gallery/linux/flutter/generated_plugins.cmake @@ -0,0 +1,23 @@ +# +# Generated file, do not edit. +# + +list(APPEND FLUTTER_PLUGIN_LIST +) + +list(APPEND FLUTTER_FFI_PLUGIN_LIST +) + +set(PLUGIN_BUNDLED_LIBRARIES) + +foreach(plugin ${FLUTTER_PLUGIN_LIST}) + add_subdirectory(flutter/ephemeral/.plugin_symlinks/${plugin}/linux plugins/${plugin}) + target_link_libraries(${BINARY_NAME} PRIVATE ${plugin}_plugin) + list(APPEND PLUGIN_BUNDLED_LIBRARIES $) + list(APPEND PLUGIN_BUNDLED_LIBRARIES ${${plugin}_bundled_libraries}) +endforeach(plugin) + +foreach(ffi_plugin ${FLUTTER_FFI_PLUGIN_LIST}) + add_subdirectory(flutter/ephemeral/.plugin_symlinks/${ffi_plugin}/linux plugins/${ffi_plugin}) + list(APPEND PLUGIN_BUNDLED_LIBRARIES ${${ffi_plugin}_bundled_libraries}) +endforeach(ffi_plugin) diff --git a/cupertino_gallery/linux/runner/CMakeLists.txt b/cupertino_gallery/linux/runner/CMakeLists.txt new file mode 100644 index 000000000..e97dabc70 --- /dev/null +++ b/cupertino_gallery/linux/runner/CMakeLists.txt @@ -0,0 +1,26 @@ +cmake_minimum_required(VERSION 3.13) +project(runner LANGUAGES CXX) + +# Define the application target. To change its name, change BINARY_NAME in the +# top-level CMakeLists.txt, not the value here, or `flutter run` will no longer +# work. +# +# Any new source files that you add to the application should be added here. +add_executable(${BINARY_NAME} + "main.cc" + "my_application.cc" + "${FLUTTER_MANAGED_DIR}/generated_plugin_registrant.cc" +) + +# Apply the standard set of build settings. This can be removed for applications +# that need different build settings. +apply_standard_settings(${BINARY_NAME}) + +# Add preprocessor definitions for the application ID. +add_definitions(-DAPPLICATION_ID="${APPLICATION_ID}") + +# Add dependency libraries. Add any application-specific dependencies here. +target_link_libraries(${BINARY_NAME} PRIVATE flutter) +target_link_libraries(${BINARY_NAME} PRIVATE PkgConfig::GTK) + +target_include_directories(${BINARY_NAME} PRIVATE "${CMAKE_SOURCE_DIR}") diff --git a/cupertino_gallery/linux/runner/main.cc b/cupertino_gallery/linux/runner/main.cc new file mode 100644 index 000000000..e7c5c5437 --- /dev/null +++ b/cupertino_gallery/linux/runner/main.cc @@ -0,0 +1,6 @@ +#include "my_application.h" + +int main(int argc, char** argv) { + g_autoptr(MyApplication) app = my_application_new(); + return g_application_run(G_APPLICATION(app), argc, argv); +} diff --git a/cupertino_gallery/linux/runner/my_application.cc b/cupertino_gallery/linux/runner/my_application.cc new file mode 100644 index 000000000..781e7415b --- /dev/null +++ b/cupertino_gallery/linux/runner/my_application.cc @@ -0,0 +1,144 @@ +#include "my_application.h" + +#include +#ifdef GDK_WINDOWING_X11 +#include +#endif + +#include "flutter/generated_plugin_registrant.h" + +struct _MyApplication { + GtkApplication parent_instance; + char** dart_entrypoint_arguments; +}; + +G_DEFINE_TYPE(MyApplication, my_application, GTK_TYPE_APPLICATION) + +// Called when first Flutter frame received. +static void first_frame_cb(MyApplication* self, FlView *view) +{ + gtk_widget_show(gtk_widget_get_toplevel(GTK_WIDGET(view))); +} + +// Implements GApplication::activate. +static void my_application_activate(GApplication* application) { + MyApplication* self = MY_APPLICATION(application); + GtkWindow* window = + GTK_WINDOW(gtk_application_window_new(GTK_APPLICATION(application))); + + // Use a header bar when running in GNOME as this is the common style used + // by applications and is the setup most users will be using (e.g. Ubuntu + // desktop). + // If running on X and not using GNOME then just use a traditional title bar + // in case the window manager does more exotic layout, e.g. tiling. + // If running on Wayland assume the header bar will work (may need changing + // if future cases occur). + gboolean use_header_bar = TRUE; +#ifdef GDK_WINDOWING_X11 + GdkScreen* screen = gtk_window_get_screen(window); + if (GDK_IS_X11_SCREEN(screen)) { + const gchar* wm_name = gdk_x11_screen_get_window_manager_name(screen); + if (g_strcmp0(wm_name, "GNOME Shell") != 0) { + use_header_bar = FALSE; + } + } +#endif + if (use_header_bar) { + GtkHeaderBar* header_bar = GTK_HEADER_BAR(gtk_header_bar_new()); + gtk_widget_show(GTK_WIDGET(header_bar)); + gtk_header_bar_set_title(header_bar, "cupertino_gallery"); + gtk_header_bar_set_show_close_button(header_bar, TRUE); + gtk_window_set_titlebar(window, GTK_WIDGET(header_bar)); + } else { + gtk_window_set_title(window, "cupertino_gallery"); + } + + gtk_window_set_default_size(window, 1280, 720); + + g_autoptr(FlDartProject) project = fl_dart_project_new(); + fl_dart_project_set_dart_entrypoint_arguments(project, self->dart_entrypoint_arguments); + + FlView* view = fl_view_new(project); + GdkRGBA background_color; + // Background defaults to black, override it here if necessary, e.g. #00000000 for transparent. + gdk_rgba_parse(&background_color, "#000000"); + fl_view_set_background_color(view, &background_color); + gtk_widget_show(GTK_WIDGET(view)); + gtk_container_add(GTK_CONTAINER(window), GTK_WIDGET(view)); + + // Show the window when Flutter renders. + // Requires the view to be realized so we can start rendering. + g_signal_connect_swapped(view, "first-frame", G_CALLBACK(first_frame_cb), self); + gtk_widget_realize(GTK_WIDGET(view)); + + fl_register_plugins(FL_PLUGIN_REGISTRY(view)); + + gtk_widget_grab_focus(GTK_WIDGET(view)); +} + +// Implements GApplication::local_command_line. +static gboolean my_application_local_command_line(GApplication* application, gchar*** arguments, int* exit_status) { + MyApplication* self = MY_APPLICATION(application); + // Strip out the first argument as it is the binary name. + self->dart_entrypoint_arguments = g_strdupv(*arguments + 1); + + g_autoptr(GError) error = nullptr; + if (!g_application_register(application, nullptr, &error)) { + g_warning("Failed to register: %s", error->message); + *exit_status = 1; + return TRUE; + } + + g_application_activate(application); + *exit_status = 0; + + return TRUE; +} + +// Implements GApplication::startup. +static void my_application_startup(GApplication* application) { + //MyApplication* self = MY_APPLICATION(object); + + // Perform any actions required at application startup. + + G_APPLICATION_CLASS(my_application_parent_class)->startup(application); +} + +// Implements GApplication::shutdown. +static void my_application_shutdown(GApplication* application) { + //MyApplication* self = MY_APPLICATION(object); + + // Perform any actions required at application shutdown. + + G_APPLICATION_CLASS(my_application_parent_class)->shutdown(application); +} + +// Implements GObject::dispose. +static void my_application_dispose(GObject* object) { + MyApplication* self = MY_APPLICATION(object); + g_clear_pointer(&self->dart_entrypoint_arguments, g_strfreev); + G_OBJECT_CLASS(my_application_parent_class)->dispose(object); +} + +static void my_application_class_init(MyApplicationClass* klass) { + G_APPLICATION_CLASS(klass)->activate = my_application_activate; + G_APPLICATION_CLASS(klass)->local_command_line = my_application_local_command_line; + G_APPLICATION_CLASS(klass)->startup = my_application_startup; + G_APPLICATION_CLASS(klass)->shutdown = my_application_shutdown; + G_OBJECT_CLASS(klass)->dispose = my_application_dispose; +} + +static void my_application_init(MyApplication* self) {} + +MyApplication* my_application_new() { + // Set the program name to the application ID, which helps various systems + // like GTK and desktop environments map this running application to its + // corresponding .desktop file. This ensures better integration by allowing + // the application to be recognized beyond its binary name. + g_set_prgname(APPLICATION_ID); + + return MY_APPLICATION(g_object_new(my_application_get_type(), + "application-id", APPLICATION_ID, + "flags", G_APPLICATION_NON_UNIQUE, + nullptr)); +} diff --git a/cupertino_gallery/linux/runner/my_application.h b/cupertino_gallery/linux/runner/my_application.h new file mode 100644 index 000000000..72271d5e4 --- /dev/null +++ b/cupertino_gallery/linux/runner/my_application.h @@ -0,0 +1,18 @@ +#ifndef FLUTTER_MY_APPLICATION_H_ +#define FLUTTER_MY_APPLICATION_H_ + +#include + +G_DECLARE_FINAL_TYPE(MyApplication, my_application, MY, APPLICATION, + GtkApplication) + +/** + * my_application_new: + * + * Creates a new Flutter-based application. + * + * Returns: a new #MyApplication. + */ +MyApplication* my_application_new(); + +#endif // FLUTTER_MY_APPLICATION_H_ diff --git a/cupertino_gallery/macos/.gitignore b/cupertino_gallery/macos/.gitignore new file mode 100644 index 000000000..746adbb6b --- /dev/null +++ b/cupertino_gallery/macos/.gitignore @@ -0,0 +1,7 @@ +# Flutter-related +**/Flutter/ephemeral/ +**/Pods/ + +# Xcode-related +**/dgph +**/xcuserdata/ diff --git a/cupertino_gallery/macos/Flutter/Flutter-Debug.xcconfig b/cupertino_gallery/macos/Flutter/Flutter-Debug.xcconfig new file mode 100644 index 000000000..c2efd0b60 --- /dev/null +++ b/cupertino_gallery/macos/Flutter/Flutter-Debug.xcconfig @@ -0,0 +1 @@ +#include "ephemeral/Flutter-Generated.xcconfig" diff --git a/cupertino_gallery/macos/Flutter/Flutter-Release.xcconfig b/cupertino_gallery/macos/Flutter/Flutter-Release.xcconfig new file mode 100644 index 000000000..c2efd0b60 --- /dev/null +++ b/cupertino_gallery/macos/Flutter/Flutter-Release.xcconfig @@ -0,0 +1 @@ +#include "ephemeral/Flutter-Generated.xcconfig" diff --git a/cupertino_gallery/macos/Flutter/GeneratedPluginRegistrant.swift b/cupertino_gallery/macos/Flutter/GeneratedPluginRegistrant.swift new file mode 100644 index 000000000..cccf817a5 --- /dev/null +++ b/cupertino_gallery/macos/Flutter/GeneratedPluginRegistrant.swift @@ -0,0 +1,10 @@ +// +// Generated file. Do not edit. +// + +import FlutterMacOS +import Foundation + + +func RegisterGeneratedPlugins(registry: FlutterPluginRegistry) { +} diff --git a/cupertino_gallery/macos/Runner.xcodeproj/project.pbxproj b/cupertino_gallery/macos/Runner.xcodeproj/project.pbxproj new file mode 100644 index 000000000..ad1b7939b --- /dev/null +++ b/cupertino_gallery/macos/Runner.xcodeproj/project.pbxproj @@ -0,0 +1,705 @@ +// !$*UTF8*$! +{ + archiveVersion = 1; + classes = { + }; + objectVersion = 54; + objects = { + +/* Begin PBXAggregateTarget section */ + 33CC111A2044C6BA0003C045 /* Flutter Assemble */ = { + isa = PBXAggregateTarget; + buildConfigurationList = 33CC111B2044C6BA0003C045 /* Build configuration list for PBXAggregateTarget "Flutter Assemble" */; + buildPhases = ( + 33CC111E2044C6BF0003C045 /* ShellScript */, + ); + dependencies = ( + ); + name = "Flutter Assemble"; + productName = FLX; + }; +/* End PBXAggregateTarget section */ + +/* Begin PBXBuildFile section */ + 331C80D8294CF71000263BE5 /* RunnerTests.swift in Sources */ = {isa = PBXBuildFile; fileRef = 331C80D7294CF71000263BE5 /* RunnerTests.swift */; }; + 335BBD1B22A9A15E00E9071D /* GeneratedPluginRegistrant.swift in Sources */ = {isa = PBXBuildFile; fileRef = 335BBD1A22A9A15E00E9071D /* GeneratedPluginRegistrant.swift */; }; + 33CC10F12044A3C60003C045 /* AppDelegate.swift in Sources */ = {isa = PBXBuildFile; fileRef = 33CC10F02044A3C60003C045 /* AppDelegate.swift */; }; + 33CC10F32044A3C60003C045 /* Assets.xcassets in Resources */ = {isa = PBXBuildFile; fileRef = 33CC10F22044A3C60003C045 /* Assets.xcassets */; }; + 33CC10F62044A3C60003C045 /* MainMenu.xib in Resources */ = {isa = PBXBuildFile; fileRef = 33CC10F42044A3C60003C045 /* MainMenu.xib */; }; + 33CC11132044BFA00003C045 /* MainFlutterWindow.swift in Sources */ = {isa = PBXBuildFile; fileRef = 33CC11122044BFA00003C045 /* MainFlutterWindow.swift */; }; +/* End PBXBuildFile section */ + +/* Begin PBXContainerItemProxy section */ + 331C80D9294CF71000263BE5 /* PBXContainerItemProxy */ = { + isa = PBXContainerItemProxy; + containerPortal = 33CC10E52044A3C60003C045 /* Project object */; + proxyType = 1; + remoteGlobalIDString = 33CC10EC2044A3C60003C045; + remoteInfo = Runner; + }; + 33CC111F2044C79F0003C045 /* PBXContainerItemProxy */ = { + isa = PBXContainerItemProxy; + containerPortal = 33CC10E52044A3C60003C045 /* Project object */; + proxyType = 1; + remoteGlobalIDString = 33CC111A2044C6BA0003C045; + remoteInfo = FLX; + }; +/* End PBXContainerItemProxy section */ + +/* Begin PBXCopyFilesBuildPhase section */ + 33CC110E2044A8840003C045 /* Bundle Framework */ = { + isa = PBXCopyFilesBuildPhase; + buildActionMask = 2147483647; + dstPath = ""; + dstSubfolderSpec = 10; + files = ( + ); + name = "Bundle Framework"; + runOnlyForDeploymentPostprocessing = 0; + }; +/* End PBXCopyFilesBuildPhase section */ + +/* Begin PBXFileReference section */ + 331C80D5294CF71000263BE5 /* RunnerTests.xctest */ = {isa = PBXFileReference; explicitFileType = wrapper.cfbundle; includeInIndex = 0; path = RunnerTests.xctest; sourceTree = BUILT_PRODUCTS_DIR; }; + 331C80D7294CF71000263BE5 /* RunnerTests.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = RunnerTests.swift; sourceTree = ""; }; + 333000ED22D3DE5D00554162 /* Warnings.xcconfig */ = {isa = PBXFileReference; lastKnownFileType = text.xcconfig; path = Warnings.xcconfig; sourceTree = ""; }; + 335BBD1A22A9A15E00E9071D /* GeneratedPluginRegistrant.swift */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.swift; path = GeneratedPluginRegistrant.swift; sourceTree = ""; }; + 33CC10ED2044A3C60003C045 /* cupertino_gallery.app */ = {isa = PBXFileReference; explicitFileType = wrapper.application; includeInIndex = 0; path = "cupertino_gallery.app"; sourceTree = BUILT_PRODUCTS_DIR; }; + 33CC10F02044A3C60003C045 /* AppDelegate.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = AppDelegate.swift; sourceTree = ""; }; + 33CC10F22044A3C60003C045 /* Assets.xcassets */ = {isa = PBXFileReference; lastKnownFileType = folder.assetcatalog; name = Assets.xcassets; path = Runner/Assets.xcassets; sourceTree = ""; }; + 33CC10F52044A3C60003C045 /* Base */ = {isa = PBXFileReference; lastKnownFileType = file.xib; name = Base; path = Base.lproj/MainMenu.xib; sourceTree = ""; }; + 33CC10F72044A3C60003C045 /* Info.plist */ = {isa = PBXFileReference; lastKnownFileType = text.plist.xml; name = Info.plist; path = Runner/Info.plist; sourceTree = ""; }; + 33CC11122044BFA00003C045 /* MainFlutterWindow.swift */ = {isa = PBXFileReference; lastKnownFileType = sourcecode.swift; path = MainFlutterWindow.swift; sourceTree = ""; }; + 33CEB47222A05771004F2AC0 /* Flutter-Debug.xcconfig */ = {isa = PBXFileReference; lastKnownFileType = text.xcconfig; path = "Flutter-Debug.xcconfig"; sourceTree = ""; }; + 33CEB47422A05771004F2AC0 /* Flutter-Release.xcconfig */ = {isa = PBXFileReference; lastKnownFileType = text.xcconfig; path = "Flutter-Release.xcconfig"; sourceTree = ""; }; + 33CEB47722A0578A004F2AC0 /* Flutter-Generated.xcconfig */ = {isa = PBXFileReference; lastKnownFileType = text.xcconfig; name = "Flutter-Generated.xcconfig"; path = "ephemeral/Flutter-Generated.xcconfig"; sourceTree = ""; }; + 33E51913231747F40026EE4D /* DebugProfile.entitlements */ = {isa = PBXFileReference; lastKnownFileType = text.plist.entitlements; path = DebugProfile.entitlements; sourceTree = ""; }; + 33E51914231749380026EE4D /* Release.entitlements */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = text.plist.entitlements; path = Release.entitlements; sourceTree = ""; }; + 33E5194F232828860026EE4D /* AppInfo.xcconfig */ = {isa = PBXFileReference; lastKnownFileType = text.xcconfig; path = AppInfo.xcconfig; sourceTree = ""; }; + 7AFA3C8E1D35360C0083082E /* Release.xcconfig */ = {isa = PBXFileReference; lastKnownFileType = text.xcconfig; path = Release.xcconfig; sourceTree = ""; }; + 9740EEB21CF90195004384FC /* Debug.xcconfig */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = text.xcconfig; path = Debug.xcconfig; sourceTree = ""; }; +/* End PBXFileReference section */ + +/* Begin PBXFrameworksBuildPhase section */ + 331C80D2294CF70F00263BE5 /* Frameworks */ = { + isa = PBXFrameworksBuildPhase; + buildActionMask = 2147483647; + files = ( + ); + runOnlyForDeploymentPostprocessing = 0; + }; + 33CC10EA2044A3C60003C045 /* Frameworks */ = { + isa = PBXFrameworksBuildPhase; + buildActionMask = 2147483647; + files = ( + ); + runOnlyForDeploymentPostprocessing = 0; + }; +/* End PBXFrameworksBuildPhase section */ + +/* Begin PBXGroup section */ + 331C80D6294CF71000263BE5 /* RunnerTests */ = { + isa = PBXGroup; + children = ( + 331C80D7294CF71000263BE5 /* RunnerTests.swift */, + ); + path = RunnerTests; + sourceTree = ""; + }; + 33BA886A226E78AF003329D5 /* Configs */ = { + isa = PBXGroup; + children = ( + 33E5194F232828860026EE4D /* AppInfo.xcconfig */, + 9740EEB21CF90195004384FC /* Debug.xcconfig */, + 7AFA3C8E1D35360C0083082E /* Release.xcconfig */, + 333000ED22D3DE5D00554162 /* Warnings.xcconfig */, + ); + path = Configs; + sourceTree = ""; + }; + 33CC10E42044A3C60003C045 = { + isa = PBXGroup; + children = ( + 33FAB671232836740065AC1E /* Runner */, + 33CEB47122A05771004F2AC0 /* Flutter */, + 331C80D6294CF71000263BE5 /* RunnerTests */, + 33CC10EE2044A3C60003C045 /* Products */, + D73912EC22F37F3D000D13A0 /* Frameworks */, + ); + sourceTree = ""; + }; + 33CC10EE2044A3C60003C045 /* Products */ = { + isa = PBXGroup; + children = ( + 33CC10ED2044A3C60003C045 /* cupertino_gallery.app */, + 331C80D5294CF71000263BE5 /* RunnerTests.xctest */, + ); + name = Products; + sourceTree = ""; + }; + 33CC11242044D66E0003C045 /* Resources */ = { + isa = PBXGroup; + children = ( + 33CC10F22044A3C60003C045 /* Assets.xcassets */, + 33CC10F42044A3C60003C045 /* MainMenu.xib */, + 33CC10F72044A3C60003C045 /* Info.plist */, + ); + name = Resources; + path = ..; + sourceTree = ""; + }; + 33CEB47122A05771004F2AC0 /* Flutter */ = { + isa = PBXGroup; + children = ( + 335BBD1A22A9A15E00E9071D /* GeneratedPluginRegistrant.swift */, + 33CEB47222A05771004F2AC0 /* Flutter-Debug.xcconfig */, + 33CEB47422A05771004F2AC0 /* Flutter-Release.xcconfig */, + 33CEB47722A0578A004F2AC0 /* Flutter-Generated.xcconfig */, + ); + path = Flutter; + sourceTree = ""; + }; + 33FAB671232836740065AC1E /* Runner */ = { + isa = PBXGroup; + children = ( + 33CC10F02044A3C60003C045 /* AppDelegate.swift */, + 33CC11122044BFA00003C045 /* MainFlutterWindow.swift */, + 33E51913231747F40026EE4D /* DebugProfile.entitlements */, + 33E51914231749380026EE4D /* Release.entitlements */, + 33CC11242044D66E0003C045 /* Resources */, + 33BA886A226E78AF003329D5 /* Configs */, + ); + path = Runner; + sourceTree = ""; + }; + D73912EC22F37F3D000D13A0 /* Frameworks */ = { + isa = PBXGroup; + children = ( + ); + name = Frameworks; + sourceTree = ""; + }; +/* End PBXGroup section */ + +/* Begin PBXNativeTarget section */ + 331C80D4294CF70F00263BE5 /* RunnerTests */ = { + isa = PBXNativeTarget; + buildConfigurationList = 331C80DE294CF71000263BE5 /* Build configuration list for PBXNativeTarget "RunnerTests" */; + buildPhases = ( + 331C80D1294CF70F00263BE5 /* Sources */, + 331C80D2294CF70F00263BE5 /* Frameworks */, + 331C80D3294CF70F00263BE5 /* Resources */, + ); + buildRules = ( + ); + dependencies = ( + 331C80DA294CF71000263BE5 /* PBXTargetDependency */, + ); + name = RunnerTests; + productName = RunnerTests; + productReference = 331C80D5294CF71000263BE5 /* RunnerTests.xctest */; + productType = "com.apple.product-type.bundle.unit-test"; + }; + 33CC10EC2044A3C60003C045 /* Runner */ = { + isa = PBXNativeTarget; + buildConfigurationList = 33CC10FB2044A3C60003C045 /* Build configuration list for PBXNativeTarget "Runner" */; + buildPhases = ( + 33CC10E92044A3C60003C045 /* Sources */, + 33CC10EA2044A3C60003C045 /* Frameworks */, + 33CC10EB2044A3C60003C045 /* Resources */, + 33CC110E2044A8840003C045 /* Bundle Framework */, + 3399D490228B24CF009A79C7 /* ShellScript */, + ); + buildRules = ( + ); + dependencies = ( + 33CC11202044C79F0003C045 /* PBXTargetDependency */, + ); + name = Runner; + productName = Runner; + productReference = 33CC10ED2044A3C60003C045 /* cupertino_gallery.app */; + productType = "com.apple.product-type.application"; + }; +/* End PBXNativeTarget section */ + +/* Begin PBXProject section */ + 33CC10E52044A3C60003C045 /* Project object */ = { + isa = PBXProject; + attributes = { + BuildIndependentTargetsInParallel = YES; + LastSwiftUpdateCheck = 0920; + LastUpgradeCheck = 1510; + ORGANIZATIONNAME = ""; + TargetAttributes = { + 331C80D4294CF70F00263BE5 = { + CreatedOnToolsVersion = 14.0; + TestTargetID = 33CC10EC2044A3C60003C045; + }; + 33CC10EC2044A3C60003C045 = { + CreatedOnToolsVersion = 9.2; + LastSwiftMigration = 1100; + ProvisioningStyle = Automatic; + SystemCapabilities = { + com.apple.Sandbox = { + enabled = 1; + }; + }; + }; + 33CC111A2044C6BA0003C045 = { + CreatedOnToolsVersion = 9.2; + ProvisioningStyle = Manual; + }; + }; + }; + buildConfigurationList = 33CC10E82044A3C60003C045 /* Build configuration list for PBXProject "Runner" */; + compatibilityVersion = "Xcode 9.3"; + developmentRegion = en; + hasScannedForEncodings = 0; + knownRegions = ( + en, + Base, + ); + mainGroup = 33CC10E42044A3C60003C045; + productRefGroup = 33CC10EE2044A3C60003C045 /* Products */; + projectDirPath = ""; + projectRoot = ""; + targets = ( + 33CC10EC2044A3C60003C045 /* Runner */, + 331C80D4294CF70F00263BE5 /* RunnerTests */, + 33CC111A2044C6BA0003C045 /* Flutter Assemble */, + ); + }; +/* End PBXProject section */ + +/* Begin PBXResourcesBuildPhase section */ + 331C80D3294CF70F00263BE5 /* Resources */ = { + isa = PBXResourcesBuildPhase; + buildActionMask = 2147483647; + files = ( + ); + runOnlyForDeploymentPostprocessing = 0; + }; + 33CC10EB2044A3C60003C045 /* Resources */ = { + isa = PBXResourcesBuildPhase; + buildActionMask = 2147483647; + files = ( + 33CC10F32044A3C60003C045 /* Assets.xcassets in Resources */, + 33CC10F62044A3C60003C045 /* MainMenu.xib in Resources */, + ); + runOnlyForDeploymentPostprocessing = 0; + }; +/* End PBXResourcesBuildPhase section */ + +/* Begin PBXShellScriptBuildPhase section */ + 3399D490228B24CF009A79C7 /* ShellScript */ = { + isa = PBXShellScriptBuildPhase; + alwaysOutOfDate = 1; + buildActionMask = 2147483647; + files = ( + ); + inputFileListPaths = ( + ); + inputPaths = ( + ); + outputFileListPaths = ( + ); + outputPaths = ( + ); + runOnlyForDeploymentPostprocessing = 0; + shellPath = /bin/sh; + shellScript = "echo \"$PRODUCT_NAME.app\" > \"$PROJECT_DIR\"/Flutter/ephemeral/.app_filename && \"$FLUTTER_ROOT\"/packages/flutter_tools/bin/macos_assemble.sh embed\n"; + }; + 33CC111E2044C6BF0003C045 /* ShellScript */ = { + isa = PBXShellScriptBuildPhase; + buildActionMask = 2147483647; + files = ( + ); + inputFileListPaths = ( + Flutter/ephemeral/FlutterInputs.xcfilelist, + ); + inputPaths = ( + Flutter/ephemeral/tripwire, + ); + outputFileListPaths = ( + Flutter/ephemeral/FlutterOutputs.xcfilelist, + ); + outputPaths = ( + ); + runOnlyForDeploymentPostprocessing = 0; + shellPath = /bin/sh; + shellScript = "\"$FLUTTER_ROOT\"/packages/flutter_tools/bin/macos_assemble.sh && touch Flutter/ephemeral/tripwire"; + }; +/* End PBXShellScriptBuildPhase section */ + +/* Begin PBXSourcesBuildPhase section */ + 331C80D1294CF70F00263BE5 /* Sources */ = { + isa = PBXSourcesBuildPhase; + buildActionMask = 2147483647; + files = ( + 331C80D8294CF71000263BE5 /* RunnerTests.swift in Sources */, + ); + runOnlyForDeploymentPostprocessing = 0; + }; + 33CC10E92044A3C60003C045 /* Sources */ = { + isa = PBXSourcesBuildPhase; + buildActionMask = 2147483647; + files = ( + 33CC11132044BFA00003C045 /* MainFlutterWindow.swift in Sources */, + 33CC10F12044A3C60003C045 /* AppDelegate.swift in Sources */, + 335BBD1B22A9A15E00E9071D /* GeneratedPluginRegistrant.swift in Sources */, + ); + runOnlyForDeploymentPostprocessing = 0; + }; +/* End PBXSourcesBuildPhase section */ + +/* Begin PBXTargetDependency section */ + 331C80DA294CF71000263BE5 /* PBXTargetDependency */ = { + isa = PBXTargetDependency; + target = 33CC10EC2044A3C60003C045 /* Runner */; + targetProxy = 331C80D9294CF71000263BE5 /* PBXContainerItemProxy */; + }; + 33CC11202044C79F0003C045 /* PBXTargetDependency */ = { + isa = PBXTargetDependency; + target = 33CC111A2044C6BA0003C045 /* Flutter Assemble */; + targetProxy = 33CC111F2044C79F0003C045 /* PBXContainerItemProxy */; + }; +/* End PBXTargetDependency section */ + +/* Begin PBXVariantGroup section */ + 33CC10F42044A3C60003C045 /* MainMenu.xib */ = { + isa = PBXVariantGroup; + children = ( + 33CC10F52044A3C60003C045 /* Base */, + ); + name = MainMenu.xib; + path = Runner; + sourceTree = ""; + }; +/* End PBXVariantGroup section */ + +/* Begin XCBuildConfiguration section */ + 331C80DB294CF71000263BE5 /* Debug */ = { + isa = XCBuildConfiguration; + buildSettings = { + BUNDLE_LOADER = "$(TEST_HOST)"; + CURRENT_PROJECT_VERSION = 1; + GENERATE_INFOPLIST_FILE = YES; + MARKETING_VERSION = 1.0; + PRODUCT_BUNDLE_IDENTIFIER = com.example.cupertinoGallery.RunnerTests; + PRODUCT_NAME = "$(TARGET_NAME)"; + SWIFT_VERSION = 5.0; + TEST_HOST = "$(BUILT_PRODUCTS_DIR)/cupertino_gallery.app/$(BUNDLE_EXECUTABLE_FOLDER_PATH)/cupertino_gallery"; + }; + name = Debug; + }; + 331C80DC294CF71000263BE5 /* Release */ = { + isa = XCBuildConfiguration; + buildSettings = { + BUNDLE_LOADER = "$(TEST_HOST)"; + CURRENT_PROJECT_VERSION = 1; + GENERATE_INFOPLIST_FILE = YES; + MARKETING_VERSION = 1.0; + PRODUCT_BUNDLE_IDENTIFIER = com.example.cupertinoGallery.RunnerTests; + PRODUCT_NAME = "$(TARGET_NAME)"; + SWIFT_VERSION = 5.0; + TEST_HOST = "$(BUILT_PRODUCTS_DIR)/cupertino_gallery.app/$(BUNDLE_EXECUTABLE_FOLDER_PATH)/cupertino_gallery"; + }; + name = Release; + }; + 331C80DD294CF71000263BE5 /* Profile */ = { + isa = XCBuildConfiguration; + buildSettings = { + BUNDLE_LOADER = "$(TEST_HOST)"; + CURRENT_PROJECT_VERSION = 1; + GENERATE_INFOPLIST_FILE = YES; + MARKETING_VERSION = 1.0; + PRODUCT_BUNDLE_IDENTIFIER = com.example.cupertinoGallery.RunnerTests; + PRODUCT_NAME = "$(TARGET_NAME)"; + SWIFT_VERSION = 5.0; + TEST_HOST = "$(BUILT_PRODUCTS_DIR)/cupertino_gallery.app/$(BUNDLE_EXECUTABLE_FOLDER_PATH)/cupertino_gallery"; + }; + name = Profile; + }; + 338D0CE9231458BD00FA5F75 /* Profile */ = { + isa = XCBuildConfiguration; + baseConfigurationReference = 7AFA3C8E1D35360C0083082E /* Release.xcconfig */; + buildSettings = { + ALWAYS_SEARCH_USER_PATHS = NO; + ASSETCATALOG_COMPILER_GENERATE_SWIFT_ASSET_SYMBOL_EXTENSIONS = YES; + CLANG_ANALYZER_NONNULL = YES; + CLANG_ANALYZER_NUMBER_OBJECT_CONVERSION = YES_AGGRESSIVE; + CLANG_CXX_LANGUAGE_STANDARD = "gnu++14"; + CLANG_CXX_LIBRARY = "libc++"; + CLANG_ENABLE_MODULES = YES; + CLANG_ENABLE_OBJC_ARC = YES; + CLANG_WARN_BLOCK_CAPTURE_AUTORELEASING = YES; + CLANG_WARN_BOOL_CONVERSION = YES; + CLANG_WARN_CONSTANT_CONVERSION = YES; + CLANG_WARN_DEPRECATED_OBJC_IMPLEMENTATIONS = YES; + CLANG_WARN_DIRECT_OBJC_ISA_USAGE = YES_ERROR; + CLANG_WARN_DOCUMENTATION_COMMENTS = YES; + CLANG_WARN_EMPTY_BODY = YES; + CLANG_WARN_ENUM_CONVERSION = YES; + CLANG_WARN_INFINITE_RECURSION = YES; + CLANG_WARN_INT_CONVERSION = YES; + CLANG_WARN_NON_LITERAL_NULL_CONVERSION = YES; + CLANG_WARN_OBJC_LITERAL_CONVERSION = YES; + CLANG_WARN_OBJC_ROOT_CLASS = YES_ERROR; + CLANG_WARN_RANGE_LOOP_ANALYSIS = YES; + CLANG_WARN_SUSPICIOUS_MOVE = YES; + CODE_SIGN_IDENTITY = "-"; + COPY_PHASE_STRIP = NO; + DEAD_CODE_STRIPPING = YES; + DEBUG_INFORMATION_FORMAT = "dwarf-with-dsym"; + ENABLE_NS_ASSERTIONS = NO; + ENABLE_STRICT_OBJC_MSGSEND = YES; + ENABLE_USER_SCRIPT_SANDBOXING = NO; + GCC_C_LANGUAGE_STANDARD = gnu11; + GCC_NO_COMMON_BLOCKS = YES; + GCC_WARN_64_TO_32_BIT_CONVERSION = YES; + GCC_WARN_ABOUT_RETURN_TYPE = YES_ERROR; + GCC_WARN_UNINITIALIZED_AUTOS = YES_AGGRESSIVE; + GCC_WARN_UNUSED_FUNCTION = YES; + GCC_WARN_UNUSED_VARIABLE = YES; + MACOSX_DEPLOYMENT_TARGET = 10.15; + MTL_ENABLE_DEBUG_INFO = NO; + SDKROOT = macosx; + SWIFT_COMPILATION_MODE = wholemodule; + SWIFT_OPTIMIZATION_LEVEL = "-O"; + }; + name = Profile; + }; + 338D0CEA231458BD00FA5F75 /* Profile */ = { + isa = XCBuildConfiguration; + baseConfigurationReference = 33E5194F232828860026EE4D /* AppInfo.xcconfig */; + buildSettings = { + ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon; + CLANG_ENABLE_MODULES = YES; + CODE_SIGN_ENTITLEMENTS = Runner/DebugProfile.entitlements; + CODE_SIGN_STYLE = Automatic; + COMBINE_HIDPI_IMAGES = YES; + INFOPLIST_FILE = Runner/Info.plist; + LD_RUNPATH_SEARCH_PATHS = ( + "$(inherited)", + "@executable_path/../Frameworks", + ); + PROVISIONING_PROFILE_SPECIFIER = ""; + SWIFT_VERSION = 5.0; + }; + name = Profile; + }; + 338D0CEB231458BD00FA5F75 /* Profile */ = { + isa = XCBuildConfiguration; + buildSettings = { + CODE_SIGN_STYLE = Manual; + PRODUCT_NAME = "$(TARGET_NAME)"; + }; + name = Profile; + }; + 33CC10F92044A3C60003C045 /* Debug */ = { + isa = XCBuildConfiguration; + baseConfigurationReference = 9740EEB21CF90195004384FC /* Debug.xcconfig */; + buildSettings = { + ALWAYS_SEARCH_USER_PATHS = NO; + ASSETCATALOG_COMPILER_GENERATE_SWIFT_ASSET_SYMBOL_EXTENSIONS = YES; + CLANG_ANALYZER_NONNULL = YES; + CLANG_ANALYZER_NUMBER_OBJECT_CONVERSION = YES_AGGRESSIVE; + CLANG_CXX_LANGUAGE_STANDARD = "gnu++14"; + CLANG_CXX_LIBRARY = "libc++"; + CLANG_ENABLE_MODULES = YES; + CLANG_ENABLE_OBJC_ARC = YES; + CLANG_WARN_BLOCK_CAPTURE_AUTORELEASING = YES; + CLANG_WARN_BOOL_CONVERSION = YES; + CLANG_WARN_CONSTANT_CONVERSION = YES; + CLANG_WARN_DEPRECATED_OBJC_IMPLEMENTATIONS = YES; + CLANG_WARN_DIRECT_OBJC_ISA_USAGE = YES_ERROR; + CLANG_WARN_DOCUMENTATION_COMMENTS = YES; + CLANG_WARN_EMPTY_BODY = YES; + CLANG_WARN_ENUM_CONVERSION = YES; + CLANG_WARN_INFINITE_RECURSION = YES; + CLANG_WARN_INT_CONVERSION = YES; + CLANG_WARN_NON_LITERAL_NULL_CONVERSION = YES; + CLANG_WARN_OBJC_LITERAL_CONVERSION = YES; + CLANG_WARN_OBJC_ROOT_CLASS = YES_ERROR; + CLANG_WARN_RANGE_LOOP_ANALYSIS = YES; + CLANG_WARN_SUSPICIOUS_MOVE = YES; + CODE_SIGN_IDENTITY = "-"; + COPY_PHASE_STRIP = NO; + DEAD_CODE_STRIPPING = YES; + DEBUG_INFORMATION_FORMAT = dwarf; + ENABLE_STRICT_OBJC_MSGSEND = YES; + ENABLE_TESTABILITY = YES; + ENABLE_USER_SCRIPT_SANDBOXING = NO; + GCC_C_LANGUAGE_STANDARD = gnu11; + GCC_DYNAMIC_NO_PIC = NO; + GCC_NO_COMMON_BLOCKS = YES; + GCC_OPTIMIZATION_LEVEL = 0; + GCC_PREPROCESSOR_DEFINITIONS = ( + "DEBUG=1", + "$(inherited)", + ); + GCC_WARN_64_TO_32_BIT_CONVERSION = YES; + GCC_WARN_ABOUT_RETURN_TYPE = YES_ERROR; + GCC_WARN_UNINITIALIZED_AUTOS = YES_AGGRESSIVE; + GCC_WARN_UNUSED_FUNCTION = YES; + GCC_WARN_UNUSED_VARIABLE = YES; + MACOSX_DEPLOYMENT_TARGET = 10.15; + MTL_ENABLE_DEBUG_INFO = YES; + ONLY_ACTIVE_ARCH = YES; + SDKROOT = macosx; + SWIFT_ACTIVE_COMPILATION_CONDITIONS = DEBUG; + SWIFT_OPTIMIZATION_LEVEL = "-Onone"; + }; + name = Debug; + }; + 33CC10FA2044A3C60003C045 /* Release */ = { + isa = XCBuildConfiguration; + baseConfigurationReference = 7AFA3C8E1D35360C0083082E /* Release.xcconfig */; + buildSettings = { + ALWAYS_SEARCH_USER_PATHS = NO; + ASSETCATALOG_COMPILER_GENERATE_SWIFT_ASSET_SYMBOL_EXTENSIONS = YES; + CLANG_ANALYZER_NONNULL = YES; + CLANG_ANALYZER_NUMBER_OBJECT_CONVERSION = YES_AGGRESSIVE; + CLANG_CXX_LANGUAGE_STANDARD = "gnu++14"; + CLANG_CXX_LIBRARY = "libc++"; + CLANG_ENABLE_MODULES = YES; + CLANG_ENABLE_OBJC_ARC = YES; + CLANG_WARN_BLOCK_CAPTURE_AUTORELEASING = YES; + CLANG_WARN_BOOL_CONVERSION = YES; + CLANG_WARN_CONSTANT_CONVERSION = YES; + CLANG_WARN_DEPRECATED_OBJC_IMPLEMENTATIONS = YES; + CLANG_WARN_DIRECT_OBJC_ISA_USAGE = YES_ERROR; + CLANG_WARN_DOCUMENTATION_COMMENTS = YES; + CLANG_WARN_EMPTY_BODY = YES; + CLANG_WARN_ENUM_CONVERSION = YES; + CLANG_WARN_INFINITE_RECURSION = YES; + CLANG_WARN_INT_CONVERSION = YES; + CLANG_WARN_NON_LITERAL_NULL_CONVERSION = YES; + CLANG_WARN_OBJC_LITERAL_CONVERSION = YES; + CLANG_WARN_OBJC_ROOT_CLASS = YES_ERROR; + CLANG_WARN_RANGE_LOOP_ANALYSIS = YES; + CLANG_WARN_SUSPICIOUS_MOVE = YES; + CODE_SIGN_IDENTITY = "-"; + COPY_PHASE_STRIP = NO; + DEAD_CODE_STRIPPING = YES; + DEBUG_INFORMATION_FORMAT = "dwarf-with-dsym"; + ENABLE_NS_ASSERTIONS = NO; + ENABLE_STRICT_OBJC_MSGSEND = YES; + ENABLE_USER_SCRIPT_SANDBOXING = NO; + GCC_C_LANGUAGE_STANDARD = gnu11; + GCC_NO_COMMON_BLOCKS = YES; + GCC_WARN_64_TO_32_BIT_CONVERSION = YES; + GCC_WARN_ABOUT_RETURN_TYPE = YES_ERROR; + GCC_WARN_UNINITIALIZED_AUTOS = YES_AGGRESSIVE; + GCC_WARN_UNUSED_FUNCTION = YES; + GCC_WARN_UNUSED_VARIABLE = YES; + MACOSX_DEPLOYMENT_TARGET = 10.15; + MTL_ENABLE_DEBUG_INFO = NO; + SDKROOT = macosx; + SWIFT_COMPILATION_MODE = wholemodule; + SWIFT_OPTIMIZATION_LEVEL = "-O"; + }; + name = Release; + }; + 33CC10FC2044A3C60003C045 /* Debug */ = { + isa = XCBuildConfiguration; + baseConfigurationReference = 33E5194F232828860026EE4D /* AppInfo.xcconfig */; + buildSettings = { + ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon; + CLANG_ENABLE_MODULES = YES; + CODE_SIGN_ENTITLEMENTS = Runner/DebugProfile.entitlements; + CODE_SIGN_STYLE = Automatic; + COMBINE_HIDPI_IMAGES = YES; + INFOPLIST_FILE = Runner/Info.plist; + LD_RUNPATH_SEARCH_PATHS = ( + "$(inherited)", + "@executable_path/../Frameworks", + ); + PROVISIONING_PROFILE_SPECIFIER = ""; + SWIFT_OPTIMIZATION_LEVEL = "-Onone"; + SWIFT_VERSION = 5.0; + }; + name = Debug; + }; + 33CC10FD2044A3C60003C045 /* Release */ = { + isa = XCBuildConfiguration; + baseConfigurationReference = 33E5194F232828860026EE4D /* AppInfo.xcconfig */; + buildSettings = { + ASSETCATALOG_COMPILER_APPICON_NAME = AppIcon; + CLANG_ENABLE_MODULES = YES; + CODE_SIGN_ENTITLEMENTS = Runner/Release.entitlements; + CODE_SIGN_STYLE = Automatic; + COMBINE_HIDPI_IMAGES = YES; + INFOPLIST_FILE = Runner/Info.plist; + LD_RUNPATH_SEARCH_PATHS = ( + "$(inherited)", + "@executable_path/../Frameworks", + ); + PROVISIONING_PROFILE_SPECIFIER = ""; + SWIFT_VERSION = 5.0; + }; + name = Release; + }; + 33CC111C2044C6BA0003C045 /* Debug */ = { + isa = XCBuildConfiguration; + buildSettings = { + CODE_SIGN_STYLE = Manual; + PRODUCT_NAME = "$(TARGET_NAME)"; + }; + name = Debug; + }; + 33CC111D2044C6BA0003C045 /* Release */ = { + isa = XCBuildConfiguration; + buildSettings = { + CODE_SIGN_STYLE = Automatic; + PRODUCT_NAME = "$(TARGET_NAME)"; + }; + name = Release; + }; +/* End XCBuildConfiguration section */ + +/* Begin XCConfigurationList section */ + 331C80DE294CF71000263BE5 /* Build configuration list for PBXNativeTarget "RunnerTests" */ = { + isa = XCConfigurationList; + buildConfigurations = ( + 331C80DB294CF71000263BE5 /* Debug */, + 331C80DC294CF71000263BE5 /* Release */, + 331C80DD294CF71000263BE5 /* Profile */, + ); + defaultConfigurationIsVisible = 0; + defaultConfigurationName = Release; + }; + 33CC10E82044A3C60003C045 /* Build configuration list for PBXProject "Runner" */ = { + isa = XCConfigurationList; + buildConfigurations = ( + 33CC10F92044A3C60003C045 /* Debug */, + 33CC10FA2044A3C60003C045 /* Release */, + 338D0CE9231458BD00FA5F75 /* Profile */, + ); + defaultConfigurationIsVisible = 0; + defaultConfigurationName = Release; + }; + 33CC10FB2044A3C60003C045 /* Build configuration list for PBXNativeTarget "Runner" */ = { + isa = XCConfigurationList; + buildConfigurations = ( + 33CC10FC2044A3C60003C045 /* Debug */, + 33CC10FD2044A3C60003C045 /* Release */, + 338D0CEA231458BD00FA5F75 /* Profile */, + ); + defaultConfigurationIsVisible = 0; + defaultConfigurationName = Release; + }; + 33CC111B2044C6BA0003C045 /* Build configuration list for PBXAggregateTarget "Flutter Assemble" */ = { + isa = XCConfigurationList; + buildConfigurations = ( + 33CC111C2044C6BA0003C045 /* Debug */, + 33CC111D2044C6BA0003C045 /* Release */, + 338D0CEB231458BD00FA5F75 /* Profile */, + ); + defaultConfigurationIsVisible = 0; + defaultConfigurationName = Release; + }; +/* End XCConfigurationList section */ + }; + rootObject = 33CC10E52044A3C60003C045 /* Project object */; +} diff --git a/cupertino_gallery/macos/Runner.xcodeproj/project.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist b/cupertino_gallery/macos/Runner.xcodeproj/project.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist new file mode 100644 index 000000000..18d981003 --- /dev/null +++ b/cupertino_gallery/macos/Runner.xcodeproj/project.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist @@ -0,0 +1,8 @@ + + + + + IDEDidComputeMac32BitWarning + + + diff --git a/cupertino_gallery/macos/Runner.xcodeproj/xcshareddata/xcschemes/Runner.xcscheme b/cupertino_gallery/macos/Runner.xcodeproj/xcshareddata/xcschemes/Runner.xcscheme new file mode 100644 index 000000000..6cebf581b --- /dev/null +++ b/cupertino_gallery/macos/Runner.xcodeproj/xcshareddata/xcschemes/Runner.xcscheme @@ -0,0 +1,99 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/cupertino_gallery/macos/Runner.xcworkspace/contents.xcworkspacedata b/cupertino_gallery/macos/Runner.xcworkspace/contents.xcworkspacedata new file mode 100644 index 000000000..1d526a16e --- /dev/null +++ b/cupertino_gallery/macos/Runner.xcworkspace/contents.xcworkspacedata @@ -0,0 +1,7 @@ + + + + + diff --git a/cupertino_gallery/macos/Runner.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist b/cupertino_gallery/macos/Runner.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist new file mode 100644 index 000000000..18d981003 --- /dev/null +++ b/cupertino_gallery/macos/Runner.xcworkspace/xcshareddata/IDEWorkspaceChecks.plist @@ -0,0 +1,8 @@ + + + + + IDEDidComputeMac32BitWarning + + + diff --git a/cupertino_gallery/macos/Runner/AppDelegate.swift b/cupertino_gallery/macos/Runner/AppDelegate.swift new file mode 100644 index 000000000..b3c176141 --- /dev/null +++ b/cupertino_gallery/macos/Runner/AppDelegate.swift @@ -0,0 +1,13 @@ +import Cocoa +import FlutterMacOS + +@main +class AppDelegate: FlutterAppDelegate { + override func applicationShouldTerminateAfterLastWindowClosed(_ sender: NSApplication) -> Bool { + return true + } + + override func applicationSupportsSecureRestorableState(_ app: NSApplication) -> Bool { + return true + } +} diff --git a/cupertino_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/Contents.json b/cupertino_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/Contents.json new file mode 100644 index 000000000..a2ec33f19 --- /dev/null +++ b/cupertino_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/Contents.json @@ -0,0 +1,68 @@ +{ + "images" : [ + { + "size" : "16x16", + "idiom" : "mac", + "filename" : "app_icon_16.png", + "scale" : "1x" + }, + { + "size" : "16x16", + "idiom" : "mac", + "filename" : "app_icon_32.png", + "scale" : "2x" + }, + { + "size" : "32x32", + "idiom" : "mac", + "filename" : "app_icon_32.png", + "scale" : "1x" + }, + { + "size" : "32x32", + "idiom" : "mac", + "filename" : "app_icon_64.png", + "scale" : "2x" + }, + { + "size" : "128x128", + "idiom" : "mac", + "filename" : "app_icon_128.png", + "scale" : "1x" + }, + { + "size" : "128x128", + "idiom" : "mac", + "filename" : "app_icon_256.png", + "scale" : "2x" + }, + { + "size" : "256x256", + "idiom" : "mac", + "filename" : "app_icon_256.png", + "scale" : "1x" + }, + { + "size" : "256x256", + "idiom" : "mac", + "filename" : "app_icon_512.png", + "scale" : "2x" + }, + { + "size" : "512x512", + "idiom" : "mac", + "filename" : "app_icon_512.png", + "scale" : "1x" + }, + { + "size" : "512x512", + "idiom" : "mac", + "filename" : "app_icon_1024.png", + "scale" : "2x" + } + ], + "info" : { + "version" : 1, + "author" : "xcode" + } +} diff --git a/cupertino_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_1024.png b/cupertino_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_1024.png new file mode 100644 index 000000000..82b6f9d9a Binary files /dev/null and b/cupertino_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_1024.png differ diff --git a/cupertino_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_128.png b/cupertino_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_128.png new file mode 100644 index 000000000..13b35eba5 Binary files /dev/null and b/cupertino_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_128.png differ diff --git a/cupertino_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_16.png b/cupertino_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_16.png new file mode 100644 index 000000000..0a3f5fa40 Binary files /dev/null and b/cupertino_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_16.png differ diff --git a/cupertino_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_256.png b/cupertino_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_256.png new file mode 100644 index 000000000..bdb57226d Binary files /dev/null and b/cupertino_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_256.png differ diff --git a/cupertino_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_32.png b/cupertino_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_32.png new file mode 100644 index 000000000..f083318e0 Binary files /dev/null and b/cupertino_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_32.png differ diff --git a/cupertino_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_512.png b/cupertino_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_512.png new file mode 100644 index 000000000..326c0e72c Binary files /dev/null and b/cupertino_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_512.png differ diff --git a/cupertino_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_64.png b/cupertino_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_64.png new file mode 100644 index 000000000..2f1632cfd Binary files /dev/null and b/cupertino_gallery/macos/Runner/Assets.xcassets/AppIcon.appiconset/app_icon_64.png differ diff --git a/cupertino_gallery/macos/Runner/Base.lproj/MainMenu.xib b/cupertino_gallery/macos/Runner/Base.lproj/MainMenu.xib new file mode 100644 index 000000000..80e867a4e --- /dev/null +++ b/cupertino_gallery/macos/Runner/Base.lproj/MainMenu.xib @@ -0,0 +1,343 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/cupertino_gallery/macos/Runner/Configs/AppInfo.xcconfig b/cupertino_gallery/macos/Runner/Configs/AppInfo.xcconfig new file mode 100644 index 000000000..4aaf31cde --- /dev/null +++ b/cupertino_gallery/macos/Runner/Configs/AppInfo.xcconfig @@ -0,0 +1,14 @@ +// Application-level settings for the Runner target. +// +// This may be replaced with something auto-generated from metadata (e.g., pubspec.yaml) in the +// future. If not, the values below would default to using the project name when this becomes a +// 'flutter create' template. + +// The application's name. By default this is also the title of the Flutter window. +PRODUCT_NAME = cupertino_gallery + +// The application's bundle identifier +PRODUCT_BUNDLE_IDENTIFIER = com.example.cupertinoGallery + +// The copyright displayed in application information +PRODUCT_COPYRIGHT = Copyright © 2025 com.example. All rights reserved. diff --git a/cupertino_gallery/macos/Runner/Configs/Debug.xcconfig b/cupertino_gallery/macos/Runner/Configs/Debug.xcconfig new file mode 100644 index 000000000..36b0fd946 --- /dev/null +++ b/cupertino_gallery/macos/Runner/Configs/Debug.xcconfig @@ -0,0 +1,2 @@ +#include "../../Flutter/Flutter-Debug.xcconfig" +#include "Warnings.xcconfig" diff --git a/cupertino_gallery/macos/Runner/Configs/Release.xcconfig b/cupertino_gallery/macos/Runner/Configs/Release.xcconfig new file mode 100644 index 000000000..dff4f4956 --- /dev/null +++ b/cupertino_gallery/macos/Runner/Configs/Release.xcconfig @@ -0,0 +1,2 @@ +#include "../../Flutter/Flutter-Release.xcconfig" +#include "Warnings.xcconfig" diff --git a/cupertino_gallery/macos/Runner/Configs/Warnings.xcconfig b/cupertino_gallery/macos/Runner/Configs/Warnings.xcconfig new file mode 100644 index 000000000..42bcbf478 --- /dev/null +++ b/cupertino_gallery/macos/Runner/Configs/Warnings.xcconfig @@ -0,0 +1,13 @@ +WARNING_CFLAGS = -Wall -Wconditional-uninitialized -Wnullable-to-nonnull-conversion -Wmissing-method-return-type -Woverlength-strings +GCC_WARN_UNDECLARED_SELECTOR = YES +CLANG_UNDEFINED_BEHAVIOR_SANITIZER_NULLABILITY = YES +CLANG_WARN_UNGUARDED_AVAILABILITY = YES_AGGRESSIVE +CLANG_WARN__DUPLICATE_METHOD_MATCH = YES +CLANG_WARN_PRAGMA_PACK = YES +CLANG_WARN_STRICT_PROTOTYPES = YES +CLANG_WARN_COMMA = YES +GCC_WARN_STRICT_SELECTOR_MATCH = YES +CLANG_WARN_OBJC_REPEATED_USE_OF_WEAK = YES +CLANG_WARN_OBJC_IMPLICIT_RETAIN_SELF = YES +GCC_WARN_SHADOW = YES +CLANG_WARN_UNREACHABLE_CODE = YES diff --git a/cupertino_gallery/macos/Runner/DebugProfile.entitlements b/cupertino_gallery/macos/Runner/DebugProfile.entitlements new file mode 100644 index 000000000..dddb8a30c --- /dev/null +++ b/cupertino_gallery/macos/Runner/DebugProfile.entitlements @@ -0,0 +1,12 @@ + + + + + com.apple.security.app-sandbox + + com.apple.security.cs.allow-jit + + com.apple.security.network.server + + + diff --git a/cupertino_gallery/macos/Runner/Info.plist b/cupertino_gallery/macos/Runner/Info.plist new file mode 100644 index 000000000..4789daa6a --- /dev/null +++ b/cupertino_gallery/macos/Runner/Info.plist @@ -0,0 +1,32 @@ + + + + + CFBundleDevelopmentRegion + $(DEVELOPMENT_LANGUAGE) + CFBundleExecutable + $(EXECUTABLE_NAME) + CFBundleIconFile + + CFBundleIdentifier + $(PRODUCT_BUNDLE_IDENTIFIER) + CFBundleInfoDictionaryVersion + 6.0 + CFBundleName + $(PRODUCT_NAME) + CFBundlePackageType + APPL + CFBundleShortVersionString + $(FLUTTER_BUILD_NAME) + CFBundleVersion + $(FLUTTER_BUILD_NUMBER) + LSMinimumSystemVersion + $(MACOSX_DEPLOYMENT_TARGET) + NSHumanReadableCopyright + $(PRODUCT_COPYRIGHT) + NSMainNibFile + MainMenu + NSPrincipalClass + NSApplication + + diff --git a/cupertino_gallery/macos/Runner/MainFlutterWindow.swift b/cupertino_gallery/macos/Runner/MainFlutterWindow.swift new file mode 100644 index 000000000..3cc05eb23 --- /dev/null +++ b/cupertino_gallery/macos/Runner/MainFlutterWindow.swift @@ -0,0 +1,15 @@ +import Cocoa +import FlutterMacOS + +class MainFlutterWindow: NSWindow { + override func awakeFromNib() { + let flutterViewController = FlutterViewController() + let windowFrame = self.frame + self.contentViewController = flutterViewController + self.setFrame(windowFrame, display: true) + + RegisterGeneratedPlugins(registry: flutterViewController) + + super.awakeFromNib() + } +} diff --git a/cupertino_gallery/macos/Runner/Release.entitlements b/cupertino_gallery/macos/Runner/Release.entitlements new file mode 100644 index 000000000..852fa1a47 --- /dev/null +++ b/cupertino_gallery/macos/Runner/Release.entitlements @@ -0,0 +1,8 @@ + + + + + com.apple.security.app-sandbox + + + diff --git a/cupertino_gallery/macos/RunnerTests/RunnerTests.swift b/cupertino_gallery/macos/RunnerTests/RunnerTests.swift new file mode 100644 index 000000000..61f3bd1fc --- /dev/null +++ b/cupertino_gallery/macos/RunnerTests/RunnerTests.swift @@ -0,0 +1,12 @@ +import Cocoa +import FlutterMacOS +import XCTest + +class RunnerTests: XCTestCase { + + func testExample() { + // If you add code to the Runner application, consider adding tests here. + // See https://developer.apple.com/documentation/xctest for more information about using XCTest. + } + +} diff --git a/cupertino_gallery/pubspec.yaml b/cupertino_gallery/pubspec.yaml new file mode 100644 index 000000000..6aac360fd --- /dev/null +++ b/cupertino_gallery/pubspec.yaml @@ -0,0 +1,21 @@ +name: cupertino_gallery +description: A Flutter project showcasing supported Cupertino components. +publish_to: "none" +version: 1.0.0+1 + +environment: + sdk: ^3.9.0-0 + +dependencies: + flutter: + sdk: flutter + cupertino_icons: ^1.0.8 + +dev_dependencies: + analysis_defaults: + path: ../analysis_defaults + flutter_test: + sdk: flutter + +flutter: + uses-material-design: true \ No newline at end of file diff --git a/cupertino_gallery/test/widget_test.dart b/cupertino_gallery/test/widget_test.dart new file mode 100644 index 000000000..2a2b81928 --- /dev/null +++ b/cupertino_gallery/test/widget_test.dart @@ -0,0 +1,8 @@ +// This is a basic Flutter widget test. +// +// To perform an interaction with a widget in your test, use the WidgetTester +// utility in the flutter_test package. For example, you can send tap and scroll +// gestures. You can also use WidgetTester to find child widgets in the widget +// tree, read text, and verify that the values of widget properties are correct. + +void main() {} diff --git a/cupertino_gallery/web/favicon.png b/cupertino_gallery/web/favicon.png new file mode 100644 index 000000000..8aaa46ac1 Binary files /dev/null and b/cupertino_gallery/web/favicon.png differ diff --git a/cupertino_gallery/web/icons/Icon-192.png b/cupertino_gallery/web/icons/Icon-192.png new file mode 100644 index 000000000..b749bfef0 Binary files /dev/null and b/cupertino_gallery/web/icons/Icon-192.png differ diff --git a/cupertino_gallery/web/icons/Icon-512.png b/cupertino_gallery/web/icons/Icon-512.png new file mode 100644 index 000000000..88cfd48df Binary files /dev/null and b/cupertino_gallery/web/icons/Icon-512.png differ diff --git a/cupertino_gallery/web/icons/Icon-maskable-192.png b/cupertino_gallery/web/icons/Icon-maskable-192.png new file mode 100644 index 000000000..eb9b4d76e Binary files /dev/null and b/cupertino_gallery/web/icons/Icon-maskable-192.png differ diff --git a/cupertino_gallery/web/icons/Icon-maskable-512.png b/cupertino_gallery/web/icons/Icon-maskable-512.png new file mode 100644 index 000000000..d69c56691 Binary files /dev/null and b/cupertino_gallery/web/icons/Icon-maskable-512.png differ diff --git a/cupertino_gallery/web/index.html b/cupertino_gallery/web/index.html new file mode 100644 index 000000000..927e42791 --- /dev/null +++ b/cupertino_gallery/web/index.html @@ -0,0 +1,38 @@ + + + + + + + + + + + + + + + + + + + + cupertino_gallery + + + + + + diff --git a/cupertino_gallery/web/manifest.json b/cupertino_gallery/web/manifest.json new file mode 100644 index 000000000..363529b98 --- /dev/null +++ b/cupertino_gallery/web/manifest.json @@ -0,0 +1,35 @@ +{ + "name": "cupertino_gallery", + "short_name": "cupertino_gallery", + "start_url": ".", + "display": "standalone", + "background_color": "#0175C2", + "theme_color": "#0175C2", + "description": "A new Flutter project.", + "orientation": "portrait-primary", + "prefer_related_applications": false, + "icons": [ + { + "src": "icons/Icon-192.png", + "sizes": "192x192", + "type": "image/png" + }, + { + "src": "icons/Icon-512.png", + "sizes": "512x512", + "type": "image/png" + }, + { + "src": "icons/Icon-maskable-192.png", + "sizes": "192x192", + "type": "image/png", + "purpose": "maskable" + }, + { + "src": "icons/Icon-maskable-512.png", + "sizes": "512x512", + "type": "image/png", + "purpose": "maskable" + } + ] +} diff --git a/cupertino_gallery/windows/.gitignore b/cupertino_gallery/windows/.gitignore new file mode 100644 index 000000000..d492d0d98 --- /dev/null +++ b/cupertino_gallery/windows/.gitignore @@ -0,0 +1,17 @@ +flutter/ephemeral/ + +# Visual Studio user-specific files. +*.suo +*.user +*.userosscache +*.sln.docstates + +# Visual Studio build-related files. +x64/ +x86/ + +# Visual Studio cache files +# files ending in .cache can be ignored +*.[Cc]ache +# but keep track of directories ending in .cache +!*.[Cc]ache/ diff --git a/cupertino_gallery/windows/CMakeLists.txt b/cupertino_gallery/windows/CMakeLists.txt new file mode 100644 index 000000000..dbab392a9 --- /dev/null +++ b/cupertino_gallery/windows/CMakeLists.txt @@ -0,0 +1,108 @@ +# Project-level configuration. +cmake_minimum_required(VERSION 3.14) +project(cupertino_gallery LANGUAGES CXX) + +# The name of the executable created for the application. Change this to change +# the on-disk name of your application. +set(BINARY_NAME "cupertino_gallery") + +# Explicitly opt in to modern CMake behaviors to avoid warnings with recent +# versions of CMake. +cmake_policy(VERSION 3.14...3.25) + +# Define build configuration option. +get_property(IS_MULTICONFIG GLOBAL PROPERTY GENERATOR_IS_MULTI_CONFIG) +if(IS_MULTICONFIG) + set(CMAKE_CONFIGURATION_TYPES "Debug;Profile;Release" + CACHE STRING "" FORCE) +else() + if(NOT CMAKE_BUILD_TYPE AND NOT CMAKE_CONFIGURATION_TYPES) + set(CMAKE_BUILD_TYPE "Debug" CACHE + STRING "Flutter build mode" FORCE) + set_property(CACHE CMAKE_BUILD_TYPE PROPERTY STRINGS + "Debug" "Profile" "Release") + endif() +endif() +# Define settings for the Profile build mode. +set(CMAKE_EXE_LINKER_FLAGS_PROFILE "${CMAKE_EXE_LINKER_FLAGS_RELEASE}") +set(CMAKE_SHARED_LINKER_FLAGS_PROFILE "${CMAKE_SHARED_LINKER_FLAGS_RELEASE}") +set(CMAKE_C_FLAGS_PROFILE "${CMAKE_C_FLAGS_RELEASE}") +set(CMAKE_CXX_FLAGS_PROFILE "${CMAKE_CXX_FLAGS_RELEASE}") + +# Use Unicode for all projects. +add_definitions(-DUNICODE -D_UNICODE) + +# Compilation settings that should be applied to most targets. +# +# Be cautious about adding new options here, as plugins use this function by +# default. In most cases, you should add new options to specific targets instead +# of modifying this function. +function(APPLY_STANDARD_SETTINGS TARGET) + target_compile_features(${TARGET} PUBLIC cxx_std_17) + target_compile_options(${TARGET} PRIVATE /W4 /WX /wd"4100") + target_compile_options(${TARGET} PRIVATE /EHsc) + target_compile_definitions(${TARGET} PRIVATE "_HAS_EXCEPTIONS=0") + target_compile_definitions(${TARGET} PRIVATE "$<$:_DEBUG>") +endfunction() + +# Flutter library and tool build rules. +set(FLUTTER_MANAGED_DIR "${CMAKE_CURRENT_SOURCE_DIR}/flutter") +add_subdirectory(${FLUTTER_MANAGED_DIR}) + +# Application build; see runner/CMakeLists.txt. +add_subdirectory("runner") + + +# Generated plugin build rules, which manage building the plugins and adding +# them to the application. +include(flutter/generated_plugins.cmake) + + +# === Installation === +# Support files are copied into place next to the executable, so that it can +# run in place. This is done instead of making a separate bundle (as on Linux) +# so that building and running from within Visual Studio will work. +set(BUILD_BUNDLE_DIR "$") +# Make the "install" step default, as it's required to run. +set(CMAKE_VS_INCLUDE_INSTALL_TO_DEFAULT_BUILD 1) +if(CMAKE_INSTALL_PREFIX_INITIALIZED_TO_DEFAULT) + set(CMAKE_INSTALL_PREFIX "${BUILD_BUNDLE_DIR}" CACHE PATH "..." FORCE) +endif() + +set(INSTALL_BUNDLE_DATA_DIR "${CMAKE_INSTALL_PREFIX}/data") +set(INSTALL_BUNDLE_LIB_DIR "${CMAKE_INSTALL_PREFIX}") + +install(TARGETS ${BINARY_NAME} RUNTIME DESTINATION "${CMAKE_INSTALL_PREFIX}" + COMPONENT Runtime) + +install(FILES "${FLUTTER_ICU_DATA_FILE}" DESTINATION "${INSTALL_BUNDLE_DATA_DIR}" + COMPONENT Runtime) + +install(FILES "${FLUTTER_LIBRARY}" DESTINATION "${INSTALL_BUNDLE_LIB_DIR}" + COMPONENT Runtime) + +if(PLUGIN_BUNDLED_LIBRARIES) + install(FILES "${PLUGIN_BUNDLED_LIBRARIES}" + DESTINATION "${INSTALL_BUNDLE_LIB_DIR}" + COMPONENT Runtime) +endif() + +# Copy the native assets provided by the build.dart from all packages. +set(NATIVE_ASSETS_DIR "${PROJECT_BUILD_DIR}native_assets/windows/") +install(DIRECTORY "${NATIVE_ASSETS_DIR}" + DESTINATION "${INSTALL_BUNDLE_LIB_DIR}" + COMPONENT Runtime) + +# Fully re-copy the assets directory on each build to avoid having stale files +# from a previous install. +set(FLUTTER_ASSET_DIR_NAME "flutter_assets") +install(CODE " + file(REMOVE_RECURSE \"${INSTALL_BUNDLE_DATA_DIR}/${FLUTTER_ASSET_DIR_NAME}\") + " COMPONENT Runtime) +install(DIRECTORY "${PROJECT_BUILD_DIR}/${FLUTTER_ASSET_DIR_NAME}" + DESTINATION "${INSTALL_BUNDLE_DATA_DIR}" COMPONENT Runtime) + +# Install the AOT library on non-Debug builds only. +install(FILES "${AOT_LIBRARY}" DESTINATION "${INSTALL_BUNDLE_DATA_DIR}" + CONFIGURATIONS Profile;Release + COMPONENT Runtime) diff --git a/cupertino_gallery/windows/flutter/CMakeLists.txt b/cupertino_gallery/windows/flutter/CMakeLists.txt new file mode 100644 index 000000000..903f4899d --- /dev/null +++ b/cupertino_gallery/windows/flutter/CMakeLists.txt @@ -0,0 +1,109 @@ +# This file controls Flutter-level build steps. It should not be edited. +cmake_minimum_required(VERSION 3.14) + +set(EPHEMERAL_DIR "${CMAKE_CURRENT_SOURCE_DIR}/ephemeral") + +# Configuration provided via flutter tool. +include(${EPHEMERAL_DIR}/generated_config.cmake) + +# TODO: Move the rest of this into files in ephemeral. See +# https://github.com/flutter/flutter/issues/57146. +set(WRAPPER_ROOT "${EPHEMERAL_DIR}/cpp_client_wrapper") + +# Set fallback configurations for older versions of the flutter tool. +if (NOT DEFINED FLUTTER_TARGET_PLATFORM) + set(FLUTTER_TARGET_PLATFORM "windows-x64") +endif() + +# === Flutter Library === +set(FLUTTER_LIBRARY "${EPHEMERAL_DIR}/flutter_windows.dll") + +# Published to parent scope for install step. +set(FLUTTER_LIBRARY ${FLUTTER_LIBRARY} PARENT_SCOPE) +set(FLUTTER_ICU_DATA_FILE "${EPHEMERAL_DIR}/icudtl.dat" PARENT_SCOPE) +set(PROJECT_BUILD_DIR "${PROJECT_DIR}/build/" PARENT_SCOPE) +set(AOT_LIBRARY "${PROJECT_DIR}/build/windows/app.so" PARENT_SCOPE) + +list(APPEND FLUTTER_LIBRARY_HEADERS + "flutter_export.h" + "flutter_windows.h" + "flutter_messenger.h" + "flutter_plugin_registrar.h" + "flutter_texture_registrar.h" +) +list(TRANSFORM FLUTTER_LIBRARY_HEADERS PREPEND "${EPHEMERAL_DIR}/") +add_library(flutter INTERFACE) +target_include_directories(flutter INTERFACE + "${EPHEMERAL_DIR}" +) +target_link_libraries(flutter INTERFACE "${FLUTTER_LIBRARY}.lib") +add_dependencies(flutter flutter_assemble) + +# === Wrapper === +list(APPEND CPP_WRAPPER_SOURCES_CORE + "core_implementations.cc" + "standard_codec.cc" +) +list(TRANSFORM CPP_WRAPPER_SOURCES_CORE PREPEND "${WRAPPER_ROOT}/") +list(APPEND CPP_WRAPPER_SOURCES_PLUGIN + "plugin_registrar.cc" +) +list(TRANSFORM CPP_WRAPPER_SOURCES_PLUGIN PREPEND "${WRAPPER_ROOT}/") +list(APPEND CPP_WRAPPER_SOURCES_APP + "flutter_engine.cc" + "flutter_view_controller.cc" +) +list(TRANSFORM CPP_WRAPPER_SOURCES_APP PREPEND "${WRAPPER_ROOT}/") + +# Wrapper sources needed for a plugin. +add_library(flutter_wrapper_plugin STATIC + ${CPP_WRAPPER_SOURCES_CORE} + ${CPP_WRAPPER_SOURCES_PLUGIN} +) +apply_standard_settings(flutter_wrapper_plugin) +set_target_properties(flutter_wrapper_plugin PROPERTIES + POSITION_INDEPENDENT_CODE ON) +set_target_properties(flutter_wrapper_plugin PROPERTIES + CXX_VISIBILITY_PRESET hidden) +target_link_libraries(flutter_wrapper_plugin PUBLIC flutter) +target_include_directories(flutter_wrapper_plugin PUBLIC + "${WRAPPER_ROOT}/include" +) +add_dependencies(flutter_wrapper_plugin flutter_assemble) + +# Wrapper sources needed for the runner. +add_library(flutter_wrapper_app STATIC + ${CPP_WRAPPER_SOURCES_CORE} + ${CPP_WRAPPER_SOURCES_APP} +) +apply_standard_settings(flutter_wrapper_app) +target_link_libraries(flutter_wrapper_app PUBLIC flutter) +target_include_directories(flutter_wrapper_app PUBLIC + "${WRAPPER_ROOT}/include" +) +add_dependencies(flutter_wrapper_app flutter_assemble) + +# === Flutter tool backend === +# _phony_ is a non-existent file to force this command to run every time, +# since currently there's no way to get a full input/output list from the +# flutter tool. +set(PHONY_OUTPUT "${CMAKE_CURRENT_BINARY_DIR}/_phony_") +set_source_files_properties("${PHONY_OUTPUT}" PROPERTIES SYMBOLIC TRUE) +add_custom_command( + OUTPUT ${FLUTTER_LIBRARY} ${FLUTTER_LIBRARY_HEADERS} + ${CPP_WRAPPER_SOURCES_CORE} ${CPP_WRAPPER_SOURCES_PLUGIN} + ${CPP_WRAPPER_SOURCES_APP} + ${PHONY_OUTPUT} + COMMAND ${CMAKE_COMMAND} -E env + ${FLUTTER_TOOL_ENVIRONMENT} + "${FLUTTER_ROOT}/packages/flutter_tools/bin/tool_backend.bat" + ${FLUTTER_TARGET_PLATFORM} $ + VERBATIM +) +add_custom_target(flutter_assemble DEPENDS + "${FLUTTER_LIBRARY}" + ${FLUTTER_LIBRARY_HEADERS} + ${CPP_WRAPPER_SOURCES_CORE} + ${CPP_WRAPPER_SOURCES_PLUGIN} + ${CPP_WRAPPER_SOURCES_APP} +) diff --git a/cupertino_gallery/windows/flutter/generated_plugin_registrant.cc b/cupertino_gallery/windows/flutter/generated_plugin_registrant.cc new file mode 100644 index 000000000..8b6d4680a --- /dev/null +++ b/cupertino_gallery/windows/flutter/generated_plugin_registrant.cc @@ -0,0 +1,11 @@ +// +// Generated file. Do not edit. +// + +// clang-format off + +#include "generated_plugin_registrant.h" + + +void RegisterPlugins(flutter::PluginRegistry* registry) { +} diff --git a/cupertino_gallery/windows/flutter/generated_plugin_registrant.h b/cupertino_gallery/windows/flutter/generated_plugin_registrant.h new file mode 100644 index 000000000..dc139d85a --- /dev/null +++ b/cupertino_gallery/windows/flutter/generated_plugin_registrant.h @@ -0,0 +1,15 @@ +// +// Generated file. Do not edit. +// + +// clang-format off + +#ifndef GENERATED_PLUGIN_REGISTRANT_ +#define GENERATED_PLUGIN_REGISTRANT_ + +#include + +// Registers Flutter plugins. +void RegisterPlugins(flutter::PluginRegistry* registry); + +#endif // GENERATED_PLUGIN_REGISTRANT_ diff --git a/cupertino_gallery/windows/flutter/generated_plugins.cmake b/cupertino_gallery/windows/flutter/generated_plugins.cmake new file mode 100644 index 000000000..b93c4c30c --- /dev/null +++ b/cupertino_gallery/windows/flutter/generated_plugins.cmake @@ -0,0 +1,23 @@ +# +# Generated file, do not edit. +# + +list(APPEND FLUTTER_PLUGIN_LIST +) + +list(APPEND FLUTTER_FFI_PLUGIN_LIST +) + +set(PLUGIN_BUNDLED_LIBRARIES) + +foreach(plugin ${FLUTTER_PLUGIN_LIST}) + add_subdirectory(flutter/ephemeral/.plugin_symlinks/${plugin}/windows plugins/${plugin}) + target_link_libraries(${BINARY_NAME} PRIVATE ${plugin}_plugin) + list(APPEND PLUGIN_BUNDLED_LIBRARIES $) + list(APPEND PLUGIN_BUNDLED_LIBRARIES ${${plugin}_bundled_libraries}) +endforeach(plugin) + +foreach(ffi_plugin ${FLUTTER_FFI_PLUGIN_LIST}) + add_subdirectory(flutter/ephemeral/.plugin_symlinks/${ffi_plugin}/windows plugins/${ffi_plugin}) + list(APPEND PLUGIN_BUNDLED_LIBRARIES ${${ffi_plugin}_bundled_libraries}) +endforeach(ffi_plugin) diff --git a/cupertino_gallery/windows/runner/CMakeLists.txt b/cupertino_gallery/windows/runner/CMakeLists.txt new file mode 100644 index 000000000..394917c05 --- /dev/null +++ b/cupertino_gallery/windows/runner/CMakeLists.txt @@ -0,0 +1,40 @@ +cmake_minimum_required(VERSION 3.14) +project(runner LANGUAGES CXX) + +# Define the application target. To change its name, change BINARY_NAME in the +# top-level CMakeLists.txt, not the value here, or `flutter run` will no longer +# work. +# +# Any new source files that you add to the application should be added here. +add_executable(${BINARY_NAME} WIN32 + "flutter_window.cpp" + "main.cpp" + "utils.cpp" + "win32_window.cpp" + "${FLUTTER_MANAGED_DIR}/generated_plugin_registrant.cc" + "Runner.rc" + "runner.exe.manifest" +) + +# Apply the standard set of build settings. This can be removed for applications +# that need different build settings. +apply_standard_settings(${BINARY_NAME}) + +# Add preprocessor definitions for the build version. +target_compile_definitions(${BINARY_NAME} PRIVATE "FLUTTER_VERSION=\"${FLUTTER_VERSION}\"") +target_compile_definitions(${BINARY_NAME} PRIVATE "FLUTTER_VERSION_MAJOR=${FLUTTER_VERSION_MAJOR}") +target_compile_definitions(${BINARY_NAME} PRIVATE "FLUTTER_VERSION_MINOR=${FLUTTER_VERSION_MINOR}") +target_compile_definitions(${BINARY_NAME} PRIVATE "FLUTTER_VERSION_PATCH=${FLUTTER_VERSION_PATCH}") +target_compile_definitions(${BINARY_NAME} PRIVATE "FLUTTER_VERSION_BUILD=${FLUTTER_VERSION_BUILD}") + +# Disable Windows macros that collide with C++ standard library functions. +target_compile_definitions(${BINARY_NAME} PRIVATE "NOMINMAX") + +# Add dependency libraries and include directories. Add any application-specific +# dependencies here. +target_link_libraries(${BINARY_NAME} PRIVATE flutter flutter_wrapper_app) +target_link_libraries(${BINARY_NAME} PRIVATE "dwmapi.lib") +target_include_directories(${BINARY_NAME} PRIVATE "${CMAKE_SOURCE_DIR}") + +# Run the Flutter tool portions of the build. This must not be removed. +add_dependencies(${BINARY_NAME} flutter_assemble) diff --git a/cupertino_gallery/windows/runner/Runner.rc b/cupertino_gallery/windows/runner/Runner.rc new file mode 100644 index 000000000..755bfcf15 --- /dev/null +++ b/cupertino_gallery/windows/runner/Runner.rc @@ -0,0 +1,121 @@ +// Microsoft Visual C++ generated resource script. +// +#pragma code_page(65001) +#include "resource.h" + +#define APSTUDIO_READONLY_SYMBOLS +///////////////////////////////////////////////////////////////////////////// +// +// Generated from the TEXTINCLUDE 2 resource. +// +#include "winres.h" + +///////////////////////////////////////////////////////////////////////////// +#undef APSTUDIO_READONLY_SYMBOLS + +///////////////////////////////////////////////////////////////////////////// +// English (United States) resources + +#if !defined(AFX_RESOURCE_DLL) || defined(AFX_TARG_ENU) +LANGUAGE LANG_ENGLISH, SUBLANG_ENGLISH_US + +#ifdef APSTUDIO_INVOKED +///////////////////////////////////////////////////////////////////////////// +// +// TEXTINCLUDE +// + +1 TEXTINCLUDE +BEGIN + "resource.h\0" +END + +2 TEXTINCLUDE +BEGIN + "#include ""winres.h""\r\n" + "\0" +END + +3 TEXTINCLUDE +BEGIN + "\r\n" + "\0" +END + +#endif // APSTUDIO_INVOKED + + +///////////////////////////////////////////////////////////////////////////// +// +// Icon +// + +// Icon with lowest ID value placed first to ensure application icon +// remains consistent on all systems. +IDI_APP_ICON ICON "resources\\app_icon.ico" + + +///////////////////////////////////////////////////////////////////////////// +// +// Version +// + +#if defined(FLUTTER_VERSION_MAJOR) && defined(FLUTTER_VERSION_MINOR) && defined(FLUTTER_VERSION_PATCH) && defined(FLUTTER_VERSION_BUILD) +#define VERSION_AS_NUMBER FLUTTER_VERSION_MAJOR,FLUTTER_VERSION_MINOR,FLUTTER_VERSION_PATCH,FLUTTER_VERSION_BUILD +#else +#define VERSION_AS_NUMBER 1,0,0,0 +#endif + +#if defined(FLUTTER_VERSION) +#define VERSION_AS_STRING FLUTTER_VERSION +#else +#define VERSION_AS_STRING "1.0.0" +#endif + +VS_VERSION_INFO VERSIONINFO + FILEVERSION VERSION_AS_NUMBER + PRODUCTVERSION VERSION_AS_NUMBER + FILEFLAGSMASK VS_FFI_FILEFLAGSMASK +#ifdef _DEBUG + FILEFLAGS VS_FF_DEBUG +#else + FILEFLAGS 0x0L +#endif + FILEOS VOS__WINDOWS32 + FILETYPE VFT_APP + FILESUBTYPE 0x0L +BEGIN + BLOCK "StringFileInfo" + BEGIN + BLOCK "040904e4" + BEGIN + VALUE "CompanyName", "com.example" "\0" + VALUE "FileDescription", "cupertino_gallery" "\0" + VALUE "FileVersion", VERSION_AS_STRING "\0" + VALUE "InternalName", "cupertino_gallery" "\0" + VALUE "LegalCopyright", "Copyright (C) 2025 com.example. All rights reserved." "\0" + VALUE "OriginalFilename", "cupertino_gallery.exe" "\0" + VALUE "ProductName", "cupertino_gallery" "\0" + VALUE "ProductVersion", VERSION_AS_STRING "\0" + END + END + BLOCK "VarFileInfo" + BEGIN + VALUE "Translation", 0x409, 1252 + END +END + +#endif // English (United States) resources +///////////////////////////////////////////////////////////////////////////// + + + +#ifndef APSTUDIO_INVOKED +///////////////////////////////////////////////////////////////////////////// +// +// Generated from the TEXTINCLUDE 3 resource. +// + + +///////////////////////////////////////////////////////////////////////////// +#endif // not APSTUDIO_INVOKED diff --git a/cupertino_gallery/windows/runner/flutter_window.cpp b/cupertino_gallery/windows/runner/flutter_window.cpp new file mode 100644 index 000000000..955ee3038 --- /dev/null +++ b/cupertino_gallery/windows/runner/flutter_window.cpp @@ -0,0 +1,71 @@ +#include "flutter_window.h" + +#include + +#include "flutter/generated_plugin_registrant.h" + +FlutterWindow::FlutterWindow(const flutter::DartProject& project) + : project_(project) {} + +FlutterWindow::~FlutterWindow() {} + +bool FlutterWindow::OnCreate() { + if (!Win32Window::OnCreate()) { + return false; + } + + RECT frame = GetClientArea(); + + // The size here must match the window dimensions to avoid unnecessary surface + // creation / destruction in the startup path. + flutter_controller_ = std::make_unique( + frame.right - frame.left, frame.bottom - frame.top, project_); + // Ensure that basic setup of the controller was successful. + if (!flutter_controller_->engine() || !flutter_controller_->view()) { + return false; + } + RegisterPlugins(flutter_controller_->engine()); + SetChildContent(flutter_controller_->view()->GetNativeWindow()); + + flutter_controller_->engine()->SetNextFrameCallback([&]() { + this->Show(); + }); + + // Flutter can complete the first frame before the "show window" callback is + // registered. The following call ensures a frame is pending to ensure the + // window is shown. It is a no-op if the first frame hasn't completed yet. + flutter_controller_->ForceRedraw(); + + return true; +} + +void FlutterWindow::OnDestroy() { + if (flutter_controller_) { + flutter_controller_ = nullptr; + } + + Win32Window::OnDestroy(); +} + +LRESULT +FlutterWindow::MessageHandler(HWND hwnd, UINT const message, + WPARAM const wparam, + LPARAM const lparam) noexcept { + // Give Flutter, including plugins, an opportunity to handle window messages. + if (flutter_controller_) { + std::optional result = + flutter_controller_->HandleTopLevelWindowProc(hwnd, message, wparam, + lparam); + if (result) { + return *result; + } + } + + switch (message) { + case WM_FONTCHANGE: + flutter_controller_->engine()->ReloadSystemFonts(); + break; + } + + return Win32Window::MessageHandler(hwnd, message, wparam, lparam); +} diff --git a/cupertino_gallery/windows/runner/flutter_window.h b/cupertino_gallery/windows/runner/flutter_window.h new file mode 100644 index 000000000..6da0652f0 --- /dev/null +++ b/cupertino_gallery/windows/runner/flutter_window.h @@ -0,0 +1,33 @@ +#ifndef RUNNER_FLUTTER_WINDOW_H_ +#define RUNNER_FLUTTER_WINDOW_H_ + +#include +#include + +#include + +#include "win32_window.h" + +// A window that does nothing but host a Flutter view. +class FlutterWindow : public Win32Window { + public: + // Creates a new FlutterWindow hosting a Flutter view running |project|. + explicit FlutterWindow(const flutter::DartProject& project); + virtual ~FlutterWindow(); + + protected: + // Win32Window: + bool OnCreate() override; + void OnDestroy() override; + LRESULT MessageHandler(HWND window, UINT const message, WPARAM const wparam, + LPARAM const lparam) noexcept override; + + private: + // The project to run. + flutter::DartProject project_; + + // The Flutter instance hosted by this window. + std::unique_ptr flutter_controller_; +}; + +#endif // RUNNER_FLUTTER_WINDOW_H_ diff --git a/cupertino_gallery/windows/runner/main.cpp b/cupertino_gallery/windows/runner/main.cpp new file mode 100644 index 000000000..d2938f557 --- /dev/null +++ b/cupertino_gallery/windows/runner/main.cpp @@ -0,0 +1,43 @@ +#include +#include +#include + +#include "flutter_window.h" +#include "utils.h" + +int APIENTRY wWinMain(_In_ HINSTANCE instance, _In_opt_ HINSTANCE prev, + _In_ wchar_t *command_line, _In_ int show_command) { + // Attach to console when present (e.g., 'flutter run') or create a + // new console when running with a debugger. + if (!::AttachConsole(ATTACH_PARENT_PROCESS) && ::IsDebuggerPresent()) { + CreateAndAttachConsole(); + } + + // Initialize COM, so that it is available for use in the library and/or + // plugins. + ::CoInitializeEx(nullptr, COINIT_APARTMENTTHREADED); + + flutter::DartProject project(L"data"); + + std::vector command_line_arguments = + GetCommandLineArguments(); + + project.set_dart_entrypoint_arguments(std::move(command_line_arguments)); + + FlutterWindow window(project); + Win32Window::Point origin(10, 10); + Win32Window::Size size(1280, 720); + if (!window.Create(L"cupertino_gallery", origin, size)) { + return EXIT_FAILURE; + } + window.SetQuitOnClose(true); + + ::MSG msg; + while (::GetMessage(&msg, nullptr, 0, 0)) { + ::TranslateMessage(&msg); + ::DispatchMessage(&msg); + } + + ::CoUninitialize(); + return EXIT_SUCCESS; +} diff --git a/cupertino_gallery/windows/runner/resource.h b/cupertino_gallery/windows/runner/resource.h new file mode 100644 index 000000000..66a65d1e4 --- /dev/null +++ b/cupertino_gallery/windows/runner/resource.h @@ -0,0 +1,16 @@ +//{{NO_DEPENDENCIES}} +// Microsoft Visual C++ generated include file. +// Used by Runner.rc +// +#define IDI_APP_ICON 101 + +// Next default values for new objects +// +#ifdef APSTUDIO_INVOKED +#ifndef APSTUDIO_READONLY_SYMBOLS +#define _APS_NEXT_RESOURCE_VALUE 102 +#define _APS_NEXT_COMMAND_VALUE 40001 +#define _APS_NEXT_CONTROL_VALUE 1001 +#define _APS_NEXT_SYMED_VALUE 101 +#endif +#endif diff --git a/cupertino_gallery/windows/runner/resources/app_icon.ico b/cupertino_gallery/windows/runner/resources/app_icon.ico new file mode 100644 index 000000000..c04e20caf Binary files /dev/null and b/cupertino_gallery/windows/runner/resources/app_icon.ico differ diff --git a/cupertino_gallery/windows/runner/runner.exe.manifest b/cupertino_gallery/windows/runner/runner.exe.manifest new file mode 100644 index 000000000..153653e8d --- /dev/null +++ b/cupertino_gallery/windows/runner/runner.exe.manifest @@ -0,0 +1,14 @@ + + + + + PerMonitorV2 + + + + + + + + + diff --git a/cupertino_gallery/windows/runner/utils.cpp b/cupertino_gallery/windows/runner/utils.cpp new file mode 100644 index 000000000..3a0b46511 --- /dev/null +++ b/cupertino_gallery/windows/runner/utils.cpp @@ -0,0 +1,65 @@ +#include "utils.h" + +#include +#include +#include +#include + +#include + +void CreateAndAttachConsole() { + if (::AllocConsole()) { + FILE *unused; + if (freopen_s(&unused, "CONOUT$", "w", stdout)) { + _dup2(_fileno(stdout), 1); + } + if (freopen_s(&unused, "CONOUT$", "w", stderr)) { + _dup2(_fileno(stdout), 2); + } + std::ios::sync_with_stdio(); + FlutterDesktopResyncOutputStreams(); + } +} + +std::vector GetCommandLineArguments() { + // Convert the UTF-16 command line arguments to UTF-8 for the Engine to use. + int argc; + wchar_t** argv = ::CommandLineToArgvW(::GetCommandLineW(), &argc); + if (argv == nullptr) { + return std::vector(); + } + + std::vector command_line_arguments; + + // Skip the first argument as it's the binary name. + for (int i = 1; i < argc; i++) { + command_line_arguments.push_back(Utf8FromUtf16(argv[i])); + } + + ::LocalFree(argv); + + return command_line_arguments; +} + +std::string Utf8FromUtf16(const wchar_t* utf16_string) { + if (utf16_string == nullptr) { + return std::string(); + } + unsigned int target_length = ::WideCharToMultiByte( + CP_UTF8, WC_ERR_INVALID_CHARS, utf16_string, + -1, nullptr, 0, nullptr, nullptr) + -1; // remove the trailing null character + int input_length = (int)wcslen(utf16_string); + std::string utf8_string; + if (target_length == 0 || target_length > utf8_string.max_size()) { + return utf8_string; + } + utf8_string.resize(target_length); + int converted_length = ::WideCharToMultiByte( + CP_UTF8, WC_ERR_INVALID_CHARS, utf16_string, + input_length, utf8_string.data(), target_length, nullptr, nullptr); + if (converted_length == 0) { + return std::string(); + } + return utf8_string; +} diff --git a/cupertino_gallery/windows/runner/utils.h b/cupertino_gallery/windows/runner/utils.h new file mode 100644 index 000000000..3879d5475 --- /dev/null +++ b/cupertino_gallery/windows/runner/utils.h @@ -0,0 +1,19 @@ +#ifndef RUNNER_UTILS_H_ +#define RUNNER_UTILS_H_ + +#include +#include + +// Creates a console for the process, and redirects stdout and stderr to +// it for both the runner and the Flutter library. +void CreateAndAttachConsole(); + +// Takes a null-terminated wchar_t* encoded in UTF-16 and returns a std::string +// encoded in UTF-8. Returns an empty std::string on failure. +std::string Utf8FromUtf16(const wchar_t* utf16_string); + +// Gets the command line arguments passed in as a std::vector, +// encoded in UTF-8. Returns an empty std::vector on failure. +std::vector GetCommandLineArguments(); + +#endif // RUNNER_UTILS_H_ diff --git a/cupertino_gallery/windows/runner/win32_window.cpp b/cupertino_gallery/windows/runner/win32_window.cpp new file mode 100644 index 000000000..60608d0fe --- /dev/null +++ b/cupertino_gallery/windows/runner/win32_window.cpp @@ -0,0 +1,288 @@ +#include "win32_window.h" + +#include +#include + +#include "resource.h" + +namespace { + +/// Window attribute that enables dark mode window decorations. +/// +/// Redefined in case the developer's machine has a Windows SDK older than +/// version 10.0.22000.0. +/// See: https://docs.microsoft.com/windows/win32/api/dwmapi/ne-dwmapi-dwmwindowattribute +#ifndef DWMWA_USE_IMMERSIVE_DARK_MODE +#define DWMWA_USE_IMMERSIVE_DARK_MODE 20 +#endif + +constexpr const wchar_t kWindowClassName[] = L"FLUTTER_RUNNER_WIN32_WINDOW"; + +/// Registry key for app theme preference. +/// +/// A value of 0 indicates apps should use dark mode. A non-zero or missing +/// value indicates apps should use light mode. +constexpr const wchar_t kGetPreferredBrightnessRegKey[] = + L"Software\\Microsoft\\Windows\\CurrentVersion\\Themes\\Personalize"; +constexpr const wchar_t kGetPreferredBrightnessRegValue[] = L"AppsUseLightTheme"; + +// The number of Win32Window objects that currently exist. +static int g_active_window_count = 0; + +using EnableNonClientDpiScaling = BOOL __stdcall(HWND hwnd); + +// Scale helper to convert logical scaler values to physical using passed in +// scale factor +int Scale(int source, double scale_factor) { + return static_cast(source * scale_factor); +} + +// Dynamically loads the |EnableNonClientDpiScaling| from the User32 module. +// This API is only needed for PerMonitor V1 awareness mode. +void EnableFullDpiSupportIfAvailable(HWND hwnd) { + HMODULE user32_module = LoadLibraryA("User32.dll"); + if (!user32_module) { + return; + } + auto enable_non_client_dpi_scaling = + reinterpret_cast( + GetProcAddress(user32_module, "EnableNonClientDpiScaling")); + if (enable_non_client_dpi_scaling != nullptr) { + enable_non_client_dpi_scaling(hwnd); + } + FreeLibrary(user32_module); +} + +} // namespace + +// Manages the Win32Window's window class registration. +class WindowClassRegistrar { + public: + ~WindowClassRegistrar() = default; + + // Returns the singleton registrar instance. + static WindowClassRegistrar* GetInstance() { + if (!instance_) { + instance_ = new WindowClassRegistrar(); + } + return instance_; + } + + // Returns the name of the window class, registering the class if it hasn't + // previously been registered. + const wchar_t* GetWindowClass(); + + // Unregisters the window class. Should only be called if there are no + // instances of the window. + void UnregisterWindowClass(); + + private: + WindowClassRegistrar() = default; + + static WindowClassRegistrar* instance_; + + bool class_registered_ = false; +}; + +WindowClassRegistrar* WindowClassRegistrar::instance_ = nullptr; + +const wchar_t* WindowClassRegistrar::GetWindowClass() { + if (!class_registered_) { + WNDCLASS window_class{}; + window_class.hCursor = LoadCursor(nullptr, IDC_ARROW); + window_class.lpszClassName = kWindowClassName; + window_class.style = CS_HREDRAW | CS_VREDRAW; + window_class.cbClsExtra = 0; + window_class.cbWndExtra = 0; + window_class.hInstance = GetModuleHandle(nullptr); + window_class.hIcon = + LoadIcon(window_class.hInstance, MAKEINTRESOURCE(IDI_APP_ICON)); + window_class.hbrBackground = 0; + window_class.lpszMenuName = nullptr; + window_class.lpfnWndProc = Win32Window::WndProc; + RegisterClass(&window_class); + class_registered_ = true; + } + return kWindowClassName; +} + +void WindowClassRegistrar::UnregisterWindowClass() { + UnregisterClass(kWindowClassName, nullptr); + class_registered_ = false; +} + +Win32Window::Win32Window() { + ++g_active_window_count; +} + +Win32Window::~Win32Window() { + --g_active_window_count; + Destroy(); +} + +bool Win32Window::Create(const std::wstring& title, + const Point& origin, + const Size& size) { + Destroy(); + + const wchar_t* window_class = + WindowClassRegistrar::GetInstance()->GetWindowClass(); + + const POINT target_point = {static_cast(origin.x), + static_cast(origin.y)}; + HMONITOR monitor = MonitorFromPoint(target_point, MONITOR_DEFAULTTONEAREST); + UINT dpi = FlutterDesktopGetDpiForMonitor(monitor); + double scale_factor = dpi / 96.0; + + HWND window = CreateWindow( + window_class, title.c_str(), WS_OVERLAPPEDWINDOW, + Scale(origin.x, scale_factor), Scale(origin.y, scale_factor), + Scale(size.width, scale_factor), Scale(size.height, scale_factor), + nullptr, nullptr, GetModuleHandle(nullptr), this); + + if (!window) { + return false; + } + + UpdateTheme(window); + + return OnCreate(); +} + +bool Win32Window::Show() { + return ShowWindow(window_handle_, SW_SHOWNORMAL); +} + +// static +LRESULT CALLBACK Win32Window::WndProc(HWND const window, + UINT const message, + WPARAM const wparam, + LPARAM const lparam) noexcept { + if (message == WM_NCCREATE) { + auto window_struct = reinterpret_cast(lparam); + SetWindowLongPtr(window, GWLP_USERDATA, + reinterpret_cast(window_struct->lpCreateParams)); + + auto that = static_cast(window_struct->lpCreateParams); + EnableFullDpiSupportIfAvailable(window); + that->window_handle_ = window; + } else if (Win32Window* that = GetThisFromHandle(window)) { + return that->MessageHandler(window, message, wparam, lparam); + } + + return DefWindowProc(window, message, wparam, lparam); +} + +LRESULT +Win32Window::MessageHandler(HWND hwnd, + UINT const message, + WPARAM const wparam, + LPARAM const lparam) noexcept { + switch (message) { + case WM_DESTROY: + window_handle_ = nullptr; + Destroy(); + if (quit_on_close_) { + PostQuitMessage(0); + } + return 0; + + case WM_DPICHANGED: { + auto newRectSize = reinterpret_cast(lparam); + LONG newWidth = newRectSize->right - newRectSize->left; + LONG newHeight = newRectSize->bottom - newRectSize->top; + + SetWindowPos(hwnd, nullptr, newRectSize->left, newRectSize->top, newWidth, + newHeight, SWP_NOZORDER | SWP_NOACTIVATE); + + return 0; + } + case WM_SIZE: { + RECT rect = GetClientArea(); + if (child_content_ != nullptr) { + // Size and position the child window. + MoveWindow(child_content_, rect.left, rect.top, rect.right - rect.left, + rect.bottom - rect.top, TRUE); + } + return 0; + } + + case WM_ACTIVATE: + if (child_content_ != nullptr) { + SetFocus(child_content_); + } + return 0; + + case WM_DWMCOLORIZATIONCOLORCHANGED: + UpdateTheme(hwnd); + return 0; + } + + return DefWindowProc(window_handle_, message, wparam, lparam); +} + +void Win32Window::Destroy() { + OnDestroy(); + + if (window_handle_) { + DestroyWindow(window_handle_); + window_handle_ = nullptr; + } + if (g_active_window_count == 0) { + WindowClassRegistrar::GetInstance()->UnregisterWindowClass(); + } +} + +Win32Window* Win32Window::GetThisFromHandle(HWND const window) noexcept { + return reinterpret_cast( + GetWindowLongPtr(window, GWLP_USERDATA)); +} + +void Win32Window::SetChildContent(HWND content) { + child_content_ = content; + SetParent(content, window_handle_); + RECT frame = GetClientArea(); + + MoveWindow(content, frame.left, frame.top, frame.right - frame.left, + frame.bottom - frame.top, true); + + SetFocus(child_content_); +} + +RECT Win32Window::GetClientArea() { + RECT frame; + GetClientRect(window_handle_, &frame); + return frame; +} + +HWND Win32Window::GetHandle() { + return window_handle_; +} + +void Win32Window::SetQuitOnClose(bool quit_on_close) { + quit_on_close_ = quit_on_close; +} + +bool Win32Window::OnCreate() { + // No-op; provided for subclasses. + return true; +} + +void Win32Window::OnDestroy() { + // No-op; provided for subclasses. +} + +void Win32Window::UpdateTheme(HWND const window) { + DWORD light_mode; + DWORD light_mode_size = sizeof(light_mode); + LSTATUS result = RegGetValue(HKEY_CURRENT_USER, kGetPreferredBrightnessRegKey, + kGetPreferredBrightnessRegValue, + RRF_RT_REG_DWORD, nullptr, &light_mode, + &light_mode_size); + + if (result == ERROR_SUCCESS) { + BOOL enable_dark_mode = light_mode == 0; + DwmSetWindowAttribute(window, DWMWA_USE_IMMERSIVE_DARK_MODE, + &enable_dark_mode, sizeof(enable_dark_mode)); + } +} diff --git a/cupertino_gallery/windows/runner/win32_window.h b/cupertino_gallery/windows/runner/win32_window.h new file mode 100644 index 000000000..e901dde68 --- /dev/null +++ b/cupertino_gallery/windows/runner/win32_window.h @@ -0,0 +1,102 @@ +#ifndef RUNNER_WIN32_WINDOW_H_ +#define RUNNER_WIN32_WINDOW_H_ + +#include + +#include +#include +#include + +// A class abstraction for a high DPI-aware Win32 Window. Intended to be +// inherited from by classes that wish to specialize with custom +// rendering and input handling +class Win32Window { + public: + struct Point { + unsigned int x; + unsigned int y; + Point(unsigned int x, unsigned int y) : x(x), y(y) {} + }; + + struct Size { + unsigned int width; + unsigned int height; + Size(unsigned int width, unsigned int height) + : width(width), height(height) {} + }; + + Win32Window(); + virtual ~Win32Window(); + + // Creates a win32 window with |title| that is positioned and sized using + // |origin| and |size|. New windows are created on the default monitor. Window + // sizes are specified to the OS in physical pixels, hence to ensure a + // consistent size this function will scale the inputted width and height as + // as appropriate for the default monitor. The window is invisible until + // |Show| is called. Returns true if the window was created successfully. + bool Create(const std::wstring& title, const Point& origin, const Size& size); + + // Show the current window. Returns true if the window was successfully shown. + bool Show(); + + // Release OS resources associated with window. + void Destroy(); + + // Inserts |content| into the window tree. + void SetChildContent(HWND content); + + // Returns the backing Window handle to enable clients to set icon and other + // window properties. Returns nullptr if the window has been destroyed. + HWND GetHandle(); + + // If true, closing this window will quit the application. + void SetQuitOnClose(bool quit_on_close); + + // Return a RECT representing the bounds of the current client area. + RECT GetClientArea(); + + protected: + // Processes and route salient window messages for mouse handling, + // size change and DPI. Delegates handling of these to member overloads that + // inheriting classes can handle. + virtual LRESULT MessageHandler(HWND window, + UINT const message, + WPARAM const wparam, + LPARAM const lparam) noexcept; + + // Called when CreateAndShow is called, allowing subclass window-related + // setup. Subclasses should return false if setup fails. + virtual bool OnCreate(); + + // Called when Destroy is called. + virtual void OnDestroy(); + + private: + friend class WindowClassRegistrar; + + // OS callback called by message pump. Handles the WM_NCCREATE message which + // is passed when the non-client area is being created and enables automatic + // non-client DPI scaling so that the non-client area automatically + // responds to changes in DPI. All other messages are handled by + // MessageHandler. + static LRESULT CALLBACK WndProc(HWND const window, + UINT const message, + WPARAM const wparam, + LPARAM const lparam) noexcept; + + // Retrieves a class instance pointer for |window| + static Win32Window* GetThisFromHandle(HWND const window) noexcept; + + // Update the window frame's theme to match the system theme. + static void UpdateTheme(HWND const window); + + bool quit_on_close_ = false; + + // window handle for top level window. + HWND window_handle_ = nullptr; + + // window handle for hosted content. + HWND child_content_ = nullptr; +}; + +#endif // RUNNER_WIN32_WINDOW_H_ diff --git a/desktop_photo_search/fluent_ui/tool/grind.dart b/desktop_photo_search/fluent_ui/tool/grind.dart index 4bd6473af..a672fec31 100644 --- a/desktop_photo_search/fluent_ui/tool/grind.dart +++ b/desktop_photo_search/fluent_ui/tool/grind.dart @@ -32,7 +32,7 @@ Future generateJsonBindings() async => _logProcessOutput( @Task() Future watch() async => _logProcessOutput( - Process.start('flutter', ['pub', 'run', 'build_runner', 'watch']), + Process.start('dart', ['run', 'build_runner', 'watch']), ); @Task() diff --git a/desktop_photo_search/material/tool/grind.dart b/desktop_photo_search/material/tool/grind.dart index 4bd6473af..a672fec31 100644 --- a/desktop_photo_search/material/tool/grind.dart +++ b/desktop_photo_search/material/tool/grind.dart @@ -32,7 +32,7 @@ Future generateJsonBindings() async => _logProcessOutput( @Task() Future watch() async => _logProcessOutput( - Process.start('flutter', ['pub', 'run', 'build_runner', 'watch']), + Process.start('dart', ['run', 'build_runner', 'watch']), ); @Task() diff --git a/dynamic_theme/lib/widgets/message_widget.dart b/dynamic_theme/lib/widgets/message_widget.dart index 74b45df1a..59603ca07 100644 --- a/dynamic_theme/lib/widgets/message_widget.dart +++ b/dynamic_theme/lib/widgets/message_widget.dart @@ -48,7 +48,7 @@ class MessageWidget extends StatelessWidget { child: Column( children: [ if (text case final text?) MarkdownBody(data: text), - if (image case final image?) image, + ?image, ], ), ), diff --git a/game_template/README.md b/game_template/README.md index c8d6004bc..8fef7b7e8 100644 --- a/game_template/README.md +++ b/game_template/README.md @@ -69,7 +69,7 @@ lib The state management approach is intentionally low-level. That way, it's easy to take this project and run with it, without having to learn new paradigms, or having -to remember to run `flutter pub run build_runner watch`. You are, +to remember to run `dart run build_runner watch`. You are, of course, encouraged to use whatever paradigm, helper package or code generation scheme that you prefer. @@ -522,7 +522,7 @@ To update the launcher icon, first change the files Then, run the following: ```bash -flutter pub run flutter_launcher_icons:main +dart run flutter_launcher_icons:main ``` You can [configure](https://github.com/fluttercommunity/flutter_launcher_icons#book-guide) diff --git a/gemini_tasks/lib/widgets/message_widget.dart b/gemini_tasks/lib/widgets/message_widget.dart index 74b45df1a..59603ca07 100644 --- a/gemini_tasks/lib/widgets/message_widget.dart +++ b/gemini_tasks/lib/widgets/message_widget.dart @@ -48,7 +48,7 @@ class MessageWidget extends StatelessWidget { child: Column( children: [ if (text case final text?) MarkdownBody(data: text), - if (image case final image?) image, + ?image, ], ), ), diff --git a/material_3_demo/test/component_screen_test.dart b/material_3_demo/test/component_screen_test.dart index 7f088a7a7..16169f511 100644 --- a/material_3_demo/test/component_screen_test.dart +++ b/material_3_demo/test/component_screen_test.dart @@ -261,205 +261,6 @@ void main() { expect(box.localToGlobal(Offset.zero), const Offset(0.0, 3080.0)); }, ); - - testWidgets( - 'Material version switches between Material3 and Material2 when ' - 'the version icon is clicked', - (tester) async { - widgetSetup(tester, 450, windowHeight: 7000); - await tester.pumpWidget(const App()); - BuildContext defaultElevatedButton = tester.firstElement( - find.byType(ElevatedButton), - ); - BuildContext defaultIconButton = tester.firstElement( - find.byType(IconButton), - ); - BuildContext defaultFAB = tester.firstElement( - find.byType(FloatingActionButton), - ); - BuildContext defaultCard = tester.firstElement( - find.widgetWithText(Card, 'Elevated'), - ); - BuildContext defaultChip = tester.firstElement( - find.widgetWithText(ActionChip, 'Assist'), - ); - Finder dialog = find.text('Show dialog'); - await tester.tap(dialog); - await tester.pumpAndSettle(const Duration(microseconds: 500)); - BuildContext defaultAlertDialog = tester.element( - find.byType(AlertDialog), - ); - expect(Theme.of(defaultAlertDialog).useMaterial3, true); - Finder dismiss = find.text('Okay'); - await tester.tap(dismiss); - await tester.pumpAndSettle(const Duration(microseconds: 500)); - - expect(find.widgetWithIcon(AppBar, Icons.filter_2), findsOneWidget); - expect(find.widgetWithIcon(AppBar, Icons.filter_3), findsNothing); - expect(find.text('Material 3'), findsOneWidget); - expect(Theme.of(defaultElevatedButton).useMaterial3, true); - expect(Theme.of(defaultIconButton).useMaterial3, true); - expect(Theme.of(defaultFAB).useMaterial3, true); - expect(Theme.of(defaultCard).useMaterial3, true); - expect(Theme.of(defaultChip).useMaterial3, true); - - Finder appbarM3Icon = find.descendant( - of: find.byType(AppBar), - matching: find.widgetWithIcon(IconButton, Icons.filter_2), - ); - await tester.tap(appbarM3Icon); - await tester.pumpAndSettle(const Duration(microseconds: 500)); - BuildContext updatedElevatedButton = tester.firstElement( - find.byType(ElevatedButton), - ); - BuildContext updatedIconButton = tester.firstElement( - find.byType(IconButton), - ); - BuildContext updatedFAB = tester.firstElement( - find.byType(FloatingActionButton), - ); - BuildContext updatedCard = tester.firstElement(find.byType(Card)); - BuildContext updatedChip = tester.firstElement( - find.widgetWithText(ActionChip, 'Assist'), - ); - Finder updatedDialog = find.text('Show dialog'); - await tester.tap(updatedDialog); - await tester.pumpAndSettle(const Duration(microseconds: 500)); - BuildContext updatedAlertDialog = tester.firstElement( - find.byType(AlertDialog), - ); - expect(Theme.of(updatedAlertDialog).useMaterial3, false); - Finder updatedDismiss = find.text('Dismiss'); - await tester.tap(updatedDismiss); - await tester.pumpAndSettle(const Duration(microseconds: 500)); - - expect(find.widgetWithIcon(AppBar, Icons.filter_3), findsOneWidget); - expect(find.widgetWithIcon(AppBar, Icons.filter_2), findsNothing); - expect(find.text('Material 2'), findsOneWidget); - expect(Theme.of(updatedElevatedButton).useMaterial3, false); - expect(Theme.of(updatedIconButton).useMaterial3, false); - expect(Theme.of(updatedFAB).useMaterial3, false); - expect(Theme.of(updatedCard).useMaterial3, false); - expect(Theme.of(updatedChip).useMaterial3, false); - }, - ); - - testWidgets( - 'Other screens become Material2 mode after changing mode from ' - 'main screen', - (tester) async { - await tester.pumpWidget(const App()); - Finder appbarM2Icon = find.descendant( - of: find.byType(AppBar), - matching: find.widgetWithIcon(IconButton, Icons.filter_2), - ); - await tester.tap(appbarM2Icon); - Finder secondScreenIcon = find.descendant( - of: find.byType(NavigationBar), - matching: find.widgetWithIcon( - NavigationDestination, - Icons.format_paint_outlined, - ), - ); - await tester.tap(secondScreenIcon); - await tester.pumpAndSettle(const Duration(microseconds: 500)); - BuildContext lightThemeText = tester.element( - find.text('Light ColorScheme'), - ); - expect(Theme.of(lightThemeText).useMaterial3, false); - Finder thirdScreenIcon = find.descendant( - of: find.byType(NavigationBar), - matching: find.widgetWithIcon( - NavigationDestination, - Icons.text_snippet_outlined, - ), - ); - await tester.tap(thirdScreenIcon); - await tester.pumpAndSettle(const Duration(microseconds: 500)); - BuildContext displayLargeText = tester.element( - find.text('Display Large'), - ); - expect(Theme.of(displayLargeText).useMaterial3, false); - Finder fourthScreenIcon = find.descendant( - of: find.byType(NavigationBar), - matching: find.widgetWithIcon( - NavigationDestination, - Icons.invert_colors_on_outlined, - ), - ); - await tester.tap(fourthScreenIcon); - await tester.pumpAndSettle(const Duration(microseconds: 500)); - BuildContext material = tester.firstElement(find.byType(Material)); - expect(Theme.of(material).useMaterial3, false); - }, - ); - - testWidgets('Brightness mode switches between dark and light when' - 'the brightness icon is clicked', (tester) async { - await tester.pumpWidget(const App()); - Finder lightIcon = find.descendant( - of: find.byType(AppBar), - matching: find.widgetWithIcon(IconButton, Icons.light_mode_outlined), - ); - Finder darkIcon = find.descendant( - of: find.byType(AppBar), - matching: find.widgetWithIcon(IconButton, Icons.dark_mode_outlined), - ); - BuildContext appBar = tester.element(find.byType(AppBar).first); - BuildContext body = tester.firstElement(find.byType(Scaffold).first); - BuildContext navigationRail = tester.element( - find.widgetWithIcon(NavigationRail, Icons.format_paint_outlined), - ); - expect(darkIcon, findsOneWidget); - expect(lightIcon, findsNothing); - expect(Theme.of(appBar).brightness, Brightness.light); - expect(Theme.of(body).brightness, Brightness.light); - expect(Theme.of(navigationRail).brightness, Brightness.light); - await tester.tap(darkIcon); - await tester.pumpAndSettle(const Duration(microseconds: 500)); - - BuildContext appBar2 = tester.element(find.byType(AppBar).first); - BuildContext body2 = tester.element(find.byType(Scaffold).first); - BuildContext navigationRail2 = tester.element( - find.widgetWithIcon(NavigationRail, Icons.format_paint_outlined), - ); - - expect(darkIcon, findsNothing); - expect(lightIcon, findsOneWidget); - expect(Theme.of(appBar2).brightness, Brightness.dark); - expect(Theme.of(body2).brightness, Brightness.dark); - expect(Theme.of(navigationRail2).brightness, Brightness.dark); - }); - - testWidgets('Color theme changes when a color is selected from menu', ( - tester, - ) async { - Color m3BaseColor = const Color(0xff65558f); - await tester.pumpWidget(Container()); - await tester.pumpWidget(const App()); - await tester.pump(); - Finder menuIcon = find.descendant( - of: find.byType(AppBar), - matching: find.widgetWithIcon(IconButton, Icons.palette_outlined), - ); - BuildContext appBar = tester.element( - find.widgetWithIcon(AppBar, Icons.palette_outlined).first, - ); - BuildContext body = tester.element(find.byType(Scaffold).first); - - expect(Theme.of(appBar).primaryColor, m3BaseColor); - expect(Theme.of(body).primaryColor, m3BaseColor); - await tester.tap(menuIcon); - await tester.pumpAndSettle(); - await tester.tap(find.text('Blue').last); - await tester.pumpAndSettle(); - - BuildContext appBar2 = tester.element(find.byType(AppBar).first); - BuildContext body2 = tester.element(find.byType(Scaffold).first); - ThemeData expectedTheme = ThemeData(colorSchemeSeed: Colors.blue); - expect(Theme.of(appBar2).primaryColor, expectedTheme.primaryColor); - expect(Theme.of(body2).primaryColor, expectedTheme.primaryColor); - }); } void widgetSetup( diff --git a/pedometer/ffigen.yaml b/pedometer/ffigen.yaml index 894b3f14f..b55ca65f8 100644 --- a/pedometer/ffigen.yaml +++ b/pedometer/ffigen.yaml @@ -1,4 +1,4 @@ -# Run with `flutter pub run ffigen --config ffigen.yaml`. +# Run with `dart run ffigen --config ffigen.yaml`. name: PedometerBindings description: "Bindings for CM pedometers" language: objc diff --git a/pubspec.yaml b/pubspec.yaml index b7d3e3c24..ef0e64881 100644 --- a/pubspec.yaml +++ b/pubspec.yaml @@ -6,6 +6,7 @@ environment: workspace: - add_to_app/android_view/flutter_module_using_plugin_android_view + - add_to_app/android_view/flutter_module_using_plugin_content_sizing_android_view - add_to_app/books/flutter_module_books - add_to_app/fullscreen/flutter_module_fullscreen - add_to_app/multiple_flutters/multiple_flutters_module @@ -15,6 +16,7 @@ workspace: - android_splash_screen - animations - asset_transformation + - asset_transformation/grayscale_transformer - background_isolate_channels - code_sharing/client - code_sharing/server @@ -51,3 +53,12 @@ workspace: - tool - web_embedding/element_embedding_demo - web_embedding/ng-flutter/flutter + +skip_ci: + - add_to_app/android_view/flutter_module_using_plugin_android_view + - add_to_app/android_view/flutter_module_using_plugin_content_sizing_android_view + - add_to_app/books/flutter_module_books + - add_to_app/fullscreen/flutter_module_fullscreen + - add_to_app/multiple_flutters/multiple_flutters_module + - add_to_app/plugin/flutter_module_using_plugin + - add_to_app/prebuilt_module/flutter_module diff --git a/tool/ci_script.dart b/tool/ci_script.dart index 3274aba8c..8aad89725 100644 --- a/tool/ci_script.dart +++ b/tool/ci_script.dart @@ -14,10 +14,15 @@ Future main() async { exit(1); } + final skipCiList = pubspecYaml['skip_ci'] as YamlList?; + // pub workspace, only run 'get' once await _runCommand('flutter', ['pub', 'get'], workingDirectory: rootDir.path); - final packages = workspace.map((e) => e.toString()).toList(); + final packages = workspace + .where((e) => skipCiList == null || !skipCiList.contains(e)) + .map((e) => e.toString()) + .toList(); for (final package in packages) { final packagePath = path.join(rootDir.path, package); diff --git a/tool/ci_with_channel.dart b/tool/ci_with_channel.dart new file mode 100644 index 000000000..47a39f16d --- /dev/null +++ b/tool/ci_with_channel.dart @@ -0,0 +1,137 @@ +import 'dart:io'; +import 'package:args/args.dart'; +import 'package:path/path.dart' as path; +import 'package:yaml/yaml.dart'; + +/// Do not use this with GitHub Actions. It is a convenience script for running +/// CI locally. +/// +/// Usage: dart tool/ci_with_channel.dart -c stable,beta + +Future main(List args) async { + final parser = ArgParser() + ..addFlag( + 'help', + abbr: 'h', + negatable: false, + help: 'Print this usage information.', + ) + ..addOption( + 'channels', + abbr: 'c', + help: + 'Comma-separated list of channels to run on (e.g., stable,beta,main)', + ); + + final results = parser.parse(args); + + if (results['help'] as bool) { + print(parser.usage); + return; + } + + final channelsArg = results['channels'] as String?; + + List channels; + if (channelsArg != null) { + channels = channelsArg.split(',').map((c) => c.trim()).toList(); + } else { + // Default to current channel if none specified + channels = []; + } + + final rootDir = Directory.current; + final originalChannel = await _getCurrentChannel(); + + try { + if (channels.isEmpty) { + print('Running on current channel: $originalChannel'); + await _runCI(rootDir); + } else { + for (final channel in channels) { + print('\n=== Switching to channel: $channel ==='); + await _runCommand('flutter', ['channel', channel]); + await _runCommand('flutter', ['doctor']); + await _runCI(rootDir); + } + } + } finally { + if (channels.isNotEmpty && originalChannel != null) { + print('\n=== Switching back to original channel: $originalChannel ==='); + await _runCommand('flutter', ['channel', originalChannel]); + } + } +} + +Future _getCurrentChannel() async { + final result = await Process.run('flutter', ['channel']); + if (result.exitCode != 0) { + return null; + } + final output = result.stdout as String; + final match = RegExp(r'\* (\w+)').firstMatch(output); + return match?.group(1); +} + +Future _runCI(Directory rootDir) async { + final pubspecFile = File(path.join(rootDir.path, 'pubspec.yaml')); + final pubspecContent = await pubspecFile.readAsString(); + final pubspecYaml = loadYaml(pubspecContent); + + final workspace = pubspecYaml['workspace'] as YamlList?; + if (workspace == null) { + print('No workspace found in pubspec.yaml'); + exit(1); + } + + // pub workspace, only run 'get' once + await _runCommand('flutter', ['pub', 'get'], workingDirectory: rootDir.path); + + final packages = workspace.map((e) => e.toString()).toList(); + + for (final package in packages) { + final packagePath = path.join(rootDir.path, package); + print('== Testing \'$package\' =='); + await _runCommand('dart', [ + 'analyze', + '--fatal-infos', + '--fatal-warnings', + ], workingDirectory: packagePath); + + await _runCommand('dart', ['format', '.'], workingDirectory: packagePath); + + if (await Directory(path.join(packagePath, 'test')).exists()) { + final packagePubspecFile = File(path.join(packagePath, 'pubspec.yaml')); + final packagePubspecContent = await packagePubspecFile.readAsString(); + if (packagePubspecContent.contains('flutter:')) { + await _runCommand('flutter', [ + 'test', + '--no-pub', + ], workingDirectory: packagePath); + } else { + await _runCommand('dart', ['test'], workingDirectory: packagePath); + } + } + } +} + +Future _runCommand( + String executable, + List arguments, { + String? workingDirectory, +}) async { + final process = await Process.start( + executable, + arguments, + workingDirectory: workingDirectory, + runInShell: true, + mode: ProcessStartMode.inheritStdio, + ); + final exitCode = await process.exitCode; + if (exitCode != 0) { + print( + 'Command "$executable ${arguments.join(' ')}" failed with exit code $exitCode in $workingDirectory', + ); + exit(exitCode); + } +} diff --git a/web_embedding/ng-flutter/package.json b/web_embedding/ng-flutter/package.json index 6897739f3..cca76129f 100644 --- a/web_embedding/ng-flutter/package.json +++ b/web_embedding/ng-flutter/package.json @@ -11,26 +11,26 @@ }, "private": true, "dependencies": { - "@angular/animations": "^20.0.3", - "@angular/cdk": "^20.1.0", - "@angular/common": "^20.1.4", - "@angular/compiler": "^20.0.6", + "@angular/animations": "^21.1.1", + "@angular/cdk": "^21.1.2", + "@angular/common": "^21.1.1", + "@angular/compiler": "^21.1.0", "@angular/core": "^20.0.3", - "@angular/forms": "^20.1.2", - "@angular/material": "^20.1.0", + "@angular/forms": "^21.1.0", + "@angular/material": "^21.1.1", "@angular/platform-browser": "^20.0.3", - "@angular/platform-browser-dynamic": "^20.1.0", - "@angular/router": "^20.0.3", + "@angular/platform-browser-dynamic": "^21.1.2", + "@angular/router": "^21.1.0", "rxjs": "~7.8.1", "tslib": "^2.6.2", "zone.js": "~0.15.0" }, "devDependencies": { - "@angular-devkit/build-angular": "^20.0.2", - "@angular/cli": "~20.1.0", + "@angular-devkit/build-angular": "^21.1.2", + "@angular/cli": "~21.1.1", "@angular/compiler-cli": "^20.0.3", - "@types/jasmine": "~5.1.0", - "jasmine-core": "~5.5.0", + "@types/jasmine": "~6.0.0", + "jasmine-core": "~6.0.0", "karma": "~6.4.2", "karma-chrome-launcher": "~3.2.0", "karma-coverage": "~2.2.0",